/irc-logs / freenode / #html5 / 2011-01-14 / end

Options:

  1. # Session Start: Fri Jan 14 00:00:00 2011
  2. # Session Ident: #html5
  3. # [00:00] <tw2113> i can't remember who, but someone in here mentioned my handwrittentweet site idea not being the most accessible, and i am going to do what i can to make it as assessible as can be :D
  4. # [00:00] * Quits: Wooboy (~simon@host-85-201-35-70.brutele.be) (Remote host closed the connection)
  5. # [00:02] <danielfilho> good boy :D
  6. # [00:03] <tw2113> i was thinking about having a custom field in wordpress where I type up what it says in the image with the actual tweet, and put it somewhere in the markup for possible screenreaders
  7. # [00:03] <tw2113> or just put it in the_content() and apply text indent on it
  8. # [00:06] * Quits: jetienne (~jerome@ivr94-6-82-230-255-246.fbx.proxad.net) (Read error: Operation timed out)
  9. # [00:08] <danielfilho> http://jhische.com/workforfree.html
  10. # [00:14] * Quits: lukegalea (~lukegalea@74.198.87.95) (Quit: lukegalea)
  11. # [00:14] * Quits: paul_irish (~paul_iris@216.239.45.19)
  12. # [00:17] * Quits: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
  13. # [00:17] * Joins: jacine (~jacine@drupal.org/user/88931/view)
  14. # [00:17] * Parts: jacine (~jacine@drupal.org/user/88931/view)
  15. # [00:20] <antonkovalyov> wait what
  16. # [00:21] <antonkovalyov> paul_irish is not here O_O
  17. # [00:21] * Quits: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com) (Remote host closed the connection)
  18. # [00:21] <antonkovalyov> have you guys noticed how slow twitter is in chrome?
  19. # [00:21] * Joins: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com)
  20. # [00:23] <tw2113> this is cool http://www.massiveblue.com/
  21. # [00:24] <tw2113> i wonder if i could trigger css3 animation just from moving my mouse away from a :hover
  22. # [00:24] <thatryan> you mean like do it backwards?
  23. # [00:24] <tw2113> sort of
  24. # [00:24] <cgcardona> wow that is cool tw2113
  25. # [00:24] <tw2113> i was thinking set some animation on the hover where it turns to this color
  26. # [00:24] <tw2113> and then when i move it away, it gradually goes back to the original
  27. # [00:25] <thatryan> isnt that what it does anyways...
  28. # [00:25] * Quits: kor (~kor@a83-161-211-173.adsl.xs4all.nl) (Quit: kor)
  29. # [00:25] <thatryan> i fade in my links on hover, then they fade back to original on off...
  30. # [00:27] <tw2113> it may have solved my question of how to do hypercolors
  31. # [00:27] <tw2113> in web design
  32. # [00:28] * ajpiano is now known as ajdatalistpiano
  33. # [00:29] * ajdatalistpiano is now known as ajpiano
  34. # [00:30] * Joins: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
  35. # [00:31] <antonkovalyov> ?help
  36. # [00:31] <bot-t> Get FREE A++ HELP - http://workaround.org/getting-help-on-irc
  37. # [00:32] <antonkovalyov> ?tell paul_irish your HTML5 Boilerplate talk is on the same day as Day of JS conf
  38. # [00:32] <bot-t> antonkovalyov, Okay.
  39. # [00:32] <antonkovalyov> ?ty
  40. # [00:32] <bot-t> antonkovalyov, (TY) Drop Down small or mega menu with elegent effects | jQuery ... - This is to provide a good alternative for having both Mega Menu like flexibility in content display size/structure with very little code. The code is VERY simple, yet builds a powerful drop down me... http://plugins.jquery.com/project/TYmegaMenu
  41. # [00:32] <antonkovalyov> :( no ai
  42. # [00:32] <thatryan> what just happened lol
  43. # [00:33] <antonkovalyov> thatryan, i think ?tell saves a message for somebody who is not here atm
  44. # [00:34] <thatryan> ahh
  45. # [00:34] <antonkovalyov> and ?ty was supposed to be thank you :)
  46. # [00:34] <thatryan> lol
  47. # [00:34] <thatryan> and instead you got a menu?
  48. # [00:34] <antonkovalyov> i think it just searches for jquery plugins?
  49. # [00:34] <thatryan> paul is giving a boilerplate talk?
  50. # [00:34] <antonkovalyov> ?facebox
  51. # [00:34] <bot-t> antonkovalyov, Facebox | jQuery Plugins - Facebox is a jQuery-based, Facebook-style lightbox which can display images, divs, or entire remote pages. It's easy to use and easy to drive programmatically -- use it for error messages, confirma... http://plugins.jquery.com/project/facebox
  52. # [00:34] <antonkovalyov> yep
  53. # [00:35] <antonkovalyov> http://www.sfhtml5.org/calendar/15728914/
  54. # [00:35] <thatryan> ?super awesome!
  55. # [00:35] <bot-t> thatryan, #7442 (slideDown and slideUp "jump" at the beginning and end ... - Opened 2 months ago http://bugs.jquery.com/ticket/7442
  56. # [00:35] <thatryan> LOL
  57. # [00:35] <antonkovalyov> bot-t, hey
  58. # [00:35] <bot-t> Hey antonkovalyov
  59. # [00:36] <antonkovalyov> bot-t, how it is going?
  60. # [00:36] <bot-t> antonkovalyov, Don't count on it.
  61. # [00:36] <thatryan> fail
  62. # [00:36] <thatryan> bot-t: why do you fail?
  63. # [00:36] <bot-t> thatryan, As I see it, yes.
  64. # [00:36] <antonkovalyov> it reminds me of good ol' days with emacs psychiatrist
  65. # [00:36] * Quits: figital (~figital@64.119.153.2) (Quit: Leaving)
  66. # [00:36] <thatryan> bot-t: has more of a personality when talking with paul_irish lol
  67. # [00:36] <bot-t> thatryan, ThickBox 3.1 - http://jquery.com/demo/thickbox/
  68. # [00:37] <thatryan> hmm
  69. # [00:37] * Quits: dcadenas_ (~dcadenas@r186-48-223-155.dialup.adsl.anteldata.net.uy) (Ping timeout: 260 seconds)
  70. # [00:37] <antonkovalyov> i think it tries to tell you something :)
  71. # [00:38] <thatryan> heh no doubt
  72. # [00:38] <tw2113> damn, it's not working on divs
  73. # [00:39] * Quits: jamesarosen (~jamesaros@204.28.122.178) (Read error: Connection reset by peer)
  74. # [00:39] * Joins: jamesarosen (~jamesaros@204.28.122.178)
  75. # [00:40] * Quits: bckenny (~bckenny@nat/google/x-utbxaahbzolkulzj) (Remote host closed the connection)
  76. # [00:40] * Joins: bckenny (~bckenny@nat/google/x-mtxvakdonxmefasd)
  77. # [00:41] <thatryan> tw2113: heheheh
  78. # [00:42] * Joins: dguttman_ (~dguttman@gige.bur.digisynd.com)
  79. # [00:42] <tw2113> i got it to work for the most part with text
  80. # [00:42] <antonkovalyov> thatryan, did you get on waiting list?
  81. # [00:42] <thatryan> nah
  82. # [00:42] <antonkovalyov> bot-t, do you think thatryan is going to get a spot on day of js conference
  83. # [00:42] <bot-t> antonkovalyov, Is that a question?
  84. # [00:43] <antonkovalyov> bot-t, do you think thatryan is going to get a spot on day of js conference?
  85. # [00:43] <bot-t> antonkovalyov, My sources say no.
  86. # [00:43] <thatryan> lol
  87. # [00:43] <thatryan> HA
  88. # [00:43] <antonkovalyov> haha
  89. # [00:43] <antonkovalyov> thatryan, anyway you should :)
  90. # [00:43] <thatryan> bot-t: do i ride unicorns into battle to slay care bears?
  91. # [00:43] <bot-t> thatryan, Ask again later.
  92. # [00:43] <thatryan> damn
  93. # [00:44] * Quits: jeffszusz (~jeffszusz@dyn216-8-170-154.ADSL.mnsi.net) (Remote host closed the connection)
  94. # [00:45] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Ping timeout: 240 seconds)
  95. # [00:45] * dguttman_ is now known as dguttman
  96. # [00:48] * Joins: temhawk (~temhawk@unaffiliated/temhawk)
  97. # [00:48] * Quits: bckenny (~bckenny@nat/google/x-mtxvakdonxmefasd) (Remote host closed the connection)
  98. # [00:48] * Parts: temhawk (~temhawk@unaffiliated/temhawk) ("Leaving...")
  99. # [00:49] * Joins: bckenny (~bckenny@nat/google/x-cmbrkybesvczhlmj)
  100. # [00:53] <antonkovalyov> ?tell bot-t hello
  101. # [00:53] <bot-t> antonkovalyov, Stop playing with me!
  102. # [00:53] <antonkovalyov> hahaha
  103. # [00:53] <antonkovalyov> awesome
  104. # [00:54] <tw2113> ?8ball why are you telling antonkovalyov to stop playing with you? Is it because you play with yourself already?
  105. # [00:54] <bot-t> Most likely.
  106. # [00:54] <antonkovalyov> ?tell ?tell
  107. # [00:54] <bot-t> antonkovalyov, Syntax: tell <nick> <message>
  108. # [00:54] <antonkovalyov> ?tell ? tell
  109. # [00:54] <antonkovalyov> meh :(
  110. # [00:54] <thatryan> HA that was fnny
  111. # [00:54] <thatryan> bot-t: you dont like to be played with?
  112. # [00:54] <bot-t> thatryan, Outlook good.
  113. # [00:54] <thatryan> bot-t: that makes no sense
  114. # [00:54] <bot-t> thank a lot yu deserve a great makes no sense makes no sense
  115. # [00:55] <thatryan> hhhmmm
  116. # [00:55] <antonkovalyov> ? [1,2,3].join(',')
  117. # [00:55] <bot-t> antonkovalyov, jQuery.map() - Translate all items in an array or array-like object to another array of items. http://api.jquery.com/jQuery.map/
  118. # [00:55] <antonkovalyov> ? eval [1,2,3].join(',')
  119. # [00:55] <bot-t> antonkovalyov: "1,2,3"
  120. # [00:55] <antonkovalyov> keeewl
  121. # [00:57] <thatryan> bot-t: eval lim x->100 ln(1/x)
  122. # [00:57] <bot-t> thatryan: SyntaxError: missing ; before statement
  123. # [00:57] <thatryan> ass
  124. # [00:58] <antonkovalyov> ?uninstall google
  125. # [00:58] <bot-t> OK. 301 Moved Permanently http://bing.com
  126. # [00:58] <thatryan> lol
  127. # [00:58] <ben_c> that's amazing.
  128. # [00:58] <antonkovalyov> ?i hate you
  129. # [00:58] <bot-t> NO U
  130. # [00:59] * Quits: masondesu (~Mason@c-75-64-233-135.hsd1.ms.comcast.net) (Ping timeout: 255 seconds)
  131. # [00:59] * Quits: mikew3c (~MikeSmith@EM114-48-159-251.pool.e-mobile.ne.jp) (Ping timeout: 240 seconds)
  132. # [01:00] <antonkovalyov> ?Douglas Crockford is The Immutable Singleton
  133. # [01:00] <bot-t> antonkovalyov, Jim Higson's blog: Prototype Singleton classes - http://jimhigson.blogspot.com/2009/01/prototype-singleton-classes.html
  134. # [01:00] <thatryan> bot-t: dont be mean
  135. # [01:00] <bot-t> thatryan, Is that a question?
  136. # [01:00] <thatryan> bot-t: no, a statement
  137. # [01:00] <bot-t> thatryan, jQuery.each() - A generic iterator function, which can be used to seamlessly iterate over both objects and arrays. Arrays and array-like objects with a length property (such as a function's arguments object) are i... http://api.jquery.com/jQuery.each/
  138. # [01:01] <antonkovalyov> ? "Douglas Crockford" is "The Immutable Singleton"
  139. # [01:01] <bot-t> antonkovalyov, Couldn't find ""Douglas Crockford" is "The Immutable Singleton"" in jQuery Docs.
  140. # [01:01] <antonkovalyov> bot-t: Douglas Crockford is The Immutable Singleton
  141. # [01:01] <bot-t> antonkovalyov, Stored "Douglas Crockford".
  142. # [01:01] <antonkovalyov> ?Douglas Crockford
  143. # [01:01] <bot-t> The Immutable Singleton
  144. # [01:02] <antonkovalyov> awesome
  145. # [01:02] <thatryan> word
  146. # [01:02] <antonkovalyov> bot-t: should you be open source? is yes!
  147. # [01:02] <bot-t> antonkovalyov, Invalid key: "should you be open source?" (Char 26).
  148. # [01:03] <antonkovalyov> bot-t: should you be open source is yes!
  149. # [01:03] <bot-t> antonkovalyov, Stored "should you be open source".
  150. # [01:03] <antonkovalyov> ?should you be open source
  151. # [01:03] <bot-t> yes!
  152. # [01:03] <thatryan> haha nice
  153. # [01:03] <antonkovalyov> k, i am ready for paul now
  154. # [01:03] <thatryan> uh oh
  155. # [01:03] <thatryan> what did you make a script? ;)
  156. # [01:04] <antonkovalyov> thatryan, hm?
  157. # [01:04] <antonkovalyov> btw guys http://bot-t.com/
  158. # [01:04] <thatryan> hm?
  159. # [01:04] * Quits: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com) (Remote host closed the connection)
  160. # [01:05] <antonkovalyov> "what did you make a script?" my english fails here :(
  161. # [01:05] <antonkovalyov> are you asking if i made bot-t?
  162. # [01:05] <bot-t> antonkovalyov, Better not tell you now.
  163. # [01:05] * Joins: jochen___ (~jochen@nat/google/x-epmmtgbvsnxmmrvn)
  164. # [01:05] <antonkovalyov> godamn, bot-t!
  165. # [01:05] <thatryan> ah, meant did you progra responses into bot to get paul with
  166. # [01:05] <thatryan> lol
  167. # [01:05] * Joins: mikew3c (~MikeSmith@EM111-188-13-191.pool.e-mobile.ne.jp)
  168. # [01:05] <thatryan> program*
  169. # [01:05] <antonkovalyov> thatryan, yeah, you can save factoids
  170. # [01:05] <antonkovalyov> thatryan, http://bot-t.com/docs/
  171. # [01:05] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
  172. # [01:06] <thatryan> jesus
  173. # [01:07] <thatryan> thats quite a list of stuff
  174. # [01:07] * Quits: Neiluj (~Julien@195.200.175.214) (Ping timeout: 264 seconds)
  175. # [01:07] <thatryan> bot-t: did you know you have your own website?
  176. # [01:07] <bot-t> thatryan, Ask again later.
  177. # [01:07] <thatryan> no
  178. # [01:08] <antonkovalyov> ?heartz
  179. # [01:08] <bot-t> ♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥
  180. # [01:08] <antonkovalyov> k, back to work :)
  181. # [01:09] * Quits: jochen__ (~jochen@nat/google/x-xsplocszwbitlgdv) (Ping timeout: 250 seconds)
  182. # [01:09] * jochen___ is now known as jochen__
  183. # [01:10] * Joins: fry15 (~Adium@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
  184. # [01:11] * Joins: paul_irish (~paul_iris@nat/google/x-etpqfycjenjcxffw)
  185. # [01:11] <thatryan> antonkovalyov: here's your chance
  186. # [01:12] <antonkovalyov> hey paul_irish, look what bott has to say
  187. # [01:12] <paul_irish> .
  188. # [01:12] <bot-t> (41 mins 40 secs ago) <nimbupani> tell paul_irish fixed
  189. # [01:12] <bot-t> (40 mins 10 secs ago) <antonkovalyov> tell paul_irish your HTML5 Boilerplate talk is on the same day as Day of JS conf
  190. # [01:12] <antonkovalyov> ?should you be open source
  191. # [01:12] <alcuadrado> have you checked the game on 2010 entries?
  192. # [01:12] <bot-t> yes!
  193. # [01:12] <alcuadrado> most of them suck :s
  194. # [01:12] <paul_irish> yeah i heard about that
  195. # [01:13] * Joins: Neiluj (~Julien@195.200.175.214)
  196. # [01:13] <dgathright> bot-t: Do you prefer xhtml over html?
  197. # [01:13] <bot-t> dgathright, Without a doubt.
  198. # [01:13] <thatryan> lol
  199. # [01:13] <dgathright> bot-t: Boooooo!
  200. # [01:13] <bot-t> dgathright, Links of Interest | CSS-Tricks - http://css-tricks.com/links-of-interest-41/
  201. # [01:14] <dgathright> bot-t: that doesn't have anything to do with our conversation.
  202. # [01:14] <bot-t> thank a lot yu deserve a great doesn't have anything to do with our conversation. doesn't have anything to do with our conversation.
  203. # [01:14] * Parts: hubble (~hubble@dsl081-150-127.chi1.dsl.speakeasy.net)
  204. # [01:14] <dgathright> bot-t: Are you drunk?
  205. # [01:14] <bot-t> dgathright, It is certain.
  206. # [01:14] <dgathright> bot-t: Figured
  207. # [01:14] <bot-t> dgathright, #1193 (Interface scrollTo()/scrollToAnchors() in Firefox for MAC ... - Opened 4 years ago http://bugs.jquery.com/ticket/1193
  208. # [01:14] * Quits: ben_c (~Adium@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com) (Quit: Leaving.)
  209. # [01:14] * Parts: fry15 (~Adium@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
  210. # [01:15] * Quits: mahemoff (~mahemoff@87-194-3-205.bethere.co.uk) (Quit: mahemoff)
  211. # [01:15] <antonkovalyov> paul_irish, i am thinking about skipping the last panel to get to you talk. but anyway the crowd is pretty much the same for both events. :(
  212. # [01:15] <antonkovalyov> your*
  213. # [01:16] <paul_irish> hmmm
  214. # [01:16] <paul_irish> hmmmm
  215. # [01:16] <antonkovalyov> hm?
  216. # [01:17] <paul_irish> jesus i have as many people coming to my talk as are going to the conference
  217. # [01:18] <antonkovalyov> you have more
  218. # [01:18] <thatryan> where is pauls talk
  219. # [01:18] <thatryan> fuck me how do i miss this stuff
  220. # [01:19] <paul_irish> http://www.sfhtml5.org/calendar/15728914/?eventId=15728914&action=detail
  221. # [01:19] <paul_irish> antonkovalyov: i asked the organizers to clarify when mine starts
  222. # [01:19] <antonkovalyov> thatryan, concord.
  223. # [01:19] <antonkovalyov> too far away
  224. # [01:20] <thatryan> ha
  225. # [01:20] <paul_irish> concord. lol
  226. # [01:20] <thatryan> stupid concord
  227. # [01:20] <thatryan> damn with traffic i could not get there by 630 crapp
  228. # [01:21] <antonkovalyov> paul_irish, the panel ends at 6:15. assuming that not everyone is with cars, they need hour and a half buffer to get to the city
  229. # [01:21] <antonkovalyov> your talk is at 6:30. even if they move it to 7:30, not enough time
  230. # [01:22] <paul_irish> 1.5 hours? come onnnn
  231. # [01:22] <antonkovalyov> and then it is too late :(
  232. # [01:22] <thatryan> antonkovalyov: you going to go to the mt view conference then back up to sf?
  233. # [01:22] <antonkovalyov> caltrain+bart?
  234. # [01:22] * Joins: toinso (~toinso@86-46-119-191-dynamic.b-ras1.wtd.waterford.eircom.net)
  235. # [01:22] <paul_irish> well
  236. # [01:22] <paul_irish> true.
  237. # [01:22] <antonkovalyov> thatryan, yeah.
  238. # [01:22] <paul_irish> people should get cars
  239. # [01:22] <antonkovalyov> fuck cars
  240. # [01:22] <thatryan> i have a car!
  241. # [01:22] <paul_irish> in fact.. i might get a googlecar to drive up
  242. # [01:22] <paul_irish> and i can take you
  243. # [01:22] <antonkovalyov> paul_irish, that would be awesome
  244. # [01:22] <paul_irish> cool lets.
  245. # [01:24] <thatryan> im gonna go ask boss if i can leave early thursday :)
  246. # [01:24] <antonkovalyov> thatryan, where do you work?
  247. # [01:24] <antonkovalyov> i am taking the whole day off :)
  248. # [01:25] <thatryan> startup in concord :D
  249. # [01:25] <antonkovalyov> they have startups oh wow
  250. # [01:26] <antonkovalyov> the only startup i know from the east bay is the one by hans reiser. but then he killed his wife and went to prison. not exactly a success story.
  251. # [01:29] <thatryan> lol we are doing well so far :D
  252. # [01:30] <thatryan> w00t im going!
  253. # [01:34] <antonkovalyov> unabomber was math prof at ucb
  254. # [01:34] <antonkovalyov> reiser was a cs student at ucb
  255. # [01:34] <antonkovalyov> shit i better say away from cs/math building here
  256. # [01:35] <thatryan> paul_irish: I AM SO EXCITED OMG
  257. # [01:35] <thatryan> :p
  258. # [01:35] * Joins: noxxten (noxxten@adsl-93-90-217.owb.bellsouth.net)
  259. # [01:44] * Joins: hubble (~hubble@216-80-69-33.c3-0.nwb-bsr1.chi-nwb.il.cable.rcn.com)
  260. # [01:45] * Joins: Shwaiil (~Shwaiil@a89-154-56-220.cpe.netcabo.pt)
  261. # [01:45] <Shwaiil> hi ppl
  262. # [01:46] <Shwaiil> Q: I'm wondering about developing games for mobile phones. Everyone talks about java. So, i'm wondering if HTML5/JS is also available to do the same ? For non web games, mobile apps only ? Thanks
  263. # [01:46] <Shwaiil> If there's a better or any other room that I could talk about this, I'll apreciate the sugestion
  264. # [01:47] <paul_irish> ?g z-type
  265. # [01:47] <bot-t> paul_irish, Z-Type - http://www.phoboslab.org/ztype/
  266. # [01:48] <paul_irish> ^html5/js game
  267. # [01:48] <Shwaiil> hum
  268. # [01:48] <Shwaiil> ?
  269. # [01:49] * Quits: addyosmani (~apple@host109-154-41-126.range109-154.btcentralplus.com) (Quit: addyosmani)
  270. # [01:49] * Joins: ben_alman (~ben_alman@pool-74-104-156-115.bstnma.fios.verizon.net)
  271. # [01:49] <thatryan> addicting game
  272. # [01:50] <Thasmo> COOOOOL
  273. # [01:50] <Thasmo> :>
  274. # [01:50] <thatryan> so paul_irish is the talk a boilerplate walkthrough only
  275. # [01:51] <paul_irish> i have no idea
  276. # [01:51] <paul_irish> any requests?
  277. # [01:51] <thatryan> lol you making it up as yuou go?
  278. # [01:51] <thatryan> true rockstar heh
  279. # [01:51] <paul_irish> true slacker
  280. # [01:52] <thatryan> well played
  281. # [01:52] <paul_irish> hmmm
  282. # [01:52] <paul_irish> i need to say something inspiring to web developres
  283. # [01:53] <thatryan> you tend to be though, so im sure it will come to ya
  284. # [01:55] <trave> ztype rocks!
  285. # [01:56] <thatryan> make some rad demos :)
  286. # [01:59] * Quits: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
  287. # [02:02] * moneal is now known as moneal|a
  288. # [02:11] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Remote host closed the connection)
  289. # [02:11] * Joins: dguttman (~dguttman@gige.bur.digisynd.com)
  290. # [02:12] * Quits: jamesarosen (~jamesaros@204.28.122.178) (Remote host closed the connection)
  291. # [02:14] <Neiluj> impactjs rocks !
  292. # [02:15] <Neiluj> except it's not free but not expensive for what it is
  293. # [02:18] <dgathright> bot-t: Should I fly up to SF for HP's webOS developer event in February?
  294. # [02:18] <bot-t> dgathright, Ask again later.
  295. # [02:18] <dgathright> grrrr
  296. # [02:18] <dgathright> bot-t: Is it "later" yet?
  297. # [02:18] <bot-t> dgathright, Concentrate and ask again.
  298. # [02:19] <dgathright> bot-t: Is.... it..... "later" .... yet?
  299. # [02:19] <bot-t> dgathright, Yes.
  300. # [02:19] * Joins: buzzomatic_ (~buzzomati@203.144.8.51)
  301. # [02:19] <dgathright> bot-t: Should I fly up to SF for HP's webOS developer event in February?
  302. # [02:19] <bot-t> dgathright, Signs point to yes.
  303. # [02:19] <Neiluj> :)
  304. # [02:19] <dgathright> well that settles it
  305. # [02:19] <Neiluj> bot-t: will I finish the project I'm working on tonight ?
  306. # [02:20] <bot-t> Neiluj, It is certain.
  307. # [02:20] * buzzomatic_ is now known as buzzomatic
  308. # [02:20] <Neiluj> ouf !
  309. # [02:20] <dgathright> A Magic 8 Ball is far less frustrating to deal with than bot-t
  310. # [02:20] <bot-t> dgathright, Stored "A Magic 8 Ball".
  311. # [02:20] <Neiluj> ahaha :)
  312. # [02:20] <dgathright> point proven
  313. # [02:20] * Quits: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk) (Ping timeout: 240 seconds)
  314. # [02:21] * Parts: buzzomatic (~buzzomati@203.144.8.51)
  315. # [02:21] * Quits: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com) (Remote host closed the connection)
  316. # [02:26] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Quit: Leaving...)
  317. # [02:26] * Quits: boaz (~boaz@64.119.153.2) (Quit: boaz)
  318. # [02:27] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
  319. # [02:27] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Remote host closed the connection)
  320. # [02:32] * Joins: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net)
  321. # [02:34] * Joins: grantg__ (d8bdab51@gateway/web/freenode/ip.216.189.171.81)
  322. # [02:40] * Joins: jgv (~jgv@184.152.75.83)
  323. # [02:40] * Quits: grantg__ (d8bdab51@gateway/web/freenode/ip.216.189.171.81) (Quit: Page closed)
  324. # [02:42] * Quits: Shwaiil (~Shwaiil@a89-154-56-220.cpe.netcabo.pt) (Ping timeout: 240 seconds)
  325. # [02:43] * Joins: thatryan (~thatryan@c-71-202-1-91.hsd1.ca.comcast.net)
  326. # [02:43] * Quits: jgv (~jgv@184.152.75.83) (Remote host closed the connection)
  327. # [02:45] * Joins: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
  328. # [02:47] * Joins: jgv (~jgv@184.152.75.83)
  329. # [02:49] * Quits: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 255 seconds)
  330. # [02:50] * Quits: techrush (~techrush@rrcs-173-198-32-131.west.biz.rr.com) (Ping timeout: 240 seconds)
  331. # [02:52] * Joins: murz (~mmurraywa@wcproxy.msnbc.com)
  332. # [02:53] * Joins: bentruyman (~bentruyma@c-67-163-43-249.hsd1.il.comcast.net)
  333. # [02:53] * Joins: themiddleman (~rob@c-76-27-43-76.hsd1.ut.comcast.net)
  334. # [02:54] * Parts: skyler_brungardt (~skyler_br@64.191.211.43)
  335. # [02:58] * Joins: skyler_brungardt (~skyler@64.191.211.43)
  336. # [03:03] * Quits: skyler_brungardt (~skyler@64.191.211.43) (Client Quit)
  337. # [03:05] * Joins: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net)
  338. # [03:18] * Quits: jgv (~jgv@184.152.75.83) (Remote host closed the connection)
  339. # [03:18] * Joins: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com)
  340. # [03:21] * Quits: bckenny (~bckenny@nat/google/x-cmbrkybesvczhlmj) (Remote host closed the connection)
  341. # [03:25] * Quits: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com) (Ping timeout: 240 seconds)
  342. # [03:28] * Joins: tw2113 (~tw2113@fedora/tw2113)
  343. # [03:28] <tw2113> cgcardona http://blog.nihilogic.dk/2009/02/html5-canvas-cheat-sheet.html?kozmic
  344. # [03:28] <cgcardona> nice one
  345. # [03:28] <tw2113> play mario
  346. # [03:29] <tw2113> use your keyboard cursor
  347. # [03:29] <cgcardona> did you see this?
  348. # [03:29] <cgcardona> http://dt.deviantart.com/blog/37599369/
  349. # [03:29] <paul_irish> o.o
  350. # [03:29] <tw2113> yeah, i didn't read through it though...i haven't done much with canvas and don't care for IE
  351. # [03:29] <tw2113> :D
  352. # [03:29] <cgcardona> oh that is awesome tw2113 !
  353. # [03:36] * Quits: murz (~mmurraywa@wcproxy.msnbc.com) (Remote host closed the connection)
  354. # [03:43] * Quits: tw2113 (~tw2113@fedora/tw2113) (Quit: Nice Scotty, now beam my clothes up too!)
  355. # [03:45] * Joins: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com)
  356. # [03:47] * Quits: paul_irish (~paul_iris@nat/google/x-etpqfycjenjcxffw) (Remote host closed the connection)
  357. # [03:47] * Joins: paul_irish (~paul_iris@nat/google/x-wzlfpivgjttkabat)
  358. # [03:52] * Quits: romainhuet (~romainhue@pro75-6-88-185-123-205.fbx.proxad.net) (Quit: romainhuet)
  359. # [03:54] * Quits: paul_irish (~paul_iris@nat/google/x-wzlfpivgjttkabat) (Remote host closed the connection)
  360. # [03:54] * Joins: shi (97c1dc1d@gateway/web/freenode/ip.151.193.220.29)
  361. # [03:54] * Joins: paul_irish (~paul_iris@nat/google/x-locrfffegdogcarj)
  362. # [03:56] * Quits: trave (43a1f086@gateway/web/freenode/ip.67.161.240.134) (Ping timeout: 265 seconds)
  363. # [03:56] * Quits: shi (97c1dc1d@gateway/web/freenode/ip.151.193.220.29) (Client Quit)
  364. # [04:16] * Quits: paul_irish (~paul_iris@nat/google/x-locrfffegdogcarj) (Remote host closed the connection)
  365. # [04:22] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Quit: zzzzz)
  366. # [04:30] * Quits: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net) (Quit: Linkinus - http://linkinus.com)
  367. # [04:41] * Quits: jus101 (~chatzilla@203-97-83-44.sli-systems.com) (Ping timeout: 260 seconds)
  368. # [04:46] * Quits: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar) (Read error: Connection reset by peer)
  369. # [05:09] * Joins: paul_irish (~paul_iris@nat/google/x-nzlcggbfrsknzevk)
  370. # [05:16] * Joins: dytrivedi (20017@ninthfloor.org)
  371. # [05:20] * Joins: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com)
  372. # [05:24] * Quits: hubble (~hubble@216-80-69-33.c3-0.nwb-bsr1.chi-nwb.il.cable.rcn.com) (Quit: hubble)
  373. # [05:28] <thatryan> hey paul_irish
  374. # [05:28] <thatryan> you around?
  375. # [05:29] <paul_irish> wat
  376. # [05:29] <thatryan> was curious about something with chrome dev tools
  377. # [05:30] <paul_irish> RUMORS of IE9 RC landing on jan 28th
  378. # [05:30] <thatryan> when editing styles, is there any settings to change so if you hit tab it will jump to net field, not erase everything?
  379. # [05:30] <paul_irish> thatryan: use chrome dev channel
  380. # [05:31] <paul_irish> GEEZ. i swear you've heard me say that like 4324235 times
  381. # [05:31] <thatryan> nope not me!
  382. # [05:31] <Neiluj> :)
  383. # [05:31] <Neiluj> are you not on chrome's dev "relations" ? :p :p
  384. # [05:31] <thatryan> LOL
  385. # [05:32] <paul_irish> ?g chrome dev channel
  386. # [05:32] <bot-t> paul_irish, developer channel - The Chromium Projects - http://www.chromium.org/getting-involved/dev-channel
  387. # [05:32] <paul_irish> MAKE IT HAPPEN NAO
  388. # [05:32] <Neiluj> ;)
  389. # [05:33] * Quits: dgathright (~dgathrigh@nat/yahoo/x-uckzvzkbiywnnasr) (Ping timeout: 255 seconds)
  390. # [05:33] * Joins: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net)
  391. # [05:34] <thatryan> HA OK downloading
  392. # [05:35] <Neiluj> btw, talking about chrome, something I really like is when you're viewing source of a page, refreshing works... safari is pissing me off with this
  393. # [05:37] <Neiluj> I don't understand how Apple still didn't highlight source code in 2011...
  394. # [05:37] * Quits: Facefoxdotcom (~machine4@pool-74-111-197-200.lsanca.fios.verizon.net) (Quit: www.FaceFox.com)
  395. # [05:38] <thatryan> whoa weird
  396. # [05:40] <thatryan> renders stuff different fix it! :p
  397. # [05:42] * Quits: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net) (Quit: Linkinus - http://linkinus.com)
  398. # [05:42] * Quits: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net) (Quit: masondesu)
  399. # [05:54] * Joins: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
  400. # [05:57] * Quits: paul_irish (~paul_iris@nat/google/x-nzlcggbfrsknzevk) (Remote host closed the connection)
  401. # [05:58] * Joins: dguttman_ (~dguttman@gige.bur.digisynd.com)
  402. # [06:02] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Ping timeout: 276 seconds)
  403. # [06:03] * Joins: paul_irish (~paul_iris@67.218.106.189)
  404. # [06:03] * Quits: dguttman_ (~dguttman@gige.bur.digisynd.com) (Ping timeout: 276 seconds)
  405. # [06:16] * Joins: dmachi1 (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net)
  406. # [06:16] * Quits: dmachi (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net) (Read error: Connection reset by peer)
  407. # [06:28] * Joins: tw2113 (~tw2113@fedora/tw2113)
  408. # [06:33] <antonkovalyov> i just got a new thing in chrome. on the preferences icon (where usually the yellow circle pops up when chrome needs to be updated) i had some kind of blue tilde icon. it did point to the background pages window but i saw absolutely nothing wrong there.
  409. # [06:33] <antonkovalyov> i thought maybe something crashed, but all my tabs seem to be fine
  410. # [06:33] <antonkovalyov> and i can't find anything about it on the web.
  411. # [06:34] * Quits: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net) (Quit: boaz)
  412. # [06:34] <thatryan> lol i installed dev version half my page disappeared :)
  413. # [06:36] <antonkovalyov> thatryan, i use dev version all the time. seems to work just fine. there were times where i could not open devtools almost anywhere (the tab would just crash) and there was a bug when you could not scroll up (seriously). but other then that, it is more stable than other browsers' stable versions. :-)
  414. # [06:36] <antonkovalyov> what page dissapeared?
  415. # [06:37] <paul_irish> antonkovalyov: tbh i dont know whats up with that background pages icon
  416. # [06:37] <paul_irish> bg pages are used by extensions
  417. # [06:37] <antonkovalyov> paul_irish, but do you see it as well?
  418. # [06:37] <paul_irish> but no idea why it needs to be exposed on the wrench
  419. # [06:39] <antonkovalyov> hm, maybe some extension crashed.
  420. # [06:39] <antonkovalyov> paul_irish, this new chrome://settings is sexy
  421. # [06:40] * Quits: paul_irish (~paul_iris@67.218.106.189) (Remote host closed the connection)
  422. # [06:41] * Joins: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com)
  423. # [06:45] * Quits: antonkovalyov (~antonkova@adsl-75-18-218-45.dsl.pltn13.sbcglobal.net) (Quit: Linkinus - http://linkinus.com)
  424. # [06:45] * Joins: Killman_ (~Killman@186.3.10.3)
  425. # [06:45] * Killman is now known as Guest72832
  426. # [06:46] * Quits: Killman_ (~Killman@186.3.10.3) (Client Quit)
  427. # [06:46] * Joins: antonkovalyov (~antonkova@adsl-75-18-218-45.dsl.pltn13.sbcglobal.net)
  428. # [06:46] * Joins: paul_irish (~paul_iris@c-76-21-40-62.hsd1.ca.comcast.net)
  429. # [06:47] * Joins: Killman (~Killman@186.3.10.3)
  430. # [06:47] * Quits: Killman (~Killman@186.3.10.3) (Changing host)
  431. # [06:47] * Joins: Killman (~Killman@unaffiliated/killman)
  432. # [06:50] * Quits: Guest72832 (~Killman@unaffiliated/killman) (Ping timeout: 276 seconds)
  433. # [06:55] * Joins: jeffszusz (~jeffszusz@dyn216-8-170-154.ADSL.mnsi.net)
  434. # [06:56] <paul_irish> thatryan: how *should* i do a boilerplate talk.
  435. # [06:57] <thatryan> paul_irish: Good question, is this talk specifically for just that?
  436. # [06:57] <paul_irish> yes
  437. # [06:58] <paul_irish> intro to the idea. what it's goals are.. highlights of the markup and css..
  438. # [06:58] <paul_irish> modernizr highlights.
  439. # [06:58] <thatryan> remember, obviously you do lol, the video walkthrough you did for it?
  440. # [06:58] <paul_irish> apache highlights.
  441. # [06:58] <paul_irish> build script concept.
  442. # [06:58] <paul_irish> :/
  443. # [06:59] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
  444. # [06:59] <thatryan> that video was awesome, very fun and informative
  445. # [06:59] <paul_irish> ill try to be drunk for the talk then
  446. # [06:59] <paul_irish> jk jk jk
  447. # [06:59] * Quits: mikew3c (~MikeSmith@EM111-188-13-191.pool.e-mobile.ne.jp) (Ping timeout: 246 seconds)
  448. # [06:59] <thatryan> LOL that was gret
  449. # [06:59] <thatryan> ;)
  450. # [07:00] <thatryan> the more in depth parts of the boilerplate, like you mention, build scripts etc, would be helpful to hear more about
  451. # [07:00] <thatryan> those pieces i dont really follow
  452. # [07:02] * Joins: shwetank (~emailshwe@122.173.85.222)
  453. # [07:02] * tw2113 sucks as a mockup designer
  454. # [07:03] <thatryan> gonna use it to build into html5 info? cutting edge crap we should be using? :)
  455. # [07:05] * Joins: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp)
  456. # [07:05] * Quits: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp) (Client Quit)
  457. # [07:05] * Joins: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp)
  458. # [07:10] <paul_irish> YEAH CUTTING EDGE SHIT
  459. # [07:12] <paul_irish> probably some polyfill like crazy type shit
  460. # [07:12] <tw2113> with ARIA stuff, do you guys limit what you put in? or just put in whatever assistive standards will eventually be so you're ready when the technology finally gets updated?
  461. # [07:12] <thatryan> oh cool
  462. # [07:12] <thatryan> polyfill stuff would be rd
  463. # [07:14] <paul_irish> tw2113: i put in anything that NVDA will be responsive to.
  464. # [07:15] <paul_irish> let the other ones catch up
  465. # [07:15] <paul_irish> NVDA is the target, for all intents and purposes.
  466. # [07:16] <tw2113> i was putting role tags on a client site earlier
  467. # [07:31] <antonkovalyov> hey guys, need your help. give me some definition of polyfill so i could translate it to russian, please. :-)
  468. # [07:32] <mikew3c> I didn't know what it even meant until paul_irish filled me in on it a couple months back
  469. # [07:32] <mikew3c> poly-filled me in
  470. # [07:32] <mikew3c> har har
  471. # [07:32] <paul_irish> hahaa
  472. # [07:32] <paul_irish> antonkovalyov: so polyfill is like a shim..
  473. # [07:32] <paul_irish> json2.js is a good example of a polyfill
  474. # [07:33] <paul_irish> it has the exact same API of native JSON... and only adds itself to the page if native support is not present.
  475. # [07:33] <paul_irish> all polyfills are code that is expected to expire. as soon as the browsers are upgraded.
  476. # [07:33] <antonkovalyov> is the term degradative?
  477. # [07:33] <paul_irish> i suppose? :/
  478. # [07:34] <antonkovalyov> we have a term for that in russian (the exact translation would be crutches) but it is a bit degradative so i don't know if i should use it
  479. # [07:34] <antonkovalyov> hm
  480. # [07:35] <thatryan> antonkovalyov: dont worry we gonna get our learn on in two weeks :D
  481. # [07:36] <antonkovalyov> thatryan, i am translating boilerplate site to russian, gonna learn this shit earlier.
  482. # [07:36] <thatryan> rad
  483. # [07:37] * Quits: jeffszusz (~jeffszusz@dyn216-8-170-154.ADSL.mnsi.net) (Remote host closed the connection)
  484. # [07:39] <paul_irish> i think a crutches type idea is pretty accurate
  485. # [07:40] * Quits: tw2113 (~tw2113@fedora/tw2113) (Quit: Never look down on someone unless you're helping them up.)
  486. # [07:44] <antonkovalyov> ?tell tw2113 that he has the wisest quit message i've ever seen. and the most serious. :-P
  487. # [07:44] <bot-t> antonkovalyov, Okay.
  488. # [07:45] <antonkovalyov> paul_irish, ok, crutches it is then.
  489. # [07:58] * Quits: peol (~andree@unaffiliated/peol) (Quit: peol)
  490. # [08:01] * Joins: HT (~ht@ip3e83ff64.speed.planet.nl)
  491. # [08:04] <thatryan> paul_irish: how did you get to know everything?
  492. # [08:08] * Quits: Bass10 (Bass10@c-76-113-194-7.hsd1.mn.comcast.net) (Ping timeout: 240 seconds)
  493. # [08:09] * Quits: patcito (~123@190.42.79.230) (Read error: Connection reset by peer)
  494. # [08:10] * Quits: mr_daniel (~irssi@g224121030.adsl.alicedsl.de) (Read error: Connection reset by peer)
  495. # [08:14] <antonkovalyov> paul_irish, http://dl.dropbox.com/u/447925/Screenshots/ts1tdw~bbm8f.png shouldn't it be "with background" instead of "with a border"?
  496. # [08:15] * Joins: mr_daniel (~irssi@g224123107.adsl.alicedsl.de)
  497. # [08:33] * Joins: Howell` (~Howell`@116.226.88.12)
  498. # [08:33] * Quits: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net) (Remote host closed the connection)
  499. # [08:34] * Joins: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net)
  500. # [08:34] * Joins: buzzomatic (~buzzomati@203.144.8.51)
  501. # [08:40] * Joins: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com)
  502. # [08:41] * Joins: Titosemi (~titosemi@f053227002.adsl.alicedsl.de)
  503. # [08:41] * Joins: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk)
  504. # [08:43] * Quits: thatryan (~thatryan@c-71-202-1-91.hsd1.ca.comcast.net) (Quit: Leaving...)
  505. # [08:46] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
  506. # [08:47] <paul_irish> hehehe yes i believe you're right
  507. # [08:47] * Joins: sumeet_ (~sumeet@c-67-180-23-104.hsd1.ca.comcast.net)
  508. # [08:47] <paul_irish> good call antonkovalyov
  509. # [08:47] * sumeet_ is now known as shipit
  510. # [08:47] <paul_irish> can you tweak that in /src/index.html ?
  511. # [08:49] <antonkovalyov> paul_irish, yeah. i wonder if i can do pull requests on specific commits only
  512. # [08:49] <paul_irish> not really
  513. # [08:49] <antonkovalyov> don't want to mix that and translations stuff
  514. # [08:49] <paul_irish> unless you do those commits in a branch
  515. # [08:49] <antonkovalyov> shit
  516. # [08:50] <paul_irish> if its in a branch then its easy
  517. # [08:50] <antonkovalyov> kk
  518. # [08:51] * Quits: LongBeach (~mike@AFontenayssB-152-1-50-215.w82-121.abo.wanadoo.fr)
  519. # [08:57] * Joins: chipotle_ (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com)
  520. # [08:57] * Quits: dytrivedi (20017@ninthfloor.org) (Remote host closed the connection)
  521. # [08:57] * Quits: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com) (Read error: Connection reset by peer)
  522. # [08:58] * Joins: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
  523. # [09:01] * Joins: peol (~andree@91.213.250.6)
  524. # [09:01] * Quits: peol (~andree@91.213.250.6) (Changing host)
  525. # [09:01] * Joins: peol (~andree@unaffiliated/peol)
  526. # [09:03] <antonkovalyov> paul_irish, done
  527. # [09:03] <paul_irish> shit damn
  528. # [09:03] <antonkovalyov> hm?
  529. # [09:04] <paul_irish> thanks :)
  530. # [09:04] <antonkovalyov> hah. is "shit damn" like double-negative is positive?
  531. # [09:05] * Joins: jetienne (~jerome@ivr94-6-82-230-255-246.fbx.proxad.net)
  532. # [09:08] * Joins: shichuan (97c1dc1b@gateway/web/freenode/ip.151.193.220.27)
  533. # [09:12] * Quits: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk) (Ping timeout: 240 seconds)
  534. # [09:14] * Quits: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 240 seconds)
  535. # [09:16] * Quits: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com) (Quit: dguttman)
  536. # [09:17] * Joins: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com)
  537. # [09:18] * Joins: dgathright_ (~dgathrigh@pool-108-23-17-58.lsanca.fios.verizon.net)
  538. # [09:18] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Ping timeout: 260 seconds)
  539. # [09:18] * dgathright_ is now known as dgathright
  540. # [09:19] * Joins: dgathright_ (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
  541. # [09:21] <paul_irish> yes.
  542. # [09:23] * Quits: dgathright (~dgathrigh@pool-108-23-17-58.lsanca.fios.verizon.net) (Ping timeout: 260 seconds)
  543. # [09:23] * dgathright_ is now known as dgathright
  544. # [09:24] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Ping timeout: 255 seconds)
  545. # [09:25] * Joins: tob1 (~tob1@xlate.10t.org)
  546. # [09:26] * Joins: jeremyselier (~Jeremy@seg75-1-81-57-242-198.fbx.proxad.net)
  547. # [09:27] * Joins: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
  548. # [09:27] * Quits: tob1 (~tob1@xlate.10t.org) (Client Quit)
  549. # [09:33] * Joins: matjas (~matjas@91.182.67.153)
  550. # [09:35] * Joins: ACTRAiSER (~ACTRAiSER@217.110.228.68)
  551. # [09:35] <ACTRAiSER> morning
  552. # [09:43] * Quits: Howell` (~Howell`@116.226.88.12) (Ping timeout: 240 seconds)
  553. # [09:43] * Quits: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net) (Remote host closed the connection)
  554. # [09:44] * Joins: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za)
  555. # [09:44] * Joins: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net)
  556. # [09:45] * Quits: shwetank (~emailshwe@122.173.85.222) (Quit: shwetank)
  557. # [09:55] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  558. # [10:02] * Joins: peol (~andree@91.213.250.6)
  559. # [10:02] * Quits: peol (~andree@91.213.250.6) (Changing host)
  560. # [10:02] * Joins: peol (~andree@unaffiliated/peol)
  561. # [10:03] * Quits: jeremyselier (~Jeremy@seg75-1-81-57-242-198.fbx.proxad.net) (Ping timeout: 240 seconds)
  562. # [10:19] * Joins: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it)
  563. # [10:22] * Quits: HAITI (~j@unaffiliated/haiti) (Ping timeout: 246 seconds)
  564. # [10:25] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  565. # [10:29] * Joins: peol (~andree@unaffiliated/peol)
  566. # [10:32] * Joins: codetonowhere (~Adium@2001:67c:90:770:222:41ff:fe2a:3d9e)
  567. # [10:35] * Joins: mahemoff (~mahemoff@nat/google/x-apemazowpaksyorj)
  568. # [10:35] * Parts: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
  569. # [10:35] * Quits: codetonowhere (~Adium@2001:67c:90:770:222:41ff:fe2a:3d9e) (Client Quit)
  570. # [10:37] <antonkovalyov> holy shit
  571. # [10:37] <antonkovalyov> i think i finished translating
  572. # [10:37] * Joins: romainhuet (~romainhue@pro75-6-88-185-123-205.fbx.proxad.net)
  573. # [10:38] <antonkovalyov> paul_irish, gonna show it to a friend of mine and then will make a pull request
  574. # [10:38] * Quits: mahemoff (~mahemoff@nat/google/x-apemazowpaksyorj) (Remote host closed the connection)
  575. # [10:38] * Joins: mahemoff (~mahemoff@nat/google/x-hooreckohgitsjyb)
  576. # [10:40] * Quits: anttio (~anttio@huittinen.of.frantic.com) (Quit: anttio)
  577. # [10:43] * Quits: buzzomatic (~buzzomati@203.144.8.51) (Quit: buzzomatic)
  578. # [10:54] * Quits: krijnh (~krijnhoet@83.160.77.30) (Ping timeout: 260 seconds)
  579. # [10:55] * Attempting to rejoin channel #html5
  580. # [10:55] * Rejoined channel #html5
  581. # [10:55] * Topic is 'Welcome, amigos :: Ask any question about html5 & Friends. || Author Spec: http://dev.w3.org/html5/spec-author-view/ || Full spec: http://whatwg.org/html5 || Also: http://html5rocks.com http://diveintohtml5.org http://mzl.la/9giLwR http://html5homi.es'
  582. # [10:55] * Set by marienz!~marienz@freenode/staff/marienz on Fri Nov 05 18:43:30
  583. # [10:55] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  584. # [10:59] * Quits: shichuan (97c1dc1b@gateway/web/freenode/ip.151.193.220.27) (Quit: Page closed)
  585. # [11:07] * Joins: anttio (~anttio@huittinen.of.frantic.com)
  586. # [11:12] * Quits: antonkovalyov (~antonkova@adsl-75-18-218-45.dsl.pltn13.sbcglobal.net) (Quit: Leaving...)
  587. # [11:14] * Quits: toinso (~toinso@86-46-119-191-dynamic.b-ras1.wtd.waterford.eircom.net) (Quit: Leaving)
  588. # [11:19] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
  589. # [11:25] * Joins: peol (~andree@91.213.250.6)
  590. # [11:25] * Quits: peol (~andree@91.213.250.6) (Changing host)
  591. # [11:25] * Joins: peol (~andree@unaffiliated/peol)
  592. # [11:26] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  593. # [11:27] * Quits: Killman (~Killman@unaffiliated/killman) (Quit: bbl ZZZZ)
  594. # [11:36] * Quits: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za) (Quit: Computer has gone to sleep.)
  595. # [11:42] * Joins: rakeshpai (~rakeshpai@59.162.86.164)
  596. # [11:43] * Joins: peol (~andree@91.213.250.6)
  597. # [11:43] * Quits: peol (~andree@91.213.250.6) (Changing host)
  598. # [11:43] * Joins: peol (~andree@unaffiliated/peol)
  599. # [11:43] * Joins: buzzomatic (~buzzomati@203.144.8.51)
  600. # [11:45] * Quits: peol (~andree@unaffiliated/peol) (Client Quit)
  601. # [11:45] * Joins: Titosemi1 (~titosemi@g229019143.adsl.alicedsl.de)
  602. # [11:46] * Joins: kor (~kor@a83-161-211-173.adsl.xs4all.nl)
  603. # [11:47] * Quits: Titosemi (~titosemi@f053227002.adsl.alicedsl.de) (Ping timeout: 240 seconds)
  604. # [11:50] * Quits: shipit (~sumeet@c-67-180-23-104.hsd1.ca.comcast.net) (Remote host closed the connection)
  605. # [12:01] * Quits: mahemoff (~mahemoff@nat/google/x-hooreckohgitsjyb) (Quit: mahemoff)
  606. # [12:02] * Joins: codetonowhere1 (~Adium@brick-lane.lbi.co.uk)
  607. # [12:03] * Quits: codetonowhere (~Adium@2001:67c:90:760:222:41ff:fe2a:3d9e) (Ping timeout: 240 seconds)
  608. # [12:03] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
  609. # [12:07] * Joins: mahemoff (~mahemoff@74.125.57.60)
  610. # [12:11] * Joins: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
  611. # [12:15] * Quits: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 260 seconds)
  612. # [12:16] * Joins: Ms2ger (~Ms2ger@91.181.163.121)
  613. # [12:16] * Joins: ben_c (~ben_c@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
  614. # [12:20] * Joins: peol (~andree@91.213.250.6)
  615. # [12:20] * Quits: peol (~andree@91.213.250.6) (Changing host)
  616. # [12:20] * Joins: peol (~andree@unaffiliated/peol)
  617. # [12:21] * Joins: gsnedders (~gsnedders@204.232.194.186)
  618. # [12:33] * Joins: dcadenas (~dcadenas@r186-48-201-251.dialup.adsl.anteldata.net.uy)
  619. # [12:34] * Joins: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za)
  620. # [12:40] * Quits: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com) (Remote host closed the connection)
  621. # [12:44] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
  622. # [12:51] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  623. # [12:51] * Joins: peol (~andree@unaffiliated/peol)
  624. # [12:52] * Joins: svenlito (~svenlito@193.111.227.10)
  625. # [12:52] * Quits: romainhuet (~romainhue@pro75-6-88-185-123-205.fbx.proxad.net) (Quit: romainhuet)
  626. # [12:57] * Joins: mikew3c_ (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp)
  627. # [12:59] * Quits: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp) (Ping timeout: 240 seconds)
  628. # [12:59] * mikew3c_ is now known as mikew3c
  629. # [13:04] * Quits: mahemoff (~mahemoff@74.125.57.60) (Quit: mahemoff)
  630. # [13:10] * chipotle_ is now known as Boohemian
  631. # [13:11] * Boohemian is now known as Boohemian_
  632. # [13:11] * Boohemian_ is now known as chipotle
  633. # [13:15] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
  634. # [13:19] * Quits: burg (~burg@unaffiliated/burg) (Read error: Connection reset by peer)
  635. # [13:21] * Joins: andree (~andree@91.213.250.6)
  636. # [13:21] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  637. # [13:21] * Quits: andree (~andree@91.213.250.6) (Changing host)
  638. # [13:21] * Joins: andree (~andree@unaffiliated/peol)
  639. # [13:25] * chipotle is now known as umode
  640. # [13:33] * Joins: romainhuet (~romainhue@pro75-4-82-238-200-10.fbx.proxad.net)
  641. # [13:37] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Ping timeout: 265 seconds)
  642. # [13:38] * Joins: mahemoff (~mahemoff@nat/google/x-xngimhxfxzpsahat)
  643. # [13:39] * Joins: burg (~burg@c12.uaic.ro)
  644. # [13:45] * Parts: ben_c (~ben_c@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
  645. # [13:45] * Joins: ben_c (~ben_c@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
  646. # [13:45] * Quits: kor (~kor@a83-161-211-173.adsl.xs4all.nl) (Quit: kor)
  647. # [13:47] * Joins: svenlito_ (~svnlto@188-223-81-77.dsl.cnl.uk.net)
  648. # [13:49] * Joins: kor (~kor@a83-161-211-173.adsl.xs4all.nl)
  649. # [13:51] * Quits: |Anthony| (~anthony@unaffiliated/anthony/x-4632056) (Quit: I quit cause IRC sux ;))
  650. # [13:51] * Quits: andree (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  651. # [13:52] * Joins: peol (~andree@91.213.250.6)
  652. # [13:52] * Quits: peol (~andree@91.213.250.6) (Changing host)
  653. # [13:52] * Joins: peol (~andree@unaffiliated/peol)
  654. # [13:53] * Joins: |Anthony| (~anthony@unaffiliated/anthony/x-4632056)
  655. # [13:53] * Quits: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it) (Ping timeout: 240 seconds)
  656. # [13:56] * Joins: lukegalea (~lukegalea@tor.office.avidlifemedia.com)
  657. # [13:57] * Joins: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it)
  658. # [14:04] * Parts: gsnedders (~gsnedders@204.232.194.186)
  659. # [14:05] * Joins: dgathright_ (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
  660. # [14:07] * Quits: ben_alman (~ben_alman@pool-74-104-156-115.bstnma.fios.verizon.net) (Ping timeout: 276 seconds)
  661. # [14:07] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Ping timeout: 276 seconds)
  662. # [14:07] * dgathright_ is now known as dgathright
  663. # [14:12] * Quits: svenlito_ (~svnlto@188-223-81-77.dsl.cnl.uk.net) (Ping timeout: 255 seconds)
  664. # [14:19] * Joins: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net)
  665. # [14:23] * Quits: mahemoff (~mahemoff@nat/google/x-xngimhxfxzpsahat) (Quit: mahemoff)
  666. # [14:32] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  667. # [14:34] * Joins: peol (~andree@91.213.250.6)
  668. # [14:34] * Quits: peol (~andree@91.213.250.6) (Changing host)
  669. # [14:34] * Joins: peol (~andree@unaffiliated/peol)
  670. # [14:34] * Joins: mahemoff (~mahemoff@nat/google/x-mjmmdniysvojjjso)
  671. # [14:51] * Quits: bentruyman (~bentruyma@c-67-163-43-249.hsd1.il.comcast.net) (Quit: bentruyman)
  672. # [14:54] * Quits: mahemoff (~mahemoff@nat/google/x-mjmmdniysvojjjso) (Quit: mahemoff)
  673. # [14:54] * Joins: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net)
  674. # [14:58] * Joins: mahemoff (~mahemoff@nat/google/x-xmckvrsfyvhtsyhr)
  675. # [15:02] * Quits: romainhuet (~romainhue@pro75-4-82-238-200-10.fbx.proxad.net) (Remote host closed the connection)
  676. # [15:02] * Joins: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa)
  677. # [15:03] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  678. # [15:04] * Joins: peol (~andree@unaffiliated/peol)
  679. # [15:06] * Joins: agu10^ (~sbd@190.244.100.66)
  680. # [15:06] <agu10^> hello
  681. # [15:06] <agu10^> can I totally replace flash by using jQuery instead?
  682. # [15:06] <agu10^> for creating web designs
  683. # [15:06] <agu10^> flash-like
  684. # [15:09] * Joins: Pewpewarrows (~Pewpewarr@75-145-93-41-WashingtonDC.hfc.comcastbusiness.net)
  685. # [15:14] <ben_c> well it depends what you're wanting to do :)
  686. # [15:18] * Quits: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net) (Quit: boaz)
  687. # [15:19] * Quits: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com) (Remote host closed the connection)
  688. # [15:30] * Joins: Michael (~disney@extwdig.dig.com)
  689. # [15:30] * Quits: Michael (~disney@extwdig.dig.com) (Changing host)
  690. # [15:30] * Joins: Michael (~disney@unaffiliated/jabberwock)
  691. # [15:38] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Quit: dgathright)
  692. # [15:47] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
  693. # [15:50] * Joins: raslon (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
  694. # [15:53] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  695. # [15:53] * Joins: peol (~andree@91.213.250.6)
  696. # [15:53] * Quits: peol (~andree@91.213.250.6) (Changing host)
  697. # [15:53] * Joins: peol (~andree@unaffiliated/peol)
  698. # [15:53] * Quits: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 264 seconds)
  699. # [15:53] * Quits: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za) (Remote host closed the connection)
  700. # [15:54] * Joins: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
  701. # [15:54] * Quits: raslon (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 260 seconds)
  702. # [15:58] * Quits: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 255 seconds)
  703. # [16:00] * Joins: Bass10 (Bass10@c-76-113-194-7.hsd1.mn.comcast.net)
  704. # [16:04] * Quits: themiddleman (~rob@c-76-27-43-76.hsd1.ut.comcast.net) (Ping timeout: 255 seconds)
  705. # [16:05] * Joins: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106)
  706. # [16:05] <davidmurdoch> Any orlandonians in the house?
  707. # [16:05] <davidmurdoch> er, orlandoins?
  708. # [16:06] <davidmurdoch> wait, is it orlandons?
  709. # [16:07] <danielfilho> I'm a brazilian.
  710. # [16:07] <danielfilho> Sorry :(
  711. # [16:07] <danielfilho> :D
  712. # [16:08] <tw2113> close enough danielfilho
  713. # [16:08] <bot-t> (8 hours 23 mins ago) <antonkovalyov> tell tw2113 that he has the wisest quit message i've ever seen. and the most serious. :-P
  714. # [16:08] <danielfilho> what is your quit msg, tw2113?
  715. # [16:09] <davidmurdoch> anyone looking for work? I need design and wordpress site?
  716. # [16:09] <danielfilho> I can indicate you a designer which makes some freelances.
  717. # [16:09] <danielfilho> But he is in Brazil.
  718. # [16:09] <tw2113> according to my preferences, "leaving"
  719. # [16:09] <danielfilho> tw2113: original.
  720. # [16:10] <danielfilho> not.
  721. # [16:10] <tw2113> default setting
  722. # [16:10] <tw2113> i'll have to have him tell me what he saw
  723. # [16:10] <tw2113> unless he's thinking about last night when i was on my home computer
  724. # [16:10] <tw2113> which has better ones
  725. # [16:11] <davidmurdoch> I need someone who can do the design and HTML. I'm slammed.
  726. # [16:11] <tw2113> as i was noting last night to myself and a couple other people...i suck at mockups
  727. # [16:11] * Joins: Brodingo (472ae19a@gateway/web/freenode/ip.71.42.225.154)
  728. # [16:12] * Joins: joemsak (~hubble@173-165-61-105-Illinois.hfc.comcastbusiness.net)
  729. # [16:14] * Joins: mduncan (~mduncan@216.195.221.2)
  730. # [16:15] * Quits: ACTRAiSER (~ACTRAiSER@217.110.228.68) (Quit: Zynga World Domination Tour 2011)
  731. # [16:16] * Joins: bentruyman (~bentruyma@li159-104.members.linode.com)
  732. # [16:34] * Joins: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com)
  733. # [16:35] * Quits: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106) (Ping timeout: 265 seconds)
  734. # [16:35] * Quits: anttio (~anttio@huittinen.of.frantic.com) (Quit: anttio)
  735. # [16:36] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  736. # [16:36] * Joins: peol (~andree@unaffiliated/peol)
  737. # [16:37] * Quits: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa) (Quit: romainhuet)
  738. # [16:37] * Joins: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa)
  739. # [16:38] * Quits: bentruyman (~bentruyma@li159-104.members.linode.com) (Quit: bentruyman)
  740. # [16:42] * Quits: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa) (Ping timeout: 272 seconds)
  741. # [16:43] <Michael> http://blogs.msdn.com/b/larryosterman/archive/2010/01/29/nextgenhacker101-owes-me-a-new-monitor.aspx
  742. # [16:43] <Michael> waffle mayop
  743. # [16:43] <Michael> mayo
  744. # [16:43] <Michael> "10 people are using google"
  745. # [16:43] <Michael> "tracer t"
  746. # [16:43] <Michael> that's uproarious
  747. # [16:43] * Joins: Killman (~Killman@unaffiliated/killman)
  748. # [16:43] <Michael> paul_irish, if you have seen that you'll get a good laugh
  749. # [16:51] * Joins: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
  750. # [16:55] * Joins: bentruyman (~bentruyma@li159-104.members.linode.com)
  751. # [17:00] * Quits: buzzomatic (~buzzomati@203.144.8.51) (Quit: buzzomatic)
  752. # [17:02] * Joins: HAITI (~j@unaffiliated/haiti)
  753. # [17:06] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
  754. # [17:06] * Joins: peol (~andree@unaffiliated/peol)
  755. # [17:06] * Quits: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 240 seconds)
  756. # [17:07] * Joins: masondesu_ (~Mason@209.149.99.2)
  757. # [17:09] * Quits: Ms2ger (~Ms2ger@91.181.163.121) (Read error: Connection reset by peer)
  758. # [17:12] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
  759. # [17:12] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Client Quit)
  760. # [17:12] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
  761. # [17:12] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Client Quit)
  762. # [17:12] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
  763. # [17:17] * Joins: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106)
  764. # [17:20] * Joins: jamund (~jamund@24-104-129.146.hfc.mediarain.com)
  765. # [17:22] * Quits: mikew3c (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp) (Quit: mikew3c)
  766. # [17:22] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
  767. # [17:23] * Quits: Michael (~disney@unaffiliated/jabberwock) (Read error: Connection reset by peer)
  768. # [17:23] * Joins: Jabberwock (~disney@extwdig.dig.com)
  769. # [17:23] * Jabberwock is now known as Guest52967
  770. # [17:26] * Joins: Ms2ger (~Ms2ger@91.181.253.59)
  771. # [17:26] * Joins: boaz (~boaz@64.119.153.2)
  772. # [17:27] * Joins: felcom (~felcom@rrcs-71-43-19-2.se.biz.rr.com)
  773. # [17:28] * Quits: Guest52967 (~disney@extwdig.dig.com) (Ping timeout: 264 seconds)
  774. # [17:28] * Joins: figital (~figital@64.119.153.2)
  775. # [17:32] * Quits: peol (~andree@unaffiliated/peol) (Quit: peol)
  776. # [17:33] * Quits: joemsak (~hubble@173-165-61-105-Illinois.hfc.comcastbusiness.net) (Ping timeout: 255 seconds)
  777. # [17:33] * Joins: hubble (~hubble@dsl081-150-127.chi1.dsl.speakeasy.net)
  778. # [17:35] * Joins: mikew3c (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp)
  779. # [17:39] * Joins: exp (~zAyghip8@cpc2-ely02-0-0-cust338.5-1.cable.virginmedia.com)
  780. # [17:39] * Joins: addyosmani (~apple@host109-154-41-126.range109-154.btcentralplus.com)
  781. # [17:40] * Quits: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com) (Read error: Connection timed out)
  782. # [17:41] * Joins: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com)
  783. # [17:43] * Titosemi1 is now known as Titosemi
  784. # [17:45] * Quits: mahemoff (~mahemoff@nat/google/x-xmckvrsfyvhtsyhr) (Quit: mahemoff)
  785. # [17:47] * Joins: DjEther (~disney@eorcrp-gdm0a-as.bsc.disney.com)
  786. # [17:50] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
  787. # [17:51] * Quits: masondesu_ (~Mason@209.149.99.2) (Quit: masondesu_)
  788. # [17:52] * Quits: DjEther (~disney@eorcrp-gdm0a-as.bsc.disney.com) (Ping timeout: 255 seconds)
  789. # [17:55] * Joins: mahemoff (~mahemoff@nat/google/x-qxgoixdgrbeiewux)
  790. # [17:55] * Joins: techrush (~techrush@rrcs-173-198-32-131.west.biz.rr.com)
  791. # [17:56] * Quits: paul_irish (~paul_iris@c-76-21-40-62.hsd1.ca.comcast.net) (Remote host closed the connection)
  792. # [18:00] * Quits: Brodingo (472ae19a@gateway/web/freenode/ip.71.42.225.154) (Ping timeout: 265 seconds)
  793. # [18:02] * Joins: paul_irish (~paul_iris@67.218.107.122)
  794. # [18:03] * Quits: mahemoff (~mahemoff@nat/google/x-qxgoixdgrbeiewux) (Quit: mahemoff)
  795. # [18:05] <paul_irish> guys'
  796. # [18:05] <paul_irish> going live.
  797. # [18:05] <paul_irish> http://twitter.com/#!/w3fools <=====
  798. # [18:05] <tbranyen> :O
  799. # [18:06] * Joins: snover (~Adium@unaffiliated/snover)
  800. # [18:07] * Joins: mahemoff (~mahemoff@74.125.57.60)
  801. # [18:07] <paul_irish> http://twitter.com/#!/w3fools <===== PICK YR FAVE and RT
  802. # [18:08] <alrra> yey :D
  803. # [18:09] <mkwst> clever. nice. :)
  804. # [18:09] * Joins: nimbupani (~Adium@c-24-22-131-46.hsd1.wa.comcast.net)
  805. # [18:11] <ben_c> RT'd
  806. # [18:12] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
  807. # [18:13] <tw2113> any reason why some of the w3fools entries have strikethrough?
  808. # [18:14] * Joins: shwetank (~emailshwe@122.173.85.222)
  809. # [18:14] <felcom> http://w3schools.com/cert/default.asp LOL
  810. # [18:15] <thatryan> PITY THE FOOL! lol yes
  811. # [18:15] <felcom> i love that the prices for HTML === PHP
  812. # [18:15] <tw2113> if you want a certificate, I'd be willing to design one for you in photoshop/gimp
  813. # [18:15] * Quits: dmachi1 (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net) (Read error: Connection reset by peer)
  814. # [18:16] <felcom> i can do that myself, but thanks! =D
  815. # [18:16] <thatryan> pssh, tw2113 ill do it in mspaint what now
  816. # [18:16] * Joins: dmachi (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net)
  817. # [18:16] <thatryan> shit, first i have to buy a pc
  818. # [18:16] <felcom> i mean if you're gonna sell BS certs, at least make the prices somewhat realistic
  819. # [18:16] * tw2113 has contribution on the page but lacks name in the contributors list
  820. # [18:16] <tw2113> i'm prefectly fine with that :D
  821. # [18:18] <tw2113> heh, .Net magazine just emailed me to let let me know that due to shite weather in the US, shipping of my first issue may be delayed
  822. # [18:18] <thatryan> i wanna contribute! :D
  823. # [18:18] <thatryan> me me
  824. # [18:18] <felcom> paul_irish: you guys should make w3fools certs
  825. # [18:18] * moneal|a is now known as moneal
  826. # [18:18] <tw2113> given that i was under the impression it'd be a few more weeks, this is news to me
  827. # [18:18] <paul_irish> felcom: put in the konami code.
  828. # [18:18] <tw2113> i may get one sooner than expected
  829. # [18:19] <felcom> paul_irish: LOL
  830. # [18:19] <felcom> nice!
  831. # [18:19] <paul_irish> :D
  832. # [18:19] <paul_irish> that was all bentruyman's genius
  833. # [18:19] <tw2113> i wonder how many people will scoff at w3fools saying that it's not a long enough list of complaints to ignore the site completely
  834. # [18:19] <thatryan> konami awesome lol
  835. # [18:19] <bentruyman> ur making me blush!
  836. # [18:19] <bentruyman> :)
  837. # [18:20] * Joins: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net)
  838. # [18:21] * Joins: JKarsrud (~JKarsrud@178.74.12.26)
  839. # [18:22] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
  840. # [18:22] * Quits: JKarsrud (~JKarsrud@178.74.12.26) (Read error: Connection reset by peer)
  841. # [18:22] * Joins: JKarsrud (~JKarsrud@178.74.12.26)
  842. # [18:23] <thatryan> […] professional web developers often prefer HTML editors like FrontPage or Dreamweaver, instead of writing plain text.
  843. # [18:23] <thatryan> lol wow it really says that?
  844. # [18:24] <thatryan> guess i should buy dreamweaver! lol
  845. # [18:25] <tw2113> who buys...pirate
  846. # [18:25] <tw2113> YARR!
  847. # [18:25] <thatryan> ARG!
  848. # [18:26] * Joins: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com)
  849. # [18:26] <tw2113> cgcardona, you came to join the w3fools.com launch party?
  850. # [18:27] <cgcardona> i guess so
  851. # [18:27] <thatryan> w00t
  852. # [18:27] <tw2113> there is no guess....
  853. # [18:27] <thatryan> or spoon
  854. # [18:27] <cgcardona> sorry - yes, yes i did
  855. # [18:27] * Quits: burg (~burg@c12.uaic.ro) (Ping timeout: 255 seconds)
  856. # [18:28] <tw2113> much better
  857. # [18:28] <cgcardona> hmmm - the page isn't valid? http://validator.w3.org/check?verbose=1&uri=http://w3fools.com/
  858. # [18:29] <paul_irish> we're fixing most of those now
  859. # [18:29] * Joins: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net)
  860. # [18:29] * Quits: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net) (Changing host)
  861. # [18:29] * Joins: peol (~andree@unaffiliated/peol)
  862. # [18:29] <agu10^> hi
  863. # [18:29] <agu10^> what do you think of CMSs ?
  864. # [18:29] <thatryan> lots of stuff :)
  865. # [18:30] <felcom> i think they make managing content easier
  866. # [18:30] <felcom> *sometimes
  867. # [18:31] <agu10^> cool
  868. # [18:31] <agu10^> can you achieve great designs with them?
  869. # [18:31] <thatryan> you can achieve great designs with anything
  870. # [18:31] <felcom> i'd go so far as to say magnificent designs are even possible
  871. # [18:32] <thatryan> if you try really hard, even supernatural ones
  872. # [18:32] * Joins: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
  873. # [18:32] <agu10^> lol
  874. # [18:32] <agu10^> isn't it hard to get nice designs with a CMS ?
  875. # [18:33] <agu10^> I can't find really good templates... they're all mediocre
  876. # [18:33] <thatryan> paul_irish: who wrote the response sections lol
  877. # [18:33] <tw2113> just cause others suck at it, doesn't mean yours will
  878. # [18:33] * Quits: svenlito (~svenlito@193.111.227.10) (Remote host closed the connection)
  879. # [18:33] <felcom> the best thing to do is to learn to make your own templates
  880. # [18:33] <tw2113> it all depends on their skills
  881. # [18:33] <cgcardona> agu10^: don't look for templates - create your own
  882. # [18:33] <cgcardona> then if it sucks it's your fault
  883. # [18:33] <thatryan> lol
  884. # [18:33] <agu10^> cgcardona, heheh
  885. # [18:33] <agu10^> well, I wanted to find one
  886. # [18:34] <agu10^> it's not possible that they all suck :(
  887. # [18:34] <tw2113> so stop relying on other peoples suckitude
  888. # [18:34] <cgcardona> what cms are you considering?
  889. # [18:34] <felcom> chances are, if you care about your Website, no template will be an exact fit
  890. # [18:34] <thatryan> ++
  891. # [18:35] * Quits: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106) (Ping timeout: 265 seconds)
  892. # [18:35] <paul_irish> thatryan: wha/
  893. # [18:35] <thatryan> the repsones to each little section of w3schools fail, some of them are cracking me up :)
  894. # [18:36] <Ms2ger> What's even more funny is how many of the actual corrections are wrong ;)
  895. # [18:36] <thatryan> orly?
  896. # [18:36] * Joins: LynnWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
  897. # [18:37] <paul_irish> yup.
  898. # [18:37] <paul_irish> crowdsourcing isnt great for accuracy :)
  899. # [18:37] <tw2113> at least we have the power to fix them
  900. # [18:37] <thatryan> lol
  901. # [18:37] <tw2113> i doubt they'll fix their entries
  902. # [18:38] <thatryan> paul_irish: consider throwing a tweet share button at the bottom maybe?
  903. # [18:38] <paul_irish> we thought about it
  904. # [18:39] <paul_irish> decided not to
  905. # [18:39] <thatryan> oohh how about a little "badge" like deal we can sport next to our MDC ones?
  906. # [18:40] <paul_irish> no
  907. # [18:40] <thatryan> ok how about i shutup then? ;)
  908. # [18:41] * Joins: ReyBango (~reybango@adsl-223-135-62.mia.bellsouth.net)
  909. # [18:42] * Joins: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106)
  910. # [18:42] <tw2113> just for now, thatryan, not forever
  911. # [18:43] <thatryan> heh :)
  912. # [18:43] * Quits: mahemoff (~mahemoff@74.125.57.60) (Quit: mahemoff)
  913. # [18:44] * Joins: burg (~burg@c12.uaic.ro)
  914. # [18:46] * Quits: paul_irish (~paul_iris@67.218.107.122) (Remote host closed the connection)
  915. # [18:46] <davidmurdoch> Chrome locked up on w3fools.com for some reason. maybe it was a coincidence.
  916. # [18:46] * Joins: mahemoff (~mahemoff@74.125.57.60)
  917. # [18:48] <davidmurdoch> any designer/front-end devs looking for work in here?
  918. # [18:48] <davidmurdoch> EST timezones please.
  919. # [18:48] <davidmurdoch> timezone*
  920. # [18:49] * Joins: paul_irish (~paul_iris@nat/google/x-gnwzwtqmydasmflz)
  921. # [18:49] * Joins: patcito (~123@190.42.250.61)
  922. # [18:52] <tw2113> yay! nearing 1000 lines in a css file!
  923. # [18:52] <davidmurdoch> I just used w3school on accident. lol. I couldn't remember how to use optgroup for a second.
  924. # [18:52] * Quits: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com) (Quit: dguttman)
  925. # [18:52] <thatryan> go sit in the corner and think about what you did...
  926. # [18:52] <tw2113> paul linked me to a google search filter that removes any instances of the site from my results
  927. # [18:52] <Pewpewarrows> davidmurdoch: https://developer.mozilla.org/en-US/search?q=%s
  928. # [18:52] <Pewpewarrows> is my search keyword url
  929. # [18:53] <Pewpewarrows> so I never had to visit w3schools again
  930. # [18:53] <agu10^> can I replace flash with html5 for making flash-like webpages?
  931. # [18:53] <agu10^> or jquery?
  932. # [18:53] <davidmurdoch> agu10^ , it depends
  933. # [18:53] <agu10^> on what
  934. # [18:53] <felcom> the content
  935. # [18:53] <agu10^> what do you mean?
  936. # [18:54] <felcom> ...
  937. # [18:54] <felcom> work with me here
  938. # [18:54] <Pewpewarrows> agu10^: what kind of webpage
  939. # [18:54] <agu10^> flash-like... lots of animations and graphics
  940. # [18:54] <agu10^> bounciness, transparency, etc
  941. # [18:54] <davidmurdoch> It depends on everything.
  942. # [18:54] <agu10^> http://www.expansivestudios.com/indexflash.html
  943. # [18:54] <Pewpewarrows> javascript has been able to do that for a while
  944. # [18:54] <Pewpewarrows> now CSS can too (to a limited extent)
  945. # [18:55] <agu10^> can you make transparent menus, etc?
  946. # [18:55] <davidmurdoch> CSS can't to blur yet, which flash can.
  947. # [18:55] <agu10^> oh I see... html+css+jQuery will be more limited, right?
  948. # [18:55] <agu10^> :/
  949. # [18:55] <Pewpewarrows> wow, that site brought back a slew of repressed, painful memories
  950. # [18:55] <davidmurdoch> Is there an HTML5-for-Beginners tutorial that has been approved by paul_irish?
  951. # [18:56] <paul_irish> ?g dive into html5
  952. # [18:56] <bot-t> paul_irish, Dive Into HTML5 - http://diveintohtml5.org/
  953. # [18:56] <davidmurdoch> AH!
  954. # [18:56] <Pewpewarrows> splash page, pop-up that's automatically fullscreen even with a dual-monitor setup that spans both screens
  955. # [18:56] <agu10^> yes, the site is not good
  956. # [18:56] <agu10^> but that kind of things
  957. # [18:56] <Pewpewarrows> now I need a therapist again for shitty flash sites, thx
  958. # [18:56] <agu10^> lol
  959. # [18:56] <agu10^> well I mean that kind of graphics
  960. # [18:56] <agu10^> I know the site is wrong in many aspects
  961. # [18:57] <davidmurdoch> yah, it CAN.
  962. # [18:57] <tw2113> bad site! it took over my entire monitor
  963. # [18:57] <felcom> agu10^: theres a lot of opportunity to come up with some great and attractive ideas using html5 & js
  964. # [18:57] * Joins: davidwalsh (~davidwals@75-135-74-55.dhcp.mdsn.wi.charter.com)
  965. # [18:57] * Joins: mikew3c_ (~MikeSmith@EM114-48-174-137.pool.e-mobile.ne.jp)
  966. # [18:57] <felcom> just depends on your knowledge and creativity
  967. # [18:57] <davidmurdoch> Oh noes, I just realized the potential for abuse of the new fullscreen HTML elements coming soon.
  968. # [18:58] <agu10^> :|
  969. # [18:58] <davidmurdoch> Qk
  970. # [18:59] <felcom> fullscreen i can deal with, just dont take away my browser navigation, that makes me mad
  971. # [19:00] <agu10^> xD
  972. # [19:00] <agu10^> well, now can I do that?
  973. # [19:00] * Quits: mikew3c (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp) (Ping timeout: 240 seconds)
  974. # [19:00] * mikew3c_ is now known as mikew3c
  975. # [19:01] <davidmurdoch> you can't do fullscreen HTML yet.
  976. # [19:01] <davidmurdoch> well, not without good ol' F11
  977. # [19:01] <Pewpewarrows> have we already discussed http://w3fools.com/ ?
  978. # [19:01] <davidmurdoch> yah, paul came in and announced it.
  979. # [19:01] <Pewpewarrows> because I just spent the last 30 seconds laughing from it
  980. # [19:01] <Pewpewarrows> DAMMIT
  981. # [19:02] <paul_irish> so slow
  982. # [19:02] <davidmurdoch> Pewpewarrows: try konami code on it.
  983. # [19:02] <Pewpewarrows> davidmurdoch: lol
  984. # [19:03] <Pewpewarrows> I'm gonna print that out and frame it
  985. # [19:04] <tw2113> need to get it listed on http://konamicodesites.com/
  986. # [19:07] * Quits: dcadenas (~dcadenas@r186-48-201-251.dialup.adsl.anteldata.net.uy) (Ping timeout: 240 seconds)
  987. # [19:08] * Joins: jacine (~jacine@drupal.org/user/88931/view)
  988. # [19:08] * Quits: jeremyselier (~Jeremy@pro75-4-82-238-200-10.fbx.proxad.net) (Quit: jeremyselier)
  989. # [19:11] * Joins: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com)
  990. # [19:11] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
  991. # [19:15] * Quits: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar) (Remote host closed the connection)
  992. # [19:15] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
  993. # [19:16] <Pewpewarrows> holy hell, if that WebM decode in flash gets finished, can we finally only have to encode videos once?
  994. # [19:16] <Pewpewarrows> say it ain't so
  995. # [19:18] <alcuadrado> unluckly not :(
  996. # [19:18] <alcuadrado> iOs is the problem
  997. # [19:18] * Joins: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
  998. # [19:21] <Pewpewarrows> I don't think it'll be too long before apple follows suit with WebM
  999. # [19:23] <ben_c> the thing it comes down to is the hardware decoders in the devices..
  1000. # [19:23] <alcuadrado> yeah, that's the problem
  1001. # [19:23] <alcuadrado> and hardware doesn't have remote updates
  1002. # [19:23] <alcuadrado> :(
  1003. # [19:24] <ben_c> bloody hardware
  1004. # [19:24] <agu10^> should I make my websites using html5 or still has to be adopted?
  1005. # [19:24] <Neiluj> paul_irish: is it planned to make Modernizr apply css classes based on input types support ?
  1006. # [19:24] <nimbupani> agu10^: pls use html5 doctype
  1007. # [19:24] <nimbupani> if nothing else
  1008. # [19:25] <nimbupani> make this world better 1 doctype at a time.
  1009. # [19:25] <agu10^> well should I still use html4 ?
  1010. # [19:25] <paul_irish> Neiluj: no
  1011. # [19:25] <agu10^> not every browser supports html5...
  1012. # [19:25] <Neiluj> paul_irish: is there any reason ?
  1013. # [19:25] <alcuadrado> agu10^: all html4 is html5 compatible. well, almost
  1014. # [19:25] <paul_irish> you're the first one to ask for it
  1015. # [19:25] <Ms2ger> agu10^, all browsers support <!doctype html>
  1016. # [19:25] * Joins: tw2113 (~tw2113asw@host-66-96-230-24.midco.net)
  1017. # [19:25] * Quits: tw2113 (~tw2113asw@host-66-96-230-24.midco.net) (Changing host)
  1018. # [19:25] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
  1019. # [19:25] <paul_irish> also it would balloon the size of that className bigtime
  1020. # [19:26] <agu10^> why do I need to use <!doctype> ??
  1021. # [19:26] <Neiluj> mmh that's what I thought
  1022. # [19:26] <paul_irish> it's the easiest way to get a consistent rendering across browsers, agu10^
  1023. # [19:26] <agu10^> I never do that
  1024. # [19:26] <paul_irish> that among other things.
  1025. # [19:26] <agu10^> oh, how?
  1026. # [19:26] <Ms2ger> By triggering standards mode
  1027. # [19:26] <agu10^> how does it make it 'consistent' ?
  1028. # [19:26] <paul_irish> something called standards-mode rendering
  1029. # [19:26] <agu10^> wow, so browsers are non-standard by default?
  1030. # [19:27] <nimbupani> ?g truth about doctypes
  1031. # [19:27] <bot-t> nimbupani, The Truth about Doctypes | Nimbupani Designs - http://nimbupani.com/the-truth-about-doctypes.html
  1032. # [19:27] <Ms2ger> See https://developer.mozilla.org/en/mozilla%27s_quirks_mode
  1033. # [19:27] <shwetank> <hipster> i use html4 doctype just to be ironic.</hipster>
  1034. # [19:27] <agu10^> :O
  1035. # [19:27] <nimbupani> :))
  1036. # [19:27] <Neiluj> maybe Modernizr.applyClassnames('inputtypes') ? :)
  1037. # [19:27] <Neiluj> or something :P
  1038. # [19:27] <Ms2ger> I use the HTML4 doctype because the W3C pubrules make me
  1039. # [19:27] <paul_irish> Neiluj: if you write the code.. i'd be happy to link it up in the wiki/docs
  1040. # [19:27] <paul_irish> i use <!doctype html public "✰"> to be a real jerk. :)
  1041. # [19:27] <Neiluj> sure, what would be the cleanest way ?
  1042. # [19:28] <paul_irish> Neiluj: i guess that's up to you.
  1043. # [19:28] <Neiluj> I mean "syntax"
  1044. # [19:28] <Ms2ger> paul_irish, jerk :)
  1045. # [19:28] <paul_irish> ;)
  1046. # [19:28] <paul_irish> it works!
  1047. # [19:28] <paul_irish> sadly not without `public` though
  1048. # [19:28] <tw2113> this week i plan to use the html6 doctype on all my own sites....<!>
  1049. # [19:29] * Quits: JKarsrud (~JKarsrud@178.74.12.26) (Quit: Leaving.)
  1050. # [19:29] <paul_irish> Neiluj: shrug. however you like.
  1051. # [19:30] <davidmurdoch> paul_irish, you ever look into setting the Http Header for Server to "✰"?
  1052. # [19:30] <tw2113> put it all on one line Neiluj
  1053. # [19:30] <paul_irish> you figured out how to do it in IIS. i couldnt find a way in apache.
  1054. # [19:30] <davidmurdoch> well thats lame.
  1055. # [19:31] <paul_irish> yes
  1056. # [19:31] <Neiluj> tw2113: what do you mean ?
  1057. # [19:32] <tw2113> <!DOCTPYE><html>......</body></html>
  1058. # [19:32] <tw2113> don't hit enter in your typing
  1059. # [19:32] <nimbupani> o dear :/
  1060. # [19:32] <nimbupani> neets eh paul_irish http://www.iowasportscamps.com/
  1061. # [19:33] <tw2113> don't worry nimbupani i'm just joking about the single line bit
  1062. # [19:33] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Quit: dgathright)
  1063. # [19:33] <paul_irish> kinda nice
  1064. # [19:33] <agu10^> <!doctype html>
  1065. # [19:33] <davidmurdoch> lowercase the doctype, please.
  1066. # [19:33] <agu10^> davidmurdoch, it is lowercase...
  1067. # [19:33] <davidmurdoch> not, you.
  1068. # [19:34] <davidmurdoch> i don't know where that comma came from.
  1069. # [19:34] <agu10^> <!dockpie http>
  1070. # [19:34] <tw2113> what's wrong with capital doctypes?
  1071. # [19:34] <nimbupani> WHY DO YOU LIKE CAPS
  1072. # [19:34] <agu10^> taht they are capital sins...
  1073. # [19:34] * Joins: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
  1074. # [19:34] <davidmurdoch> <INPUT TYPE='text' />
  1075. # [19:34] <agu10^> lol
  1076. # [19:34] <tw2113> i just do it for the doctype declaration, the rest are lowercase
  1077. # [19:34] <agu10^> i hate when they use caps... why is that??
  1078. # [19:34] <davidmurdoch> why?
  1079. # [19:34] <tw2113> i think it looks better
  1080. # [19:35] <agu10^> because I dont like caps
  1081. # [19:35] <davidmurdoch> agu10^: blame the 90s
  1082. # [19:35] <agu10^> tw2113, lol
  1083. # [19:35] <agu10^> fucking 90s, they're the root of all evil
  1084. # [19:35] <davidmurdoch> HTML compresses better if you use a lowercase HTML5 doctype.
  1085. # [19:35] <agu10^> why did they do that in the 90s ??
  1086. # [19:35] <tw2113> but they brought us grunge and tragic heroin overdoses!
  1087. # [19:35] <davidmurdoch> why do planes fly, man?
  1088. # [19:35] <davidmurdoch> and miley cyrus.
  1089. # [19:35] <agu10^> were they absolutely mad in the 90s or what? their source code is always messy, nonstandard, and awful!!!
  1090. # [19:35] <davidmurdoch> er, wait.
  1091. # [19:35] <davidmurdoch> nevermind.
  1092. # [19:36] <agu10^> wut
  1093. # [19:36] <tw2113> agu10^, that was before people started practicing standards
  1094. # [19:36] <agu10^> hahah
  1095. # [19:36] <agu10^> well, but still code was awful
  1096. # [19:36] <tw2113> this was not something that was in place from the getgo
  1097. # [19:36] <agu10^> not only nonstandard, also awful, functions were all obfuscated... the whole code was obfuscated...
  1098. # [19:36] <davidmurdoch> tw2113: I"m been using HTML5 since 1995
  1099. # [19:36] <davidmurdoch> i've*
  1100. # [19:36] <davidmurdoch> :-p
  1101. # [19:37] <agu10^> why do people still use code and conventions from the 90s? it's suicide
  1102. # [19:37] * Joins: dguttman (~dguttman@gige.bur.digisynd.com)
  1103. # [19:37] <tw2113> there are still sites that use tables for layout, in 2011
  1104. # [19:37] <davidmurdoch> my fav: http://www2.warnerbros.com/spacejam/movie/jam.htm
  1105. # [19:37] <tw2113> i call them potential clients
  1106. # [19:38] <agu10^> html5 is still too similar to html4... c'mon, you didn't come up with something at least a big better????
  1107. # [19:38] <agu10^> html is way old
  1108. # [19:38] <davidmurdoch> Badda Bing, Badda Boom
  1109. # [19:38] <Ms2ger> Like XHTML2?
  1110. # [19:38] <agu10^> davidmurdoch, just boom
  1111. # [19:38] <agu10^> Ms2ger, for example, yes!
  1112. # [19:38] <Ms2ger> How much of XHTML2 can you use in browsers today?
  1113. # [19:38] <davidmurdoch> whats the func to revere an array in php?
  1114. # [19:38] <agu10^> why are we doomed to use html5 instead of xhtml or something?
  1115. # [19:38] <agu10^> Ms2ger, idk
  1116. # [19:38] <Ms2ger> Nothing
  1117. # [19:38] * Quits: m_W (m_W@c-24-0-228-200.hsd1.nj.comcast.net) (Read error: Connection reset by peer)
  1118. # [19:39] <paul_irish> ^ ^
  1119. # [19:39] <Ms2ger> Do you know why?
  1120. # [19:39] <tw2113> because html5 has become the natural evolution of the web
  1121. # [19:39] <agu10^> Ms2ger, i dont
  1122. # [19:39] <agu10^> it's abandoned?
  1123. # [19:39] <tw2113> and they have decided not to push forward with xhtml2
  1124. # [19:39] <Ms2ger> Because they started over instead of remaining backwards compatible
  1125. # [19:39] <agu10^> tw2113, why is that?
  1126. # [19:39] <agu10^> I don't see why
  1127. # [19:39] <agu10^> browsers don't want to implement it?
  1128. # [19:39] <agu10^> is that what you mean?
  1129. # [19:40] <shwetank> you can still code in xhtml style using html5 and serve it as xml if you want
  1130. # [19:40] * Quits: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com) (Remote host closed the connection)
  1131. # [19:40] <Ms2ger> Browsers will not implement things if they break the web, indeed
  1132. # [19:40] <agu10^> hmm
  1133. # [19:40] <agu10^> Ms2ger, break the web?
  1134. # [19:40] <agu10^> use <!doctype xhtml>
  1135. # [19:41] <Ms2ger> Another mode? Quirks mode showed us how bad that turns out
  1136. # [19:41] <davidmurdoch> yah, like removing h.256 codec support.
  1137. # [19:41] <tw2113> http://www.webdirections.org/blog/xhtml2-is-dead-long-live-html5/
  1138. # [19:41] <agu10^> Ms2ger, ?
  1139. # [19:43] <agu10^> we have to reinvent the whole browser
  1140. # [19:43] <agu10^> this sucks
  1141. # [19:43] * tw2113 facepalms
  1142. # [19:43] <alcuadrado> wow, great news! microsoft seems to be changing its position towards video
  1143. # [19:43] <tw2113> link or it didn't happen alcuadrado
  1144. # [19:43] * agu10^ facepalms at tw2113
  1145. # [19:44] <alcuadrado> http://www.microsoft.com/downloads/en/details.aspx?FamilyID=905b4d10-9cde-4d32-b576-c942d1375ceb&displaylang=en
  1146. # [19:44] <shwetank> huh?
  1147. # [19:46] <Pewpewarrows> are there technical terms for the actual grippable bar in a scrollbar, as opposed to the container with the arrows and background?
  1148. # [19:46] <tw2113> here you go agu10^ http://css-tricks.com/html-5-vs-xhtml-2-an-article-roundup-and-poll/
  1149. # [19:46] <davidmurdoch> Why can't microsoft use URL rewriting to make that url readable?
  1150. # [19:46] <paul_irish> ?g styling webkit scrollbar @ Pewpewarrows
  1151. # [19:46] <bot-t> Pewpewarrows, Surfin' Safari - Blog Archive Styling Scrollbars - http://webkit.org/blog/363/styling-scrollbars/
  1152. # [19:47] <tw2113> because they're too busy failing, davidmurdoch
  1153. # [19:47] <alcuadrado> they are fixing disney movies
  1154. # [19:47] <paul_irish> alcuadrado: awesome! the two things i paid money for will work like they're supposed to!
  1155. # [19:47] <Pewpewarrows> paul_irish: stop knowing everything
  1156. # [19:47] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Quit: dgathright)
  1157. # [19:47] <paul_irish> aiight
  1158. # [19:48] <davidmurdoch> ?fpi
  1159. # [19:48] <bot-t> fucking paul irish!
  1160. # [19:49] <Neiluj> paul_irish: about Modernizr coding conventions, as I will prefix the classes with "inputtypes" and as Modernizr classes are using dashes only with ".no-", is it correct to not add other dashes after it, like ".no-inputtypesrange" or ".no-inputtypes-range" ? :-/
  1161. # [19:49] * Joins: m_W (m_W@c-24-0-228-200.hsd1.nj.comcast.net)
  1162. # [19:50] <alcuadrado> nimbupani: great article on doctypes
  1163. # [19:51] <alcuadrado> btw: selected text is completly unreadable, at least in chrome on linux
  1164. # [19:51] <Neiluj> I realize that there's not similar case yet, every non-boolean (litteral objects) Modernizr properties are the same one that are not class-applied (video/audio format, input types&attrs)
  1165. # [19:51] <nimbupani> thanks alcuadrado ! yeah I gotta fix it :(
  1166. # [19:52] <mikesusz> has anyone had IE show wingdings instead of their @font-face embed? i made it live and it's not a test TLD or anything, it's still happening. :(
  1167. # [19:54] <davidmurdoch> no
  1168. # [19:54] * Quits: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net) (Quit: masondesu)
  1169. # [19:58] * Quits: nimbupani (~Adium@c-24-22-131-46.hsd1.wa.comcast.net) (Quit: Leaving.)
  1170. # [19:59] * Parts: shwetank (~emailshwe@122.173.85.222)
  1171. # [19:59] * Joins: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk)
  1172. # [20:00] <Neiluj> anyone to answer me about this Modernizr name convention special case ?
  1173. # [20:01] <danielfilho> this scrollbar thing reminds me ie6 saga.
  1174. # [20:01] <Neiluj> paul_irish: I'm ready to push, just need to know about this
  1175. # [20:01] <danielfilho> but i like it.
  1176. # [20:01] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
  1177. # [20:01] <danielfilho> sorry. I'm working as hell today. so I come here and try to summerize everything :D
  1178. # [20:01] * Joins: miketayl_r (~miketaylr@206.217.92.186)
  1179. # [20:02] * miketayl_r is now known as miketaylr
  1180. # [20:05] * Joins: dgathright (~dgathrigh@nat/yahoo/x-zhbyykjlhreejnvu)
  1181. # [20:05] <paul_irish> Neiluj: what are you asking
  1182. # [20:05] <Neiluj> ".no-inputtypesrange" or ".no-inputtypes-range" ?
  1183. # [20:05] <Neiluj> about dashes
  1184. # [20:06] * Joins: Velanor (~Velanor@cpc7-harb9-2-0-cust230.perr.cable.virginmedia.com)
  1185. # [20:07] * Quits: miketaylr (~miketaylr@206.217.92.186) (Remote host closed the connection)
  1186. # [20:07] * Parts: Velanor (~Velanor@cpc7-harb9-2-0-cust230.perr.cable.virginmedia.com)
  1187. # [20:07] <paul_irish> hmm
  1188. # [20:07] * Joins: miketaylr (~miketaylr@206.217.92.186)
  1189. # [20:07] <paul_irish> no extra dash
  1190. # [20:07] <Neiluj> even if it's inside litterals ? it's like feature grouping
  1191. # [20:08] <Neiluj> ok for me, you tell me
  1192. # [20:09] <paul_irish> yeah
  1193. # [20:09] <paul_irish> no extra dash
  1194. # [20:10] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
  1195. # [20:10] <tw2113> yikes, i should update my firefox on my craptop Winxp machine
  1196. # [20:10] <tw2113> it's only at 3.5 series
  1197. # [20:10] <Neiluj> ok
  1198. # [20:10] <thatryan> firefox is screwing with me today, keeps putting a huge gap margin up on top of body i cant find whyyyyyy
  1199. # [20:10] <tw2113> link?
  1200. # [20:11] <snover> thatryan: Does the first element in your body have a huge margin?
  1201. # [20:11] <thatryan> snover: no, no margin at all
  1202. # [20:11] <thatryan> and it is perfectly fine in chrome
  1203. # [20:11] <thatryan> tw2113: still offline right now
  1204. # [20:11] * Joins: nohk (~nohk@e180099119.adsl.alicedsl.de)
  1205. # [20:11] <snover> thatryan: it sounds familiar but I can’t remember exactly what or why.
  1206. # [20:11] * Quits: nohk (~nohk@e180099119.adsl.alicedsl.de) (Remote host closed the connection)
  1207. # [20:11] <alcuadrado> why does <!doctype html> triggers almost standard mode in ie6? casuality?
  1208. # [20:12] <thatryan> snover: lol thanks ;) if it comes to you, let me know!
  1209. # [20:12] <Neiluj> paul_irish: done, now I hit "Pull request" right ?
  1210. # [20:12] <paul_irish> ya
  1211. # [20:12] <snover> alcuadrado: IE6 doesn’t have a standards mode ;)
  1212. # [20:13] <tw2113> haha, IE6+standards=FAIL
  1213. # [20:14] <Neiluj> paul_irish: pulled
  1214. # [20:15] <paul_irish> thx
  1215. # [20:15] <Neiluj> tw2113: sorry, one line wasn't enough ;-)
  1216. # [20:15] <tw2113> was worth the shot
  1217. # [20:15] <mikesusz> thatryan - you using a cms or anything?
  1218. # [20:16] <Neiluj> mmh I already have improvement to add...
  1219. # [20:16] <thatryan> mikesusz: nope, straight html5 valid and all
  1220. # [20:16] <mikesusz> i noticed wordpress 3.1 puts the admin bar, even if you hide it with css it adds top padding to the body with !important
  1221. # [20:16] <mikesusz> ah
  1222. # [20:16] <tw2113> i disable the admin bar
  1223. # [20:16] <mikesusz> tw2113 - yeah i do now
  1224. # [20:20] <tw2113> firefox 3.6 doesn't utilize placeholder attributes right?
  1225. # [20:20] <Ms2ger> No
  1226. # [20:20] <tw2113> good, this jquery is working afterall, except in IE
  1227. # [20:20] <tw2113> i think IE is hating the jquery in general at the moment anyway, so stuff is likey getting broked
  1228. # [20:20] * Quits: miketaylr (~miketaylr@206.217.92.186) (Remote host closed the connection)
  1229. # [20:22] * Joins: masondesu (~Mason@c-75-64-233-135.hsd1.ms.comcast.net)
  1230. # [20:22] * Joins: miketaylr (~miketaylr@206.217.92.186)
  1231. # [20:27] * Quits: mahemoff (~mahemoff@74.125.57.60) (Quit: mahemoff)
  1232. # [20:27] * Joins: LynnMWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
  1233. # [20:29] * Joins: mahemoff (~mahemoff@nat/google/x-pciiagbqnzqredjq)
  1234. # [20:30] * Quits: LynnWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 240 seconds)
  1235. # [20:31] * Quits: masondesu (~Mason@c-75-64-233-135.hsd1.ms.comcast.net) (Quit: masondesu)
  1236. # [20:33] <Neiluj> paul_irish: I made some changes, pulled again
  1237. # [20:33] <Neiluj> we can do Modernizr.applyClasses('audio video input inputtypes') now
  1238. # [20:33] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
  1239. # [20:34] <paul_irish> baller.
  1240. # [20:34] <paul_irish> I'll probably extend it so you can do .applyClasses(jQuery.support)
  1241. # [20:36] <Neiluj> mmh not a bad idea indeed :)
  1242. # [20:37] <Neiluj> in my case, I needed a way to know if input range was supported for a very little tool I've made for the fun this afternoon
  1243. # [20:38] <Neiluj> I didn't even use modernizr for it but I remembered I never saw those classes and that could be really useful imo
  1244. # [20:38] * Quits: burg (~burg@c12.uaic.ro) (Read error: Connection reset by peer)
  1245. # [20:39] * Joins: antonkovalyov (~antonkova@75-101-56-240.dsl.static.sonic.net)
  1246. # [20:43] * Joins: cardona507 (~cardona50@cpe-98-150-150-230.hawaii.res.rr.com)
  1247. # [20:43] * Quits: cardona507 (~cardona50@cpe-98-150-150-230.hawaii.res.rr.com) (Client Quit)
  1248. # [20:43] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Quit: zzzzz)
  1249. # [20:43] <Neiluj> btw, the tool is a simple password generator http://zeedev.aaz.fr/pass/ if any of you have the need :)
  1250. # [20:43] * Joins: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com)
  1251. # [20:43] <Neiluj> you can grow the length with arrow keys, scroll wheels or ... input range
  1252. # [20:44] <felcom> thats neat
  1253. # [20:44] * Quits: techrush (~techrush@rrcs-173-198-32-131.west.biz.rr.com) (Remote host closed the connection)
  1254. # [20:44] <Neiluj> thx felcom ;)
  1255. # [20:45] * Quits: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it) (Ping timeout: 272 seconds)
  1256. # [20:49] * Joins: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it)
  1257. # [20:57] * Joins: burg (~burg@c12.uaic.ro)
  1258. # [20:59] * Joins: felcom_ (~felcom@rrcs-71-43-19-2.se.biz.rr.com)
  1259. # [20:59] * Quits: felcom_ (~felcom@rrcs-71-43-19-2.se.biz.rr.com) (Read error: Connection reset by peer)
  1260. # [21:03] * Quits: mahemoff (~mahemoff@nat/google/x-pciiagbqnzqredjq) (Quit: mahemoff)
  1261. # [21:03] * Quits: felcom (~felcom@rrcs-71-43-19-2.se.biz.rr.com) (Ping timeout: 240 seconds)
  1262. # [21:04] * Joins: mahemoff (~mahemoff@nat/google/x-pfungpwxwupbuhks)
  1263. # [21:10] <Neiluj> http://w3fools.com/ :)
  1264. # [21:10] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
  1265. # [21:10] <tw2113> woo, easy FF4beta updating
  1266. # [21:13] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Quit: Bye!)
  1267. # [21:13] * Joins: nimbupani (~Adium@c-24-22-131-46.hsd1.wa.comcast.net)
  1268. # [21:14] * Quits: mahemoff (~mahemoff@nat/google/x-pfungpwxwupbuhks) (Quit: mahemoff)
  1269. # [21:16] * Joins: Trisox (~Trisox@g31044.upc-g.chello.nl)
  1270. # [21:19] * Joins: mahemoff (~mahemoff@74.125.57.52)
  1271. # [21:21] * Parts: snover (~Adium@unaffiliated/snover)
  1272. # [21:22] <dgathright> http://blog.chromium.org/2011/01/more-about-chrome-html-video-codec.html
  1273. # [21:22] * Quits: Levis (~Levis@93-63-109-252.ip27.fastwebnet.it) (Remote host closed the connection)
  1274. # [21:25] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
  1275. # [21:28] <mikew3c> nimbupani: sorry, I didn't know youse was logging all my searches
  1276. # [21:28] <nimbupani> wat :/
  1277. # [21:29] <mikew3c> whencanIuse
  1278. # [21:29] <nimbupani> :D :D :D :D :D
  1279. # [21:30] <nimbupani> i hope fyrd makes more such esoteric search terms public!
  1280. # [21:30] * Joins: Ramosa (Ramosa@unaffiliated/harald/x-000000001)
  1281. # [21:30] <nimbupani> http://sex.partofhtml5.com/
  1282. # [21:31] * Quits: rakeshpai (~rakeshpai@59.162.86.164) (Quit: rakeshpai)
  1283. # [21:31] <mikew3c> heh
  1284. # [21:32] <nimbupani> I think partofhtml5.com is alex sexton's work :)
  1285. # [21:33] <tw2113> he seems like a character
  1286. # [21:34] <danielfilho> OMFG
  1287. # [21:34] <danielfilho> inline-block doesn't work on IE
  1288. # [21:34] <danielfilho> GIMME GATES' NUMBER NOW!
  1289. # [21:34] <mikesusz> danielfilho - 9?
  1290. # [21:34] <danielfilho> 8
  1291. # [21:34] <tw2113> it should take a number for things that don't work in IE
  1292. # [21:34] <mikesusz> this is news? ;)
  1293. # [21:34] <danielfilho> i never needed to use it there.
  1294. # [21:35] <tw2113> hmmm interesting, very interesting "You can now use SVG as the source of an <img> tag. You can even animate them with SMIL. And you can also use SVGs as backgrounds in CSS."
  1295. # [21:35] * Joins: cocoadaemon (~cocoadaem@2a01:e35:8a99:e90:20d:93ff:fe3b:868c)
  1296. # [21:35] <mikew3c> "something doesn't work in IE" is like a news story "Dog Bites Man" … something that works in IE is like a news story "Man Bites Dog"
  1297. # [21:36] <mikesusz> with as much time as i've spent trying to figure out filter: lately, it actually can do a lot of stuff
  1298. # [21:36] <mikesusz> it's just extremely difficult
  1299. # [21:38] <Neiluj> got to go, have a nice we guys
  1300. # [21:39] * Quits: Neiluj (~Julien@195.200.175.214) (Quit: Neiluj)
  1301. # [21:40] <alcuadrado> This game is sooo awosome http://redshootinghood.info =)
  1302. # [21:41] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Quit: Leaving...)
  1303. # [21:42] * Quits: noxxten (noxxten@adsl-93-90-217.owb.bellsouth.net)
  1304. # [21:45] <tw2113> damn, i can't get the svg stuff working yet
  1305. # [21:47] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Ping timeout: 276 seconds)
  1306. # [21:50] <tw2113> ooh "Firefox 4 includes the changes required to help improve your privacy online by closing a decade-old hole in CSS rules that let any website query your browsing history. These changes have also been picked up by WebKit-based browsers and we?ve heard rumors that IE 9 might pick up this important change as well."
  1307. # [21:53] * Joins: shipit (~sumeet@adsl-63-200-129-20.dsl.snfc21.pacbell.net)
  1308. # [21:53] * Joins: jamesarosen (~jamesaros@204.28.122.178)
  1309. # [21:55] * Joins: mokush (~quassel@188.24.40.254)
  1310. # [21:55] <antonkovalyov> nimbupani, paul_irish: could you please merge my latest pull request to html5boilerplate?
  1311. # [21:55] <antonkovalyov> i have more coming :)
  1312. # [21:56] <mokush> you guys know if weston (or somebody else) does any work on a new webforms2?
  1313. # [21:57] * Quits: jetienne (~jerome@ivr94-6-82-230-255-246.fbx.proxad.net) (Remote host closed the connection)
  1314. # [22:00] * jacine is now known as jacine|afk
  1315. # [22:01] * Joins: Mussious (~kamil@dfv192.neoplus.adsl.tpnet.pl)
  1316. # [22:02] * Joins: bios (~bios@shup.com)
  1317. # [22:03] * Quits: miketaylr (~miketaylr@206.217.92.186) (Quit: miketaylr)
  1318. # [22:04] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
  1319. # [22:05] * Quits: lukegalea (~lukegalea@tor.office.avidlifemedia.com) (Quit: lukegalea)
  1320. # [22:07] * Quits: Ms2ger (~Ms2ger@91.181.253.59) (Quit: nn)
  1321. # [22:08] <davidmurdoch> $.html([$element,$element]) doesn't work. interesting.
  1322. # [22:08] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Quit: ...)
  1323. # [22:09] * Joins: dguttman (~dguttman@gige.bur.digisynd.com)
  1324. # [22:09] <davidmurdoch> er, i mean $("#myElement").html( [$element, $element] ) doesn't work
  1325. # [22:10] * umode is now known as chipotle
  1326. # [22:12] * Joins: miketaylr (~miketaylr@206.217.92.186)
  1327. # [22:14] * Quits: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar) (Remote host closed the connection)
  1328. # [22:15] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
  1329. # [22:15] * Parts: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
  1330. # [22:21] * Joins: sulcalibur (~sulcalibu@cpc10-enfi15-2-0-cust120.hari.cable.virginmedia.com)
  1331. # [22:22] <tbranyen> davidmurdoch: well... why would that?
  1332. # [22:22] <mokush> davidmurdoch: well jquerys html works like innerhtml
  1333. # [22:22] <tbranyen> i'm missing something
  1334. # [22:22] <mokush> davidmurdoch: so you can only place place strings inside, from what I know.
  1335. # [22:25] <davidmurdoch> mokush: not true
  1336. # [22:25] <davidmurdoch> oops: $("#myElement").append( [$element, $element] )
  1337. # [22:26] <davidmurdoch> i mean append, not html
  1338. # [22:26] <mokush> davidmurdoch: that's a different thing.
  1339. # [22:27] <paul_irish> .empty().append( $([whatever,whatever]) );
  1340. # [22:27] <mokush> as append supports both nodes, elements, jquery objects.
  1341. # [22:27] <davidmurdoch> thank paul, I ended up figuring it out
  1342. # [22:27] <paul_irish> sure ya did
  1343. # [22:28] <davidmurdoch> haha. didn't yayquery talk about wanting a method that does empty().append() in one go?
  1344. # [22:28] <mokush> so paul_irish, when are you guys removing flash?
  1345. # [22:29] <paul_irish> http://blog.chromium.org/2011/01/more-about-chrome-html-video-codec.html
  1346. # [22:29] <paul_irish> $.fn.emptyAndAppend = function(){ return this.empty().append.call(this,arguments); }
  1347. # [22:29] <paul_irish> there u go david :)
  1348. # [22:30] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
  1349. # [22:30] <davidmurdoch> too verbose.
  1350. # [22:31] <davidmurdoch> :-)
  1351. # [22:31] <paul_irish> $.fn.NO_U
  1352. # [22:32] <davidmurdoch> I now have nothing to say. How do you come back from that?
  1353. # [22:32] * Joins: Michael (~disney@unaffiliated/jabberwock)
  1354. # [22:34] <nimbupani> thats the point
  1355. # [22:35] <mokush> paul_irish is such a bully
  1356. # [22:37] * Joins: LongBeach (~mike@AFontenayssB-152-1-61-106.w82-121.abo.wanadoo.fr)
  1357. # [22:37] <davidmurdoch> Zoolander reference coming up: Earth to Divya: duh; I knew that.
  1358. # [22:37] <antonkovalyov> paul_irish, nimbupani: russian translations are done
  1359. # [22:39] <nimbupani> woah neet antonkovalyov
  1360. # [22:40] <antonkovalyov> i have one pull request there thought before i can merge my translations branch to master
  1361. # [22:40] <antonkovalyov> though*
  1362. # [22:41] <antonkovalyov> now i need this small tiny jquery bugfix to actually happen. sloooooowwww
  1363. # [22:42] <Michael> Which bug is that?
  1364. # [22:42] <antonkovalyov> Michael, http://bugs.jquery.com/ticket/7945#propertyform
  1365. # [22:42] <Michael> thanks
  1366. # [22:42] <antonkovalyov> gonna do another pull request real quick, maybe it will speed things up
  1367. # [22:43] * Joins: murz (~mmurraywa@wcproxy.msnbc.com)
  1368. # [22:44] <Michael> antonkovalyov, It seems that instead of being held up you could use a different name for the key
  1369. # [22:44] <Michael> like j-query
  1370. # [22:44] <antonkovalyov> antonkovalyov, i do use a different name for the key but the bug is still a bug
  1371. # [22:44] <Michael> true
  1372. # [22:45] <Michael> just as long as it's not preventing you from moving forward
  1373. # [22:45] <Michael> Doesn't seem like a showstopper
  1374. # [22:45] <Michael> but yeah
  1375. # [22:45] <antonkovalyov> hah, i just messaged myself above
  1376. # [22:45] <Michael> I know lol
  1377. # [22:45] <antonkovalyov> Michael, we use latest stable release so even if bug is fixed in master I won't see it right away
  1378. # [22:46] <Michael> I see
  1379. # [22:46] <Michael> We're still on 1.4.2 I believe, because we use WebDriver for automated qUnit tests - and > 1.4.2 breaks in webdriver
  1380. # [22:46] <antonkovalyov> Michael, do you happen to know where was that page describing how to properly name branches for pull requests/bugs for jquery?
  1381. # [22:46] <Michael> I do not :/
  1382. # [22:48] * Quits: Mussious (~kamil@dfv192.neoplus.adsl.tpnet.pl) (Quit: Ex-Chat)
  1383. # [22:51] * Quits: peol (~andree@unaffiliated/peol) (Quit: Bye!)
  1384. # [22:53] * Joins: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net)
  1385. # [22:53] * Quits: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net) (Changing host)
  1386. # [22:53] * Joins: peol (~andree@unaffiliated/peol)
  1387. # [22:54] <paul_irish> i do
  1388. # [22:54] * Joins: rwaldron (~rwaldron_@64.119.153.2)
  1389. # [22:54] <paul_irish> rwaldron whats the gist with jquery pull req instructions
  1390. # [22:54] <paul_irish> does bot have a factoid for it
  1391. # [22:55] <paul_irish> antonkovalyov needs it'
  1392. # [22:55] * Quits: Pewpewarrows (~Pewpewarr@75-145-93-41-WashingtonDC.hfc.comcastbusiness.net) (Quit: Leaving)
  1393. # [22:55] <rwaldron> antonkovalyov, https://gist.github.com/672714
  1394. # [22:55] <antonkovalyov> ty
  1395. # [22:55] <paul_irish> txhthxh
  1396. # [22:55] <rwaldron> your welcome
  1397. # [22:55] <rwaldron> you're
  1398. # [22:55] <rwaldron> paul_irish, not that i know of, but there should be
  1399. # [22:56] <paul_irish> bot-t: jquerydevgist is https://gist.github.com/672714
  1400. # [22:56] <bot-t> paul_irish, Stored "jquerydevgist".
  1401. # [22:57] * Quits: mahemoff (~mahemoff@74.125.57.52) (Quit: mahemoff)
  1402. # [22:57] * Quits: Michael (~disney@unaffiliated/jabberwock) (Read error: Connection reset by peer)
  1403. # [22:58] * Quits: jamesarosen (~jamesaros@204.28.122.178) (Remote host closed the connection)
  1404. # [23:00] * Joins: jamesarosen (~jamesaros@204.28.122.178)
  1405. # [23:07] * Quits: LynnMWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Quit: Leaving)
  1406. # [23:08] * Quits: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net) (Remote host closed the connection)
  1407. # [23:09] * Joins: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net)
  1408. # [23:12] <danielfilho> well
  1409. # [23:12] <danielfilho> good weekend for all
  1410. # [23:12] <danielfilho> see you
  1411. # [23:13] <Trisox> hooooooooooooooi
  1412. # [23:15] * Quits: mikew3c (~MikeSmith@EM114-48-174-137.pool.e-mobile.ne.jp) (Quit: Deyr fé deyja, frændr deyr, sjálfr et sama)
  1413. # [23:20] * Joins: Dorward (~Dorward@94-192-4-225.zone6.bethere.co.uk)
  1414. # [23:20] <Dorward> Is there any documentation about backwards compatibility support for the HTML5 short meta charset code?
  1415. # [23:21] <paul_irish> YES.
  1416. # [23:21] <paul_irish> ?g github html5 boilerplate commits master
  1417. # [23:21] <bot-t> paul_irish, Xac/Rails-3-HTML5-Boilerplate - GitHub - https://github.com/Xac/Rails-3-HTML5-Boilerplate
  1418. # [23:21] <paul_irish> COME ONNNNNN google
  1419. # [23:21] * Quits: sulcalibur (~sulcalibu@cpc10-enfi15-2-0-cust120.hari.cable.virginmedia.com) (Quit: Leaving...)
  1420. # [23:23] <paul_irish> Dorward: read this http://blog.whatwg.org/the-road-to-html-5-character-encoding
  1421. # [23:23] <nimbupani> ha ha ha ha
  1422. # [23:23] * Quits: mduncan (~mduncan@216.195.221.2) (Quit: Leaving)
  1423. # [23:25] <Dorward> Thanks
  1424. # [23:28] * Joins: mikew3c (~MikeSmith@EM114-48-174-137.pool.e-mobile.ne.jp)
  1425. # [23:29] * Joins: joemsak (~hubble@173-165-61-105-Illinois.hfc.comcastbusiness.net)
  1426. # [23:30] <antonkovalyov> aaaand done http://bugs.jquery.com/ticket/7945#comment:2
  1427. # [23:31] <antonkovalyov> that was not "real quick" though, haha
  1428. # [23:31] * Quits: hubble (~hubble@dsl081-150-127.chi1.dsl.speakeasy.net) (Ping timeout: 276 seconds)
  1429. # [23:31] * joemsak is now known as hubble
  1430. # [23:38] * Quits: miketaylr (~miketaylr@206.217.92.186) (Quit: W3SCHOOLS 4 LYFE)
  1431. # [23:38] <paul_irish> http://webkit.org/blog/1424/css3-gradients/
  1432. # [23:39] <paul_irish> ?fpi
  1433. # [23:39] <bot-t> fucking paul irish!
  1434. # [23:41] <antonkovalyov> ?Douglas Crockford
  1435. # [23:41] <bot-t> The Immutable Singleton
  1436. # [23:46] * Joins: mahemoff (~mahemoff@87-194-3-205.bethere.co.uk)
  1437. # [23:55] * Quits: mahemoff (~mahemoff@87-194-3-205.bethere.co.uk) (Quit: mahemoff)
  1438. # [23:55] * Quits: mokush (~quassel@188.24.40.254) (Remote host closed the connection)
  1439. # Session Close: Sat Jan 15 00:00:00 2011

The end :)