/irc-logs / freenode / #html5 / 2011-01-14 / end

Options:

# Session Start: Fri Jan 14 00:00:00 2011
# Session Ident: #html5
# [00:00] <tw2113> i can't remember who, but someone in here mentioned my handwrittentweet site idea not being the most accessible, and i am going to do what i can to make it as assessible as can be :D
# [00:00] * Quits: Wooboy (~simon@host-85-201-35-70.brutele.be) (Remote host closed the connection)
# [00:02] <danielfilho> good boy :D
# [00:03] <tw2113> i was thinking about having a custom field in wordpress where I type up what it says in the image with the actual tweet, and put it somewhere in the markup for possible screenreaders
# [00:03] <tw2113> or just put it in the_content() and apply text indent on it
# [00:06] * Quits: jetienne (~jerome@ivr94-6-82-230-255-246.fbx.proxad.net) (Read error: Operation timed out)
# [00:08] <danielfilho> http://jhische.com/workforfree.html
# [00:14] * Quits: lukegalea (~lukegalea@74.198.87.95) (Quit: lukegalea)
# [00:14] * Quits: paul_irish (~paul_iris@216.239.45.19)
# [00:17] * Quits: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
# [00:17] * Joins: jacine (~jacine@drupal.org/user/88931/view)
# [00:17] * Parts: jacine (~jacine@drupal.org/user/88931/view)
# [00:20] <antonkovalyov> wait what
# [00:21] <antonkovalyov> paul_irish is not here O_O
# [00:21] * Quits: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com) (Remote host closed the connection)
# [00:21] <antonkovalyov> have you guys noticed how slow twitter is in chrome?
# [00:21] * Joins: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com)
# [00:23] <tw2113> this is cool http://www.massiveblue.com/
# [00:24] <tw2113> i wonder if i could trigger css3 animation just from moving my mouse away from a :hover
# [00:24] <thatryan> you mean like do it backwards?
# [00:24] <tw2113> sort of
# [00:24] <cgcardona> wow that is cool tw2113
# [00:24] <tw2113> i was thinking set some animation on the hover where it turns to this color
# [00:24] <tw2113> and then when i move it away, it gradually goes back to the original
# [00:25] <thatryan> isnt that what it does anyways...
# [00:25] * Quits: kor (~kor@a83-161-211-173.adsl.xs4all.nl) (Quit: kor)
# [00:25] <thatryan> i fade in my links on hover, then they fade back to original on off...
# [00:27] <tw2113> it may have solved my question of how to do hypercolors
# [00:27] <tw2113> in web design
# [00:28] * ajpiano is now known as ajdatalistpiano
# [00:29] * ajdatalistpiano is now known as ajpiano
# [00:30] * Joins: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
# [00:31] <antonkovalyov> ?help
# [00:31] <bot-t> Get FREE A++ HELP - http://workaround.org/getting-help-on-irc
# [00:32] <antonkovalyov> ?tell paul_irish your HTML5 Boilerplate talk is on the same day as Day of JS conf
# [00:32] <bot-t> antonkovalyov, Okay.
# [00:32] <antonkovalyov> ?ty
# [00:32] <bot-t> antonkovalyov, (TY) Drop Down small or mega menu with elegent effects | jQuery ... - This is to provide a good alternative for having both Mega Menu like flexibility in content display size/structure with very little code. The code is VERY simple, yet builds a powerful drop down me... http://plugins.jquery.com/project/TYmegaMenu
# [00:32] <antonkovalyov> :( no ai
# [00:32] <thatryan> what just happened lol
# [00:33] <antonkovalyov> thatryan, i think ?tell saves a message for somebody who is not here atm
# [00:34] <thatryan> ahh
# [00:34] <antonkovalyov> and ?ty was supposed to be thank you :)
# [00:34] <thatryan> lol
# [00:34] <thatryan> and instead you got a menu?
# [00:34] <antonkovalyov> i think it just searches for jquery plugins?
# [00:34] <thatryan> paul is giving a boilerplate talk?
# [00:34] <antonkovalyov> ?facebox
# [00:34] <bot-t> antonkovalyov, Facebox | jQuery Plugins - Facebox is a jQuery-based, Facebook-style lightbox which can display images, divs, or entire remote pages. It's easy to use and easy to drive programmatically -- use it for error messages, confirma... http://plugins.jquery.com/project/facebox
# [00:34] <antonkovalyov> yep
# [00:35] <antonkovalyov> http://www.sfhtml5.org/calendar/15728914/
# [00:35] <thatryan> ?super awesome!
# [00:35] <bot-t> thatryan, #7442 (slideDown and slideUp "jump" at the beginning and end ... - Opened 2 months ago http://bugs.jquery.com/ticket/7442
# [00:35] <thatryan> LOL
# [00:35] <antonkovalyov> bot-t, hey
# [00:35] <bot-t> Hey antonkovalyov
# [00:36] <antonkovalyov> bot-t, how it is going?
# [00:36] <bot-t> antonkovalyov, Don't count on it.
# [00:36] <thatryan> fail
# [00:36] <thatryan> bot-t: why do you fail?
# [00:36] <bot-t> thatryan, As I see it, yes.
# [00:36] <antonkovalyov> it reminds me of good ol' days with emacs psychiatrist
# [00:36] * Quits: figital (~figital@64.119.153.2) (Quit: Leaving)
# [00:36] <thatryan> bot-t: has more of a personality when talking with paul_irish lol
# [00:36] <bot-t> thatryan, ThickBox 3.1 - http://jquery.com/demo/thickbox/
# [00:37] <thatryan> hmm
# [00:37] * Quits: dcadenas_ (~dcadenas@r186-48-223-155.dialup.adsl.anteldata.net.uy) (Ping timeout: 260 seconds)
# [00:37] <antonkovalyov> i think it tries to tell you something :)
# [00:38] <thatryan> heh no doubt
# [00:38] <tw2113> damn, it's not working on divs
# [00:39] * Quits: jamesarosen (~jamesaros@204.28.122.178) (Read error: Connection reset by peer)
# [00:39] * Joins: jamesarosen (~jamesaros@204.28.122.178)
# [00:40] * Quits: bckenny (~bckenny@nat/google/x-utbxaahbzolkulzj) (Remote host closed the connection)
# [00:40] * Joins: bckenny (~bckenny@nat/google/x-mtxvakdonxmefasd)
# [00:41] <thatryan> tw2113: heheheh
# [00:42] * Joins: dguttman_ (~dguttman@gige.bur.digisynd.com)
# [00:42] <tw2113> i got it to work for the most part with text
# [00:42] <antonkovalyov> thatryan, did you get on waiting list?
# [00:42] <thatryan> nah
# [00:42] <antonkovalyov> bot-t, do you think thatryan is going to get a spot on day of js conference
# [00:42] <bot-t> antonkovalyov, Is that a question?
# [00:43] <antonkovalyov> bot-t, do you think thatryan is going to get a spot on day of js conference?
# [00:43] <bot-t> antonkovalyov, My sources say no.
# [00:43] <thatryan> lol
# [00:43] <thatryan> HA
# [00:43] <antonkovalyov> haha
# [00:43] <antonkovalyov> thatryan, anyway you should :)
# [00:43] <thatryan> bot-t: do i ride unicorns into battle to slay care bears?
# [00:43] <bot-t> thatryan, Ask again later.
# [00:43] <thatryan> damn
# [00:44] * Quits: jeffszusz (~jeffszusz@dyn216-8-170-154.ADSL.mnsi.net) (Remote host closed the connection)
# [00:45] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Ping timeout: 240 seconds)
# [00:45] * dguttman_ is now known as dguttman
# [00:48] * Joins: temhawk (~temhawk@unaffiliated/temhawk)
# [00:48] * Quits: bckenny (~bckenny@nat/google/x-mtxvakdonxmefasd) (Remote host closed the connection)
# [00:48] * Parts: temhawk (~temhawk@unaffiliated/temhawk) ("Leaving...")
# [00:49] * Joins: bckenny (~bckenny@nat/google/x-cmbrkybesvczhlmj)
# [00:53] <antonkovalyov> ?tell bot-t hello
# [00:53] <bot-t> antonkovalyov, Stop playing with me!
# [00:53] <antonkovalyov> hahaha
# [00:53] <antonkovalyov> awesome
# [00:54] <tw2113> ?8ball why are you telling antonkovalyov to stop playing with you? Is it because you play with yourself already?
# [00:54] <bot-t> Most likely.
# [00:54] <antonkovalyov> ?tell ?tell
# [00:54] <bot-t> antonkovalyov, Syntax: tell <nick> <message>
# [00:54] <antonkovalyov> ?tell ? tell
# [00:54] <antonkovalyov> meh :(
# [00:54] <thatryan> HA that was fnny
# [00:54] <thatryan> bot-t: you dont like to be played with?
# [00:54] <bot-t> thatryan, Outlook good.
# [00:54] <thatryan> bot-t: that makes no sense
# [00:54] <bot-t> thank a lot yu deserve a great makes no sense makes no sense
# [00:55] <thatryan> hhhmmm
# [00:55] <antonkovalyov> ? [1,2,3].join(',')
# [00:55] <bot-t> antonkovalyov, jQuery.map() - Translate all items in an array or array-like object to another array of items. http://api.jquery.com/jQuery.map/
# [00:55] <antonkovalyov> ? eval [1,2,3].join(',')
# [00:55] <bot-t> antonkovalyov: "1,2,3"
# [00:55] <antonkovalyov> keeewl
# [00:57] <thatryan> bot-t: eval lim x->100 ln(1/x)
# [00:57] <bot-t> thatryan: SyntaxError: missing ; before statement
# [00:57] <thatryan> ass
# [00:58] <antonkovalyov> ?uninstall google
# [00:58] <bot-t> OK. 301 Moved Permanently http://bing.com
# [00:58] <thatryan> lol
# [00:58] <ben_c> that's amazing.
# [00:58] <antonkovalyov> ?i hate you
# [00:58] <bot-t> NO U
# [00:59] * Quits: masondesu (~Mason@c-75-64-233-135.hsd1.ms.comcast.net) (Ping timeout: 255 seconds)
# [00:59] * Quits: mikew3c (~MikeSmith@EM114-48-159-251.pool.e-mobile.ne.jp) (Ping timeout: 240 seconds)
# [01:00] <antonkovalyov> ?Douglas Crockford is The Immutable Singleton
# [01:00] <bot-t> antonkovalyov, Jim Higson's blog: Prototype Singleton classes - http://jimhigson.blogspot.com/2009/01/prototype-singleton-classes.html
# [01:00] <thatryan> bot-t: dont be mean
# [01:00] <bot-t> thatryan, Is that a question?
# [01:00] <thatryan> bot-t: no, a statement
# [01:00] <bot-t> thatryan, jQuery.each() - A generic iterator function, which can be used to seamlessly iterate over both objects and arrays. Arrays and array-like objects with a length property (such as a function's arguments object) are i... http://api.jquery.com/jQuery.each/
# [01:01] <antonkovalyov> ? "Douglas Crockford" is "The Immutable Singleton"
# [01:01] <bot-t> antonkovalyov, Couldn't find ""Douglas Crockford" is "The Immutable Singleton"" in jQuery Docs.
# [01:01] <antonkovalyov> bot-t: Douglas Crockford is The Immutable Singleton
# [01:01] <bot-t> antonkovalyov, Stored "Douglas Crockford".
# [01:01] <antonkovalyov> ?Douglas Crockford
# [01:01] <bot-t> The Immutable Singleton
# [01:02] <antonkovalyov> awesome
# [01:02] <thatryan> word
# [01:02] <antonkovalyov> bot-t: should you be open source? is yes!
# [01:02] <bot-t> antonkovalyov, Invalid key: "should you be open source?" (Char 26).
# [01:03] <antonkovalyov> bot-t: should you be open source is yes!
# [01:03] <bot-t> antonkovalyov, Stored "should you be open source".
# [01:03] <antonkovalyov> ?should you be open source
# [01:03] <bot-t> yes!
# [01:03] <thatryan> haha nice
# [01:03] <antonkovalyov> k, i am ready for paul now
# [01:03] <thatryan> uh oh
# [01:03] <thatryan> what did you make a script? ;)
# [01:04] <antonkovalyov> thatryan, hm?
# [01:04] <antonkovalyov> btw guys http://bot-t.com/
# [01:04] <thatryan> hm?
# [01:04] * Quits: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com) (Remote host closed the connection)
# [01:05] <antonkovalyov> "what did you make a script?" my english fails here :(
# [01:05] <antonkovalyov> are you asking if i made bot-t?
# [01:05] <bot-t> antonkovalyov, Better not tell you now.
# [01:05] * Joins: jochen___ (~jochen@nat/google/x-epmmtgbvsnxmmrvn)
# [01:05] <antonkovalyov> godamn, bot-t!
# [01:05] <thatryan> ah, meant did you progra responses into bot to get paul with
# [01:05] <thatryan> lol
# [01:05] * Joins: mikew3c (~MikeSmith@EM111-188-13-191.pool.e-mobile.ne.jp)
# [01:05] <thatryan> program*
# [01:05] <antonkovalyov> thatryan, yeah, you can save factoids
# [01:05] <antonkovalyov> thatryan, http://bot-t.com/docs/
# [01:05] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
# [01:06] <thatryan> jesus
# [01:07] <thatryan> thats quite a list of stuff
# [01:07] * Quits: Neiluj (~Julien@195.200.175.214) (Ping timeout: 264 seconds)
# [01:07] <thatryan> bot-t: did you know you have your own website?
# [01:07] <bot-t> thatryan, Ask again later.
# [01:07] <thatryan> no
# [01:08] <antonkovalyov> ?heartz
# [01:08] <bot-t> ♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥♥
# [01:08] <antonkovalyov> k, back to work :)
# [01:09] * Quits: jochen__ (~jochen@nat/google/x-xsplocszwbitlgdv) (Ping timeout: 250 seconds)
# [01:09] * jochen___ is now known as jochen__
# [01:10] * Joins: fry15 (~Adium@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
# [01:11] * Joins: paul_irish (~paul_iris@nat/google/x-etpqfycjenjcxffw)
# [01:11] <thatryan> antonkovalyov: here's your chance
# [01:12] <antonkovalyov> hey paul_irish, look what bott has to say
# [01:12] <paul_irish> .
# [01:12] <bot-t> (41 mins 40 secs ago) <nimbupani> tell paul_irish fixed
# [01:12] <bot-t> (40 mins 10 secs ago) <antonkovalyov> tell paul_irish your HTML5 Boilerplate talk is on the same day as Day of JS conf
# [01:12] <antonkovalyov> ?should you be open source
# [01:12] <alcuadrado> have you checked the game on 2010 entries?
# [01:12] <bot-t> yes!
# [01:12] <alcuadrado> most of them suck :s
# [01:12] <paul_irish> yeah i heard about that
# [01:13] * Joins: Neiluj (~Julien@195.200.175.214)
# [01:13] <dgathright> bot-t: Do you prefer xhtml over html?
# [01:13] <bot-t> dgathright, Without a doubt.
# [01:13] <thatryan> lol
# [01:13] <dgathright> bot-t: Boooooo!
# [01:13] <bot-t> dgathright, Links of Interest | CSS-Tricks - http://css-tricks.com/links-of-interest-41/
# [01:14] <dgathright> bot-t: that doesn't have anything to do with our conversation.
# [01:14] <bot-t> thank a lot yu deserve a great doesn't have anything to do with our conversation. doesn't have anything to do with our conversation.
# [01:14] * Parts: hubble (~hubble@dsl081-150-127.chi1.dsl.speakeasy.net)
# [01:14] <dgathright> bot-t: Are you drunk?
# [01:14] <bot-t> dgathright, It is certain.
# [01:14] <dgathright> bot-t: Figured
# [01:14] <bot-t> dgathright, #1193 (Interface scrollTo()/scrollToAnchors() in Firefox for MAC ... - Opened 4 years ago http://bugs.jquery.com/ticket/1193
# [01:14] * Quits: ben_c (~Adium@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com) (Quit: Leaving.)
# [01:14] * Parts: fry15 (~Adium@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
# [01:15] * Quits: mahemoff (~mahemoff@87-194-3-205.bethere.co.uk) (Quit: mahemoff)
# [01:15] <antonkovalyov> paul_irish, i am thinking about skipping the last panel to get to you talk. but anyway the crowd is pretty much the same for both events. :(
# [01:15] <antonkovalyov> your*
# [01:16] <paul_irish> hmmm
# [01:16] <paul_irish> hmmmm
# [01:16] <antonkovalyov> hm?
# [01:17] <paul_irish> jesus i have as many people coming to my talk as are going to the conference
# [01:18] <antonkovalyov> you have more
# [01:18] <thatryan> where is pauls talk
# [01:18] <thatryan> fuck me how do i miss this stuff
# [01:19] <paul_irish> http://www.sfhtml5.org/calendar/15728914/?eventId=15728914&action=detail
# [01:19] <paul_irish> antonkovalyov: i asked the organizers to clarify when mine starts
# [01:19] <antonkovalyov> thatryan, concord.
# [01:19] <antonkovalyov> too far away
# [01:20] <thatryan> ha
# [01:20] <paul_irish> concord. lol
# [01:20] <thatryan> stupid concord
# [01:20] <thatryan> damn with traffic i could not get there by 630 crapp
# [01:21] <antonkovalyov> paul_irish, the panel ends at 6:15. assuming that not everyone is with cars, they need hour and a half buffer to get to the city
# [01:21] <antonkovalyov> your talk is at 6:30. even if they move it to 7:30, not enough time
# [01:22] <paul_irish> 1.5 hours? come onnnn
# [01:22] <antonkovalyov> and then it is too late :(
# [01:22] <thatryan> antonkovalyov: you going to go to the mt view conference then back up to sf?
# [01:22] <antonkovalyov> caltrain+bart?
# [01:22] * Joins: toinso (~toinso@86-46-119-191-dynamic.b-ras1.wtd.waterford.eircom.net)
# [01:22] <paul_irish> well
# [01:22] <paul_irish> true.
# [01:22] <antonkovalyov> thatryan, yeah.
# [01:22] <paul_irish> people should get cars
# [01:22] <antonkovalyov> fuck cars
# [01:22] <thatryan> i have a car!
# [01:22] <paul_irish> in fact.. i might get a googlecar to drive up
# [01:22] <paul_irish> and i can take you
# [01:22] <antonkovalyov> paul_irish, that would be awesome
# [01:22] <paul_irish> cool lets.
# [01:24] <thatryan> im gonna go ask boss if i can leave early thursday :)
# [01:24] <antonkovalyov> thatryan, where do you work?
# [01:24] <antonkovalyov> i am taking the whole day off :)
# [01:25] <thatryan> startup in concord :D
# [01:25] <antonkovalyov> they have startups oh wow
# [01:26] <antonkovalyov> the only startup i know from the east bay is the one by hans reiser. but then he killed his wife and went to prison. not exactly a success story.
# [01:29] <thatryan> lol we are doing well so far :D
# [01:30] <thatryan> w00t im going!
# [01:34] <antonkovalyov> unabomber was math prof at ucb
# [01:34] <antonkovalyov> reiser was a cs student at ucb
# [01:34] <antonkovalyov> shit i better say away from cs/math building here
# [01:35] <thatryan> paul_irish: I AM SO EXCITED OMG
# [01:35] <thatryan> :p
# [01:35] * Joins: noxxten (noxxten@adsl-93-90-217.owb.bellsouth.net)
# [01:44] * Joins: hubble (~hubble@216-80-69-33.c3-0.nwb-bsr1.chi-nwb.il.cable.rcn.com)
# [01:45] * Joins: Shwaiil (~Shwaiil@a89-154-56-220.cpe.netcabo.pt)
# [01:45] <Shwaiil> hi ppl
# [01:46] <Shwaiil> Q: I'm wondering about developing games for mobile phones. Everyone talks about java. So, i'm wondering if HTML5/JS is also available to do the same ? For non web games, mobile apps only ? Thanks
# [01:46] <Shwaiil> If there's a better or any other room that I could talk about this, I'll apreciate the sugestion
# [01:47] <paul_irish> ?g z-type
# [01:47] <bot-t> paul_irish, Z-Type - http://www.phoboslab.org/ztype/
# [01:48] <paul_irish> ^html5/js game
# [01:48] <Shwaiil> hum
# [01:48] <Shwaiil> ?
# [01:49] * Quits: addyosmani (~apple@host109-154-41-126.range109-154.btcentralplus.com) (Quit: addyosmani)
# [01:49] * Joins: ben_alman (~ben_alman@pool-74-104-156-115.bstnma.fios.verizon.net)
# [01:49] <thatryan> addicting game
# [01:50] <Thasmo> COOOOOL
# [01:50] <Thasmo> :>
# [01:50] <thatryan> so paul_irish is the talk a boilerplate walkthrough only
# [01:51] <paul_irish> i have no idea
# [01:51] <paul_irish> any requests?
# [01:51] <thatryan> lol you making it up as yuou go?
# [01:51] <thatryan> true rockstar heh
# [01:51] <paul_irish> true slacker
# [01:52] <thatryan> well played
# [01:52] <paul_irish> hmmm
# [01:52] <paul_irish> i need to say something inspiring to web developres
# [01:53] <thatryan> you tend to be though, so im sure it will come to ya
# [01:55] <trave> ztype rocks!
# [01:56] <thatryan> make some rad demos :)
# [01:59] * Quits: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
# [02:02] * moneal is now known as moneal|a
# [02:11] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Remote host closed the connection)
# [02:11] * Joins: dguttman (~dguttman@gige.bur.digisynd.com)
# [02:12] * Quits: jamesarosen (~jamesaros@204.28.122.178) (Remote host closed the connection)
# [02:14] <Neiluj> impactjs rocks !
# [02:15] <Neiluj> except it's not free but not expensive for what it is
# [02:18] <dgathright> bot-t: Should I fly up to SF for HP's webOS developer event in February?
# [02:18] <bot-t> dgathright, Ask again later.
# [02:18] <dgathright> grrrr
# [02:18] <dgathright> bot-t: Is it "later" yet?
# [02:18] <bot-t> dgathright, Concentrate and ask again.
# [02:19] <dgathright> bot-t: Is.... it..... "later" .... yet?
# [02:19] <bot-t> dgathright, Yes.
# [02:19] * Joins: buzzomatic_ (~buzzomati@203.144.8.51)
# [02:19] <dgathright> bot-t: Should I fly up to SF for HP's webOS developer event in February?
# [02:19] <bot-t> dgathright, Signs point to yes.
# [02:19] <Neiluj> :)
# [02:19] <dgathright> well that settles it
# [02:19] <Neiluj> bot-t: will I finish the project I'm working on tonight ?
# [02:20] <bot-t> Neiluj, It is certain.
# [02:20] * buzzomatic_ is now known as buzzomatic
# [02:20] <Neiluj> ouf !
# [02:20] <dgathright> A Magic 8 Ball is far less frustrating to deal with than bot-t
# [02:20] <bot-t> dgathright, Stored "A Magic 8 Ball".
# [02:20] <Neiluj> ahaha :)
# [02:20] <dgathright> point proven
# [02:20] * Quits: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk) (Ping timeout: 240 seconds)
# [02:21] * Parts: buzzomatic (~buzzomati@203.144.8.51)
# [02:21] * Quits: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com) (Remote host closed the connection)
# [02:26] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Quit: Leaving...)
# [02:26] * Quits: boaz (~boaz@64.119.153.2) (Quit: boaz)
# [02:27] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
# [02:27] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Remote host closed the connection)
# [02:32] * Joins: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net)
# [02:34] * Joins: grantg__ (d8bdab51@gateway/web/freenode/ip.216.189.171.81)
# [02:40] * Joins: jgv (~jgv@184.152.75.83)
# [02:40] * Quits: grantg__ (d8bdab51@gateway/web/freenode/ip.216.189.171.81) (Quit: Page closed)
# [02:42] * Quits: Shwaiil (~Shwaiil@a89-154-56-220.cpe.netcabo.pt) (Ping timeout: 240 seconds)
# [02:43] * Joins: thatryan (~thatryan@c-71-202-1-91.hsd1.ca.comcast.net)
# [02:43] * Quits: jgv (~jgv@184.152.75.83) (Remote host closed the connection)
# [02:45] * Joins: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
# [02:47] * Joins: jgv (~jgv@184.152.75.83)
# [02:49] * Quits: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 255 seconds)
# [02:50] * Quits: techrush (~techrush@rrcs-173-198-32-131.west.biz.rr.com) (Ping timeout: 240 seconds)
# [02:52] * Joins: murz (~mmurraywa@wcproxy.msnbc.com)
# [02:53] * Joins: bentruyman (~bentruyma@c-67-163-43-249.hsd1.il.comcast.net)
# [02:53] * Joins: themiddleman (~rob@c-76-27-43-76.hsd1.ut.comcast.net)
# [02:54] * Parts: skyler_brungardt (~skyler_br@64.191.211.43)
# [02:58] * Joins: skyler_brungardt (~skyler@64.191.211.43)
# [03:03] * Quits: skyler_brungardt (~skyler@64.191.211.43) (Client Quit)
# [03:05] * Joins: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net)
# [03:18] * Quits: jgv (~jgv@184.152.75.83) (Remote host closed the connection)
# [03:18] * Joins: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com)
# [03:21] * Quits: bckenny (~bckenny@nat/google/x-cmbrkybesvczhlmj) (Remote host closed the connection)
# [03:25] * Quits: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com) (Ping timeout: 240 seconds)
# [03:28] * Joins: tw2113 (~tw2113@fedora/tw2113)
# [03:28] <tw2113> cgcardona http://blog.nihilogic.dk/2009/02/html5-canvas-cheat-sheet.html?kozmic
# [03:28] <cgcardona> nice one
# [03:28] <tw2113> play mario
# [03:29] <tw2113> use your keyboard cursor
# [03:29] <cgcardona> did you see this?
# [03:29] <cgcardona> http://dt.deviantart.com/blog/37599369/
# [03:29] <paul_irish> o.o
# [03:29] <tw2113> yeah, i didn't read through it though...i haven't done much with canvas and don't care for IE
# [03:29] <tw2113> :D
# [03:29] <cgcardona> oh that is awesome tw2113 !
# [03:36] * Quits: murz (~mmurraywa@wcproxy.msnbc.com) (Remote host closed the connection)
# [03:43] * Quits: tw2113 (~tw2113@fedora/tw2113) (Quit: Nice Scotty, now beam my clothes up too!)
# [03:45] * Joins: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com)
# [03:47] * Quits: paul_irish (~paul_iris@nat/google/x-etpqfycjenjcxffw) (Remote host closed the connection)
# [03:47] * Joins: paul_irish (~paul_iris@nat/google/x-wzlfpivgjttkabat)
# [03:52] * Quits: romainhuet (~romainhue@pro75-6-88-185-123-205.fbx.proxad.net) (Quit: romainhuet)
# [03:54] * Quits: paul_irish (~paul_iris@nat/google/x-wzlfpivgjttkabat) (Remote host closed the connection)
# [03:54] * Joins: shi (97c1dc1d@gateway/web/freenode/ip.151.193.220.29)
# [03:54] * Joins: paul_irish (~paul_iris@nat/google/x-locrfffegdogcarj)
# [03:56] * Quits: trave (43a1f086@gateway/web/freenode/ip.67.161.240.134) (Ping timeout: 265 seconds)
# [03:56] * Quits: shi (97c1dc1d@gateway/web/freenode/ip.151.193.220.29) (Client Quit)
# [04:16] * Quits: paul_irish (~paul_iris@nat/google/x-locrfffegdogcarj) (Remote host closed the connection)
# [04:22] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Quit: zzzzz)
# [04:30] * Quits: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net) (Quit: Linkinus - http://linkinus.com)
# [04:41] * Quits: jus101 (~chatzilla@203-97-83-44.sli-systems.com) (Ping timeout: 260 seconds)
# [04:46] * Quits: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar) (Read error: Connection reset by peer)
# [05:09] * Joins: paul_irish (~paul_iris@nat/google/x-nzlcggbfrsknzevk)
# [05:16] * Joins: dytrivedi (20017@ninthfloor.org)
# [05:20] * Joins: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com)
# [05:24] * Quits: hubble (~hubble@216-80-69-33.c3-0.nwb-bsr1.chi-nwb.il.cable.rcn.com) (Quit: hubble)
# [05:28] <thatryan> hey paul_irish
# [05:28] <thatryan> you around?
# [05:29] <paul_irish> wat
# [05:29] <thatryan> was curious about something with chrome dev tools
# [05:30] <paul_irish> RUMORS of IE9 RC landing on jan 28th
# [05:30] <thatryan> when editing styles, is there any settings to change so if you hit tab it will jump to net field, not erase everything?
# [05:30] <paul_irish> thatryan: use chrome dev channel
# [05:31] <paul_irish> GEEZ. i swear you've heard me say that like 4324235 times
# [05:31] <thatryan> nope not me!
# [05:31] <Neiluj> :)
# [05:31] <Neiluj> are you not on chrome's dev "relations" ? :p :p
# [05:31] <thatryan> LOL
# [05:32] <paul_irish> ?g chrome dev channel
# [05:32] <bot-t> paul_irish, developer channel - The Chromium Projects - http://www.chromium.org/getting-involved/dev-channel
# [05:32] <paul_irish> MAKE IT HAPPEN NAO
# [05:32] <Neiluj> ;)
# [05:33] * Quits: dgathright (~dgathrigh@nat/yahoo/x-uckzvzkbiywnnasr) (Ping timeout: 255 seconds)
# [05:33] * Joins: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net)
# [05:34] <thatryan> HA OK downloading
# [05:35] <Neiluj> btw, talking about chrome, something I really like is when you're viewing source of a page, refreshing works... safari is pissing me off with this
# [05:37] <Neiluj> I don't understand how Apple still didn't highlight source code in 2011...
# [05:37] * Quits: Facefoxdotcom (~machine4@pool-74-111-197-200.lsanca.fios.verizon.net) (Quit: www.FaceFox.com)
# [05:38] <thatryan> whoa weird
# [05:40] <thatryan> renders stuff different fix it! :p
# [05:42] * Quits: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net) (Quit: Linkinus - http://linkinus.com)
# [05:42] * Quits: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net) (Quit: masondesu)
# [05:54] * Joins: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
# [05:57] * Quits: paul_irish (~paul_iris@nat/google/x-nzlcggbfrsknzevk) (Remote host closed the connection)
# [05:58] * Joins: dguttman_ (~dguttman@gige.bur.digisynd.com)
# [06:02] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Ping timeout: 276 seconds)
# [06:03] * Joins: paul_irish (~paul_iris@67.218.106.189)
# [06:03] * Quits: dguttman_ (~dguttman@gige.bur.digisynd.com) (Ping timeout: 276 seconds)
# [06:16] * Joins: dmachi1 (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net)
# [06:16] * Quits: dmachi (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net) (Read error: Connection reset by peer)
# [06:28] * Joins: tw2113 (~tw2113@fedora/tw2113)
# [06:33] <antonkovalyov> i just got a new thing in chrome. on the preferences icon (where usually the yellow circle pops up when chrome needs to be updated) i had some kind of blue tilde icon. it did point to the background pages window but i saw absolutely nothing wrong there.
# [06:33] <antonkovalyov> i thought maybe something crashed, but all my tabs seem to be fine
# [06:33] <antonkovalyov> and i can't find anything about it on the web.
# [06:34] * Quits: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net) (Quit: boaz)
# [06:34] <thatryan> lol i installed dev version half my page disappeared :)
# [06:36] <antonkovalyov> thatryan, i use dev version all the time. seems to work just fine. there were times where i could not open devtools almost anywhere (the tab would just crash) and there was a bug when you could not scroll up (seriously). but other then that, it is more stable than other browsers' stable versions. :-)
# [06:36] <antonkovalyov> what page dissapeared?
# [06:37] <paul_irish> antonkovalyov: tbh i dont know whats up with that background pages icon
# [06:37] <paul_irish> bg pages are used by extensions
# [06:37] <antonkovalyov> paul_irish, but do you see it as well?
# [06:37] <paul_irish> but no idea why it needs to be exposed on the wrench
# [06:39] <antonkovalyov> hm, maybe some extension crashed.
# [06:39] <antonkovalyov> paul_irish, this new chrome://settings is sexy
# [06:40] * Quits: paul_irish (~paul_iris@67.218.106.189) (Remote host closed the connection)
# [06:41] * Joins: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com)
# [06:45] * Quits: antonkovalyov (~antonkova@adsl-75-18-218-45.dsl.pltn13.sbcglobal.net) (Quit: Linkinus - http://linkinus.com)
# [06:45] * Joins: Killman_ (~Killman@186.3.10.3)
# [06:45] * Killman is now known as Guest72832
# [06:46] * Quits: Killman_ (~Killman@186.3.10.3) (Client Quit)
# [06:46] * Joins: antonkovalyov (~antonkova@adsl-75-18-218-45.dsl.pltn13.sbcglobal.net)
# [06:46] * Joins: paul_irish (~paul_iris@c-76-21-40-62.hsd1.ca.comcast.net)
# [06:47] * Joins: Killman (~Killman@186.3.10.3)
# [06:47] * Quits: Killman (~Killman@186.3.10.3) (Changing host)
# [06:47] * Joins: Killman (~Killman@unaffiliated/killman)
# [06:50] * Quits: Guest72832 (~Killman@unaffiliated/killman) (Ping timeout: 276 seconds)
# [06:55] * Joins: jeffszusz (~jeffszusz@dyn216-8-170-154.ADSL.mnsi.net)
# [06:56] <paul_irish> thatryan: how *should* i do a boilerplate talk.
# [06:57] <thatryan> paul_irish: Good question, is this talk specifically for just that?
# [06:57] <paul_irish> yes
# [06:58] <paul_irish> intro to the idea. what it's goals are.. highlights of the markup and css..
# [06:58] <paul_irish> modernizr highlights.
# [06:58] <thatryan> remember, obviously you do lol, the video walkthrough you did for it?
# [06:58] <paul_irish> apache highlights.
# [06:58] <paul_irish> build script concept.
# [06:58] <paul_irish> :/
# [06:59] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
# [06:59] <thatryan> that video was awesome, very fun and informative
# [06:59] <paul_irish> ill try to be drunk for the talk then
# [06:59] <paul_irish> jk jk jk
# [06:59] * Quits: mikew3c (~MikeSmith@EM111-188-13-191.pool.e-mobile.ne.jp) (Ping timeout: 246 seconds)
# [06:59] <thatryan> LOL that was gret
# [06:59] <thatryan> ;)
# [07:00] <thatryan> the more in depth parts of the boilerplate, like you mention, build scripts etc, would be helpful to hear more about
# [07:00] <thatryan> those pieces i dont really follow
# [07:02] * Joins: shwetank (~emailshwe@122.173.85.222)
# [07:02] * tw2113 sucks as a mockup designer
# [07:03] <thatryan> gonna use it to build into html5 info? cutting edge crap we should be using? :)
# [07:05] * Joins: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp)
# [07:05] * Quits: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp) (Client Quit)
# [07:05] * Joins: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp)
# [07:10] <paul_irish> YEAH CUTTING EDGE SHIT
# [07:12] <paul_irish> probably some polyfill like crazy type shit
# [07:12] <tw2113> with ARIA stuff, do you guys limit what you put in? or just put in whatever assistive standards will eventually be so you're ready when the technology finally gets updated?
# [07:12] <thatryan> oh cool
# [07:12] <thatryan> polyfill stuff would be rd
# [07:14] <paul_irish> tw2113: i put in anything that NVDA will be responsive to.
# [07:15] <paul_irish> let the other ones catch up
# [07:15] <paul_irish> NVDA is the target, for all intents and purposes.
# [07:16] <tw2113> i was putting role tags on a client site earlier
# [07:31] <antonkovalyov> hey guys, need your help. give me some definition of polyfill so i could translate it to russian, please. :-)
# [07:32] <mikew3c> I didn't know what it even meant until paul_irish filled me in on it a couple months back
# [07:32] <mikew3c> poly-filled me in
# [07:32] <mikew3c> har har
# [07:32] <paul_irish> hahaa
# [07:32] <paul_irish> antonkovalyov: so polyfill is like a shim..
# [07:32] <paul_irish> json2.js is a good example of a polyfill
# [07:33] <paul_irish> it has the exact same API of native JSON... and only adds itself to the page if native support is not present.
# [07:33] <paul_irish> all polyfills are code that is expected to expire. as soon as the browsers are upgraded.
# [07:33] <antonkovalyov> is the term degradative?
# [07:33] <paul_irish> i suppose? :/
# [07:34] <antonkovalyov> we have a term for that in russian (the exact translation would be crutches) but it is a bit degradative so i don't know if i should use it
# [07:34] <antonkovalyov> hm
# [07:35] <thatryan> antonkovalyov: dont worry we gonna get our learn on in two weeks :D
# [07:36] <antonkovalyov> thatryan, i am translating boilerplate site to russian, gonna learn this shit earlier.
# [07:36] <thatryan> rad
# [07:37] * Quits: jeffszusz (~jeffszusz@dyn216-8-170-154.ADSL.mnsi.net) (Remote host closed the connection)
# [07:39] <paul_irish> i think a crutches type idea is pretty accurate
# [07:40] * Quits: tw2113 (~tw2113@fedora/tw2113) (Quit: Never look down on someone unless you're helping them up.)
# [07:44] <antonkovalyov> ?tell tw2113 that he has the wisest quit message i've ever seen. and the most serious. :-P
# [07:44] <bot-t> antonkovalyov, Okay.
# [07:45] <antonkovalyov> paul_irish, ok, crutches it is then.
# [07:58] * Quits: peol (~andree@unaffiliated/peol) (Quit: peol)
# [08:01] * Joins: HT (~ht@ip3e83ff64.speed.planet.nl)
# [08:04] <thatryan> paul_irish: how did you get to know everything?
# [08:08] * Quits: Bass10 (Bass10@c-76-113-194-7.hsd1.mn.comcast.net) (Ping timeout: 240 seconds)
# [08:09] * Quits: patcito (~123@190.42.79.230) (Read error: Connection reset by peer)
# [08:10] * Quits: mr_daniel (~irssi@g224121030.adsl.alicedsl.de) (Read error: Connection reset by peer)
# [08:14] <antonkovalyov> paul_irish, http://dl.dropbox.com/u/447925/Screenshots/ts1tdw~bbm8f.png shouldn't it be "with background" instead of "with a border"?
# [08:15] * Joins: mr_daniel (~irssi@g224123107.adsl.alicedsl.de)
# [08:33] * Joins: Howell` (~Howell`@116.226.88.12)
# [08:33] * Quits: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net) (Remote host closed the connection)
# [08:34] * Joins: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net)
# [08:34] * Joins: buzzomatic (~buzzomati@203.144.8.51)
# [08:40] * Joins: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com)
# [08:41] * Joins: Titosemi (~titosemi@f053227002.adsl.alicedsl.de)
# [08:41] * Joins: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk)
# [08:43] * Quits: thatryan (~thatryan@c-71-202-1-91.hsd1.ca.comcast.net) (Quit: Leaving...)
# [08:46] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
# [08:47] <paul_irish> hehehe yes i believe you're right
# [08:47] * Joins: sumeet_ (~sumeet@c-67-180-23-104.hsd1.ca.comcast.net)
# [08:47] <paul_irish> good call antonkovalyov
# [08:47] * sumeet_ is now known as shipit
# [08:47] <paul_irish> can you tweak that in /src/index.html ?
# [08:49] <antonkovalyov> paul_irish, yeah. i wonder if i can do pull requests on specific commits only
# [08:49] <paul_irish> not really
# [08:49] <antonkovalyov> don't want to mix that and translations stuff
# [08:49] <paul_irish> unless you do those commits in a branch
# [08:49] <antonkovalyov> shit
# [08:50] <paul_irish> if its in a branch then its easy
# [08:50] <antonkovalyov> kk
# [08:51] * Quits: LongBeach (~mike@AFontenayssB-152-1-50-215.w82-121.abo.wanadoo.fr)
# [08:57] * Joins: chipotle_ (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com)
# [08:57] * Quits: dytrivedi (20017@ninthfloor.org) (Remote host closed the connection)
# [08:57] * Quits: chipotle (~chipotle@209-6-67-222.c3-0.abr-ubr1.sbo-abr.ma.cable.rcn.com) (Read error: Connection reset by peer)
# [08:58] * Joins: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
# [09:01] * Joins: peol (~andree@91.213.250.6)
# [09:01] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [09:01] * Joins: peol (~andree@unaffiliated/peol)
# [09:03] <antonkovalyov> paul_irish, done
# [09:03] <paul_irish> shit damn
# [09:03] <antonkovalyov> hm?
# [09:04] <paul_irish> thanks :)
# [09:04] <antonkovalyov> hah. is "shit damn" like double-negative is positive?
# [09:05] * Joins: jetienne (~jerome@ivr94-6-82-230-255-246.fbx.proxad.net)
# [09:08] * Joins: shichuan (97c1dc1b@gateway/web/freenode/ip.151.193.220.27)
# [09:12] * Quits: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk) (Ping timeout: 240 seconds)
# [09:14] * Quits: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 240 seconds)
# [09:16] * Quits: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com) (Quit: dguttman)
# [09:17] * Joins: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com)
# [09:18] * Joins: dgathright_ (~dgathrigh@pool-108-23-17-58.lsanca.fios.verizon.net)
# [09:18] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Ping timeout: 260 seconds)
# [09:18] * dgathright_ is now known as dgathright
# [09:19] * Joins: dgathright_ (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
# [09:21] <paul_irish> yes.
# [09:23] * Quits: dgathright (~dgathrigh@pool-108-23-17-58.lsanca.fios.verizon.net) (Ping timeout: 260 seconds)
# [09:23] * dgathright_ is now known as dgathright
# [09:24] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Ping timeout: 255 seconds)
# [09:25] * Joins: tob1 (~tob1@xlate.10t.org)
# [09:26] * Joins: jeremyselier (~Jeremy@seg75-1-81-57-242-198.fbx.proxad.net)
# [09:27] * Joins: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
# [09:27] * Quits: tob1 (~tob1@xlate.10t.org) (Client Quit)
# [09:33] * Joins: matjas (~matjas@91.182.67.153)
# [09:35] * Joins: ACTRAiSER (~ACTRAiSER@217.110.228.68)
# [09:35] <ACTRAiSER> morning
# [09:43] * Quits: Howell` (~Howell`@116.226.88.12) (Ping timeout: 240 seconds)
# [09:43] * Quits: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net) (Remote host closed the connection)
# [09:44] * Joins: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za)
# [09:44] * Joins: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net)
# [09:45] * Quits: shwetank (~emailshwe@122.173.85.222) (Quit: shwetank)
# [09:55] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [10:02] * Joins: peol (~andree@91.213.250.6)
# [10:02] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [10:02] * Joins: peol (~andree@unaffiliated/peol)
# [10:03] * Quits: jeremyselier (~Jeremy@seg75-1-81-57-242-198.fbx.proxad.net) (Ping timeout: 240 seconds)
# [10:19] * Joins: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it)
# [10:22] * Quits: HAITI (~j@unaffiliated/haiti) (Ping timeout: 246 seconds)
# [10:25] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [10:29] * Joins: peol (~andree@unaffiliated/peol)
# [10:32] * Joins: codetonowhere (~Adium@2001:67c:90:770:222:41ff:fe2a:3d9e)
# [10:35] * Joins: mahemoff (~mahemoff@nat/google/x-apemazowpaksyorj)
# [10:35] * Parts: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
# [10:35] * Quits: codetonowhere (~Adium@2001:67c:90:770:222:41ff:fe2a:3d9e) (Client Quit)
# [10:37] <antonkovalyov> holy shit
# [10:37] <antonkovalyov> i think i finished translating
# [10:37] * Joins: romainhuet (~romainhue@pro75-6-88-185-123-205.fbx.proxad.net)
# [10:38] <antonkovalyov> paul_irish, gonna show it to a friend of mine and then will make a pull request
# [10:38] * Quits: mahemoff (~mahemoff@nat/google/x-apemazowpaksyorj) (Remote host closed the connection)
# [10:38] * Joins: mahemoff (~mahemoff@nat/google/x-hooreckohgitsjyb)
# [10:40] * Quits: anttio (~anttio@huittinen.of.frantic.com) (Quit: anttio)
# [10:43] * Quits: buzzomatic (~buzzomati@203.144.8.51) (Quit: buzzomatic)
# [10:54] * Quits: krijnh (~krijnhoet@83.160.77.30) (Ping timeout: 260 seconds)
# [10:55] * Attempting to rejoin channel #html5
# [10:55] * Rejoined channel #html5
# [10:55] * Topic is 'Welcome, amigos :: Ask any question about html5 & Friends. || Author Spec: http://dev.w3.org/html5/spec-author-view/ || Full spec: http://whatwg.org/html5 || Also: http://html5rocks.com http://diveintohtml5.org http://mzl.la/9giLwR http://html5homi.es'
# [10:55] * Set by marienz!~marienz@freenode/staff/marienz on Fri Nov 05 18:43:30
# [10:55] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [10:59] * Quits: shichuan (97c1dc1b@gateway/web/freenode/ip.151.193.220.27) (Quit: Page closed)
# [11:07] * Joins: anttio (~anttio@huittinen.of.frantic.com)
# [11:12] * Quits: antonkovalyov (~antonkova@adsl-75-18-218-45.dsl.pltn13.sbcglobal.net) (Quit: Leaving...)
# [11:14] * Quits: toinso (~toinso@86-46-119-191-dynamic.b-ras1.wtd.waterford.eircom.net) (Quit: Leaving)
# [11:19] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
# [11:25] * Joins: peol (~andree@91.213.250.6)
# [11:25] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [11:25] * Joins: peol (~andree@unaffiliated/peol)
# [11:26] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [11:27] * Quits: Killman (~Killman@unaffiliated/killman) (Quit: bbl ZZZZ)
# [11:36] * Quits: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za) (Quit: Computer has gone to sleep.)
# [11:42] * Joins: rakeshpai (~rakeshpai@59.162.86.164)
# [11:43] * Joins: peol (~andree@91.213.250.6)
# [11:43] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [11:43] * Joins: peol (~andree@unaffiliated/peol)
# [11:43] * Joins: buzzomatic (~buzzomati@203.144.8.51)
# [11:45] * Quits: peol (~andree@unaffiliated/peol) (Client Quit)
# [11:45] * Joins: Titosemi1 (~titosemi@g229019143.adsl.alicedsl.de)
# [11:46] * Joins: kor (~kor@a83-161-211-173.adsl.xs4all.nl)
# [11:47] * Quits: Titosemi (~titosemi@f053227002.adsl.alicedsl.de) (Ping timeout: 240 seconds)
# [11:50] * Quits: shipit (~sumeet@c-67-180-23-104.hsd1.ca.comcast.net) (Remote host closed the connection)
# [12:01] * Quits: mahemoff (~mahemoff@nat/google/x-hooreckohgitsjyb) (Quit: mahemoff)
# [12:02] * Joins: codetonowhere1 (~Adium@brick-lane.lbi.co.uk)
# [12:03] * Quits: codetonowhere (~Adium@2001:67c:90:760:222:41ff:fe2a:3d9e) (Ping timeout: 240 seconds)
# [12:03] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
# [12:07] * Joins: mahemoff (~mahemoff@74.125.57.60)
# [12:11] * Joins: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
# [12:15] * Quits: Lynn (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 260 seconds)
# [12:16] * Joins: Ms2ger (~Ms2ger@91.181.163.121)
# [12:16] * Joins: ben_c (~ben_c@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
# [12:20] * Joins: peol (~andree@91.213.250.6)
# [12:20] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [12:20] * Joins: peol (~andree@unaffiliated/peol)
# [12:21] * Joins: gsnedders (~gsnedders@204.232.194.186)
# [12:33] * Joins: dcadenas (~dcadenas@r186-48-201-251.dialup.adsl.anteldata.net.uy)
# [12:34] * Joins: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za)
# [12:40] * Quits: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com) (Remote host closed the connection)
# [12:44] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
# [12:51] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [12:51] * Joins: peol (~andree@unaffiliated/peol)
# [12:52] * Joins: svenlito (~svenlito@193.111.227.10)
# [12:52] * Quits: romainhuet (~romainhue@pro75-6-88-185-123-205.fbx.proxad.net) (Quit: romainhuet)
# [12:57] * Joins: mikew3c_ (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp)
# [12:59] * Quits: mikew3c (~MikeSmith@EM114-48-202-232.pool.e-mobile.ne.jp) (Ping timeout: 240 seconds)
# [12:59] * mikew3c_ is now known as mikew3c
# [13:04] * Quits: mahemoff (~mahemoff@74.125.57.60) (Quit: mahemoff)
# [13:10] * chipotle_ is now known as Boohemian
# [13:11] * Boohemian is now known as Boohemian_
# [13:11] * Boohemian_ is now known as chipotle
# [13:15] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
# [13:19] * Quits: burg (~burg@unaffiliated/burg) (Read error: Connection reset by peer)
# [13:21] * Joins: andree (~andree@91.213.250.6)
# [13:21] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [13:21] * Quits: andree (~andree@91.213.250.6) (Changing host)
# [13:21] * Joins: andree (~andree@unaffiliated/peol)
# [13:25] * chipotle is now known as umode
# [13:33] * Joins: romainhuet (~romainhue@pro75-4-82-238-200-10.fbx.proxad.net)
# [13:37] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Ping timeout: 265 seconds)
# [13:38] * Joins: mahemoff (~mahemoff@nat/google/x-xngimhxfxzpsahat)
# [13:39] * Joins: burg (~burg@c12.uaic.ro)
# [13:45] * Parts: ben_c (~ben_c@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
# [13:45] * Joins: ben_c (~ben_c@cpc3-brig17-2-0-cust939.3-3.cable.virginmedia.com)
# [13:45] * Quits: kor (~kor@a83-161-211-173.adsl.xs4all.nl) (Quit: kor)
# [13:47] * Joins: svenlito_ (~svnlto@188-223-81-77.dsl.cnl.uk.net)
# [13:49] * Joins: kor (~kor@a83-161-211-173.adsl.xs4all.nl)
# [13:51] * Quits: |Anthony| (~anthony@unaffiliated/anthony/x-4632056) (Quit: I quit cause IRC sux ;))
# [13:51] * Quits: andree (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [13:52] * Joins: peol (~andree@91.213.250.6)
# [13:52] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [13:52] * Joins: peol (~andree@unaffiliated/peol)
# [13:53] * Joins: |Anthony| (~anthony@unaffiliated/anthony/x-4632056)
# [13:53] * Quits: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it) (Ping timeout: 240 seconds)
# [13:56] * Joins: lukegalea (~lukegalea@tor.office.avidlifemedia.com)
# [13:57] * Joins: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it)
# [14:04] * Parts: gsnedders (~gsnedders@204.232.194.186)
# [14:05] * Joins: dgathright_ (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
# [14:07] * Quits: ben_alman (~ben_alman@pool-74-104-156-115.bstnma.fios.verizon.net) (Ping timeout: 276 seconds)
# [14:07] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Ping timeout: 276 seconds)
# [14:07] * dgathright_ is now known as dgathright
# [14:12] * Quits: svenlito_ (~svnlto@188-223-81-77.dsl.cnl.uk.net) (Ping timeout: 255 seconds)
# [14:19] * Joins: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net)
# [14:23] * Quits: mahemoff (~mahemoff@nat/google/x-xngimhxfxzpsahat) (Quit: mahemoff)
# [14:32] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [14:34] * Joins: peol (~andree@91.213.250.6)
# [14:34] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [14:34] * Joins: peol (~andree@unaffiliated/peol)
# [14:34] * Joins: mahemoff (~mahemoff@nat/google/x-mjmmdniysvojjjso)
# [14:51] * Quits: bentruyman (~bentruyma@c-67-163-43-249.hsd1.il.comcast.net) (Quit: bentruyman)
# [14:54] * Quits: mahemoff (~mahemoff@nat/google/x-mjmmdniysvojjjso) (Quit: mahemoff)
# [14:54] * Joins: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net)
# [14:58] * Joins: mahemoff (~mahemoff@nat/google/x-xmckvrsfyvhtsyhr)
# [15:02] * Quits: romainhuet (~romainhue@pro75-4-82-238-200-10.fbx.proxad.net) (Remote host closed the connection)
# [15:02] * Joins: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa)
# [15:03] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [15:04] * Joins: peol (~andree@unaffiliated/peol)
# [15:06] * Joins: agu10^ (~sbd@190.244.100.66)
# [15:06] <agu10^> hello
# [15:06] <agu10^> can I totally replace flash by using jQuery instead?
# [15:06] <agu10^> for creating web designs
# [15:06] <agu10^> flash-like
# [15:09] * Joins: Pewpewarrows (~Pewpewarr@75-145-93-41-WashingtonDC.hfc.comcastbusiness.net)
# [15:14] <ben_c> well it depends what you're wanting to do :)
# [15:18] * Quits: boaz (~boaz@c-24-128-79-120.hsd1.ma.comcast.net) (Quit: boaz)
# [15:19] * Quits: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com) (Remote host closed the connection)
# [15:30] * Joins: Michael (~disney@extwdig.dig.com)
# [15:30] * Quits: Michael (~disney@extwdig.dig.com) (Changing host)
# [15:30] * Joins: Michael (~disney@unaffiliated/jabberwock)
# [15:38] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Quit: dgathright)
# [15:47] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
# [15:50] * Joins: raslon (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
# [15:53] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [15:53] * Joins: peol (~andree@91.213.250.6)
# [15:53] * Quits: peol (~andree@91.213.250.6) (Changing host)
# [15:53] * Joins: peol (~andree@unaffiliated/peol)
# [15:53] * Quits: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 264 seconds)
# [15:53] * Quits: reQunix (~requnix@dsl-185-97-198.dynamic.wa.co.za) (Remote host closed the connection)
# [15:54] * Joins: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
# [15:54] * Quits: raslon (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 260 seconds)
# [15:58] * Quits: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 255 seconds)
# [16:00] * Joins: Bass10 (Bass10@c-76-113-194-7.hsd1.mn.comcast.net)
# [16:04] * Quits: themiddleman (~rob@c-76-27-43-76.hsd1.ut.comcast.net) (Ping timeout: 255 seconds)
# [16:05] * Joins: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106)
# [16:05] <davidmurdoch> Any orlandonians in the house?
# [16:05] <davidmurdoch> er, orlandoins?
# [16:06] <davidmurdoch> wait, is it orlandons?
# [16:07] <danielfilho> I'm a brazilian.
# [16:07] <danielfilho> Sorry :(
# [16:07] <danielfilho> :D
# [16:08] <tw2113> close enough danielfilho
# [16:08] <bot-t> (8 hours 23 mins ago) <antonkovalyov> tell tw2113 that he has the wisest quit message i've ever seen. and the most serious. :-P
# [16:08] <danielfilho> what is your quit msg, tw2113?
# [16:09] <davidmurdoch> anyone looking for work? I need design and wordpress site?
# [16:09] <danielfilho> I can indicate you a designer which makes some freelances.
# [16:09] <danielfilho> But he is in Brazil.
# [16:09] <tw2113> according to my preferences, "leaving"
# [16:09] <danielfilho> tw2113: original.
# [16:10] <danielfilho> not.
# [16:10] <tw2113> default setting
# [16:10] <tw2113> i'll have to have him tell me what he saw
# [16:10] <tw2113> unless he's thinking about last night when i was on my home computer
# [16:10] <tw2113> which has better ones
# [16:11] <davidmurdoch> I need someone who can do the design and HTML. I'm slammed.
# [16:11] <tw2113> as i was noting last night to myself and a couple other people...i suck at mockups
# [16:11] * Joins: Brodingo (472ae19a@gateway/web/freenode/ip.71.42.225.154)
# [16:12] * Joins: joemsak (~hubble@173-165-61-105-Illinois.hfc.comcastbusiness.net)
# [16:14] * Joins: mduncan (~mduncan@216.195.221.2)
# [16:15] * Quits: ACTRAiSER (~ACTRAiSER@217.110.228.68) (Quit: Zynga World Domination Tour 2011)
# [16:16] * Joins: bentruyman (~bentruyma@li159-104.members.linode.com)
# [16:34] * Joins: MattDiPasquale (~MattDiPas@rrcs-184-74-229-10.nyc.biz.rr.com)
# [16:35] * Quits: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106) (Ping timeout: 265 seconds)
# [16:35] * Quits: anttio (~anttio@huittinen.of.frantic.com) (Quit: anttio)
# [16:36] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [16:36] * Joins: peol (~andree@unaffiliated/peol)
# [16:37] * Quits: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa) (Quit: romainhuet)
# [16:37] * Joins: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa)
# [16:38] * Quits: bentruyman (~bentruyma@li159-104.members.linode.com) (Quit: bentruyman)
# [16:42] * Quits: romainhuet (~romainhue@2a01:e35:2eec:80a0:226:8ff:fedf:5bfa) (Ping timeout: 272 seconds)
# [16:43] <Michael> http://blogs.msdn.com/b/larryosterman/archive/2010/01/29/nextgenhacker101-owes-me-a-new-monitor.aspx
# [16:43] <Michael> waffle mayop
# [16:43] <Michael> mayo
# [16:43] <Michael> "10 people are using google"
# [16:43] <Michael> "tracer t"
# [16:43] <Michael> that's uproarious
# [16:43] * Joins: Killman (~Killman@unaffiliated/killman)
# [16:43] <Michael> paul_irish, if you have seen that you'll get a good laugh
# [16:51] * Joins: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net)
# [16:55] * Joins: bentruyman (~bentruyma@li159-104.members.linode.com)
# [17:00] * Quits: buzzomatic (~buzzomati@203.144.8.51) (Quit: buzzomatic)
# [17:02] * Joins: HAITI (~j@unaffiliated/haiti)
# [17:06] * Quits: peol (~andree@unaffiliated/peol) (Read error: Connection reset by peer)
# [17:06] * Joins: peol (~andree@unaffiliated/peol)
# [17:06] * Quits: russinkungen (~russinkun@h51bafc8f.selutra.dyn.perspektivbredband.net) (Ping timeout: 240 seconds)
# [17:07] * Joins: masondesu_ (~Mason@209.149.99.2)
# [17:09] * Quits: Ms2ger (~Ms2ger@91.181.163.121) (Read error: Connection reset by peer)
# [17:12] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
# [17:12] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Client Quit)
# [17:12] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
# [17:12] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Client Quit)
# [17:12] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
# [17:17] * Joins: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106)
# [17:20] * Joins: jamund (~jamund@24-104-129.146.hfc.mediarain.com)
# [17:22] * Quits: mikew3c (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp) (Quit: mikew3c)
# [17:22] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
# [17:23] * Quits: Michael (~disney@unaffiliated/jabberwock) (Read error: Connection reset by peer)
# [17:23] * Joins: Jabberwock (~disney@extwdig.dig.com)
# [17:23] * Jabberwock is now known as Guest52967
# [17:26] * Joins: Ms2ger (~Ms2ger@91.181.253.59)
# [17:26] * Joins: boaz (~boaz@64.119.153.2)
# [17:27] * Joins: felcom (~felcom@rrcs-71-43-19-2.se.biz.rr.com)
# [17:28] * Quits: Guest52967 (~disney@extwdig.dig.com) (Ping timeout: 264 seconds)
# [17:28] * Joins: figital (~figital@64.119.153.2)
# [17:32] * Quits: peol (~andree@unaffiliated/peol) (Quit: peol)
# [17:33] * Quits: joemsak (~hubble@173-165-61-105-Illinois.hfc.comcastbusiness.net) (Ping timeout: 255 seconds)
# [17:33] * Joins: hubble (~hubble@dsl081-150-127.chi1.dsl.speakeasy.net)
# [17:35] * Joins: mikew3c (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp)
# [17:39] * Joins: exp (~zAyghip8@cpc2-ely02-0-0-cust338.5-1.cable.virginmedia.com)
# [17:39] * Joins: addyosmani (~apple@host109-154-41-126.range109-154.btcentralplus.com)
# [17:40] * Quits: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com) (Read error: Connection timed out)
# [17:41] * Joins: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com)
# [17:43] * Titosemi1 is now known as Titosemi
# [17:45] * Quits: mahemoff (~mahemoff@nat/google/x-xmckvrsfyvhtsyhr) (Quit: mahemoff)
# [17:47] * Joins: DjEther (~disney@eorcrp-gdm0a-as.bsc.disney.com)
# [17:50] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
# [17:51] * Quits: masondesu_ (~Mason@209.149.99.2) (Quit: masondesu_)
# [17:52] * Quits: DjEther (~disney@eorcrp-gdm0a-as.bsc.disney.com) (Ping timeout: 255 seconds)
# [17:55] * Joins: mahemoff (~mahemoff@nat/google/x-qxgoixdgrbeiewux)
# [17:55] * Joins: techrush (~techrush@rrcs-173-198-32-131.west.biz.rr.com)
# [17:56] * Quits: paul_irish (~paul_iris@c-76-21-40-62.hsd1.ca.comcast.net) (Remote host closed the connection)
# [18:00] * Quits: Brodingo (472ae19a@gateway/web/freenode/ip.71.42.225.154) (Ping timeout: 265 seconds)
# [18:02] * Joins: paul_irish (~paul_iris@67.218.107.122)
# [18:03] * Quits: mahemoff (~mahemoff@nat/google/x-qxgoixdgrbeiewux) (Quit: mahemoff)
# [18:05] <paul_irish> guys'
# [18:05] <paul_irish> going live.
# [18:05] <paul_irish> http://twitter.com/#!/w3fools <=====
# [18:05] <tbranyen> :O
# [18:06] * Joins: snover (~Adium@unaffiliated/snover)
# [18:07] * Joins: mahemoff (~mahemoff@74.125.57.60)
# [18:07] <paul_irish> http://twitter.com/#!/w3fools <===== PICK YR FAVE and RT
# [18:08] <alrra> yey :D
# [18:09] <mkwst> clever. nice. :)
# [18:09] * Joins: nimbupani (~Adium@c-24-22-131-46.hsd1.wa.comcast.net)
# [18:11] <ben_c> RT'd
# [18:12] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
# [18:13] <tw2113> any reason why some of the w3fools entries have strikethrough?
# [18:14] * Joins: shwetank (~emailshwe@122.173.85.222)
# [18:14] <felcom> http://w3schools.com/cert/default.asp LOL
# [18:15] <thatryan> PITY THE FOOL! lol yes
# [18:15] <felcom> i love that the prices for HTML === PHP
# [18:15] <tw2113> if you want a certificate, I'd be willing to design one for you in photoshop/gimp
# [18:15] * Quits: dmachi1 (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net) (Read error: Connection reset by peer)
# [18:16] <felcom> i can do that myself, but thanks! =D
# [18:16] <thatryan> pssh, tw2113 ill do it in mspaint what now
# [18:16] * Joins: dmachi (~dmachi@pool-71-254-70-192.ronkva.east.verizon.net)
# [18:16] <thatryan> shit, first i have to buy a pc
# [18:16] <felcom> i mean if you're gonna sell BS certs, at least make the prices somewhat realistic
# [18:16] * tw2113 has contribution on the page but lacks name in the contributors list
# [18:16] <tw2113> i'm prefectly fine with that :D
# [18:18] <tw2113> heh, .Net magazine just emailed me to let let me know that due to shite weather in the US, shipping of my first issue may be delayed
# [18:18] <thatryan> i wanna contribute! :D
# [18:18] <thatryan> me me
# [18:18] <felcom> paul_irish: you guys should make w3fools certs
# [18:18] * moneal|a is now known as moneal
# [18:18] <tw2113> given that i was under the impression it'd be a few more weeks, this is news to me
# [18:18] <paul_irish> felcom: put in the konami code.
# [18:18] <tw2113> i may get one sooner than expected
# [18:19] <felcom> paul_irish: LOL
# [18:19] <felcom> nice!
# [18:19] <paul_irish> :D
# [18:19] <paul_irish> that was all bentruyman's genius
# [18:19] <tw2113> i wonder how many people will scoff at w3fools saying that it's not a long enough list of complaints to ignore the site completely
# [18:19] <thatryan> konami awesome lol
# [18:19] <bentruyman> ur making me blush!
# [18:19] <bentruyman> :)
# [18:20] * Joins: croby (~croby@c-24-19-51-159.hsd1.wa.comcast.net)
# [18:21] * Joins: JKarsrud (~JKarsrud@178.74.12.26)
# [18:22] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
# [18:22] * Quits: JKarsrud (~JKarsrud@178.74.12.26) (Read error: Connection reset by peer)
# [18:22] * Joins: JKarsrud (~JKarsrud@178.74.12.26)
# [18:23] <thatryan> […] professional web developers often prefer HTML editors like FrontPage or Dreamweaver, instead of writing plain text.
# [18:23] <thatryan> lol wow it really says that?
# [18:24] <thatryan> guess i should buy dreamweaver! lol
# [18:25] <tw2113> who buys...pirate
# [18:25] <tw2113> YARR!
# [18:25] <thatryan> ARG!
# [18:26] * Joins: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com)
# [18:26] <tw2113> cgcardona, you came to join the w3fools.com launch party?
# [18:27] <cgcardona> i guess so
# [18:27] <thatryan> w00t
# [18:27] <tw2113> there is no guess....
# [18:27] <thatryan> or spoon
# [18:27] <cgcardona> sorry - yes, yes i did
# [18:27] * Quits: burg (~burg@c12.uaic.ro) (Ping timeout: 255 seconds)
# [18:28] <tw2113> much better
# [18:28] <cgcardona> hmmm - the page isn't valid? http://validator.w3.org/check?verbose=1&uri=http://w3fools.com/
# [18:29] <paul_irish> we're fixing most of those now
# [18:29] * Joins: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net)
# [18:29] * Quits: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net) (Changing host)
# [18:29] * Joins: peol (~andree@unaffiliated/peol)
# [18:29] <agu10^> hi
# [18:29] <agu10^> what do you think of CMSs ?
# [18:29] <thatryan> lots of stuff :)
# [18:30] <felcom> i think they make managing content easier
# [18:30] <felcom> *sometimes
# [18:31] <agu10^> cool
# [18:31] <agu10^> can you achieve great designs with them?
# [18:31] <thatryan> you can achieve great designs with anything
# [18:31] <felcom> i'd go so far as to say magnificent designs are even possible
# [18:32] <thatryan> if you try really hard, even supernatural ones
# [18:32] * Joins: Thasmo (~thasmo@d86-33-68-14.cust.tele2.at)
# [18:32] <agu10^> lol
# [18:32] <agu10^> isn't it hard to get nice designs with a CMS ?
# [18:33] <agu10^> I can't find really good templates... they're all mediocre
# [18:33] <thatryan> paul_irish: who wrote the response sections lol
# [18:33] <tw2113> just cause others suck at it, doesn't mean yours will
# [18:33] * Quits: svenlito (~svenlito@193.111.227.10) (Remote host closed the connection)
# [18:33] <felcom> the best thing to do is to learn to make your own templates
# [18:33] <tw2113> it all depends on their skills
# [18:33] <cgcardona> agu10^: don't look for templates - create your own
# [18:33] <cgcardona> then if it sucks it's your fault
# [18:33] <thatryan> lol
# [18:33] <agu10^> cgcardona, heheh
# [18:33] <agu10^> well, I wanted to find one
# [18:34] <agu10^> it's not possible that they all suck :(
# [18:34] <tw2113> so stop relying on other peoples suckitude
# [18:34] <cgcardona> what cms are you considering?
# [18:34] <felcom> chances are, if you care about your Website, no template will be an exact fit
# [18:34] <thatryan> ++
# [18:35] * Quits: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106) (Ping timeout: 265 seconds)
# [18:35] <paul_irish> thatryan: wha/
# [18:35] <thatryan> the repsones to each little section of w3schools fail, some of them are cracking me up :)
# [18:36] <Ms2ger> What's even more funny is how many of the actual corrections are wrong ;)
# [18:36] <thatryan> orly?
# [18:36] * Joins: LynnWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
# [18:37] <paul_irish> yup.
# [18:37] <paul_irish> crowdsourcing isnt great for accuracy :)
# [18:37] <tw2113> at least we have the power to fix them
# [18:37] <thatryan> lol
# [18:37] <tw2113> i doubt they'll fix their entries
# [18:38] <thatryan> paul_irish: consider throwing a tweet share button at the bottom maybe?
# [18:38] <paul_irish> we thought about it
# [18:39] <paul_irish> decided not to
# [18:39] <thatryan> oohh how about a little "badge" like deal we can sport next to our MDC ones?
# [18:40] <paul_irish> no
# [18:40] <thatryan> ok how about i shutup then? ;)
# [18:41] * Joins: ReyBango (~reybango@adsl-223-135-62.mia.bellsouth.net)
# [18:42] * Joins: davidmurdoch (434ef46a@gateway/web/freenode/ip.67.78.244.106)
# [18:42] <tw2113> just for now, thatryan, not forever
# [18:43] <thatryan> heh :)
# [18:43] * Quits: mahemoff (~mahemoff@74.125.57.60) (Quit: mahemoff)
# [18:44] * Joins: burg (~burg@c12.uaic.ro)
# [18:46] * Quits: paul_irish (~paul_iris@67.218.107.122) (Remote host closed the connection)
# [18:46] <davidmurdoch> Chrome locked up on w3fools.com for some reason. maybe it was a coincidence.
# [18:46] * Joins: mahemoff (~mahemoff@74.125.57.60)
# [18:48] <davidmurdoch> any designer/front-end devs looking for work in here?
# [18:48] <davidmurdoch> EST timezones please.
# [18:48] <davidmurdoch> timezone*
# [18:49] * Joins: paul_irish (~paul_iris@nat/google/x-gnwzwtqmydasmflz)
# [18:49] * Joins: patcito (~123@190.42.250.61)
# [18:52] <tw2113> yay! nearing 1000 lines in a css file!
# [18:52] <davidmurdoch> I just used w3school on accident. lol. I couldn't remember how to use optgroup for a second.
# [18:52] * Quits: dguttman (~dguttman@rrcs-24-43-25-203.west.biz.rr.com) (Quit: dguttman)
# [18:52] <thatryan> go sit in the corner and think about what you did...
# [18:52] <tw2113> paul linked me to a google search filter that removes any instances of the site from my results
# [18:52] <Pewpewarrows> davidmurdoch: https://developer.mozilla.org/en-US/search?q=%s
# [18:52] <Pewpewarrows> is my search keyword url
# [18:53] <Pewpewarrows> so I never had to visit w3schools again
# [18:53] <agu10^> can I replace flash with html5 for making flash-like webpages?
# [18:53] <agu10^> or jquery?
# [18:53] <davidmurdoch> agu10^ , it depends
# [18:53] <agu10^> on what
# [18:53] <felcom> the content
# [18:53] <agu10^> what do you mean?
# [18:54] <felcom> ...
# [18:54] <felcom> work with me here
# [18:54] <Pewpewarrows> agu10^: what kind of webpage
# [18:54] <agu10^> flash-like... lots of animations and graphics
# [18:54] <agu10^> bounciness, transparency, etc
# [18:54] <davidmurdoch> It depends on everything.
# [18:54] <agu10^> http://www.expansivestudios.com/indexflash.html
# [18:54] <Pewpewarrows> javascript has been able to do that for a while
# [18:54] <Pewpewarrows> now CSS can too (to a limited extent)
# [18:55] <agu10^> can you make transparent menus, etc?
# [18:55] <davidmurdoch> CSS can't to blur yet, which flash can.
# [18:55] <agu10^> oh I see... html+css+jQuery will be more limited, right?
# [18:55] <agu10^> :/
# [18:55] <Pewpewarrows> wow, that site brought back a slew of repressed, painful memories
# [18:55] <davidmurdoch> Is there an HTML5-for-Beginners tutorial that has been approved by paul_irish?
# [18:56] <paul_irish> ?g dive into html5
# [18:56] <bot-t> paul_irish, Dive Into HTML5 - http://diveintohtml5.org/
# [18:56] <davidmurdoch> AH!
# [18:56] <Pewpewarrows> splash page, pop-up that's automatically fullscreen even with a dual-monitor setup that spans both screens
# [18:56] <agu10^> yes, the site is not good
# [18:56] <agu10^> but that kind of things
# [18:56] <Pewpewarrows> now I need a therapist again for shitty flash sites, thx
# [18:56] <agu10^> lol
# [18:56] <agu10^> well I mean that kind of graphics
# [18:56] <agu10^> I know the site is wrong in many aspects
# [18:57] <davidmurdoch> yah, it CAN.
# [18:57] <tw2113> bad site! it took over my entire monitor
# [18:57] <felcom> agu10^: theres a lot of opportunity to come up with some great and attractive ideas using html5 & js
# [18:57] * Joins: davidwalsh (~davidwals@75-135-74-55.dhcp.mdsn.wi.charter.com)
# [18:57] * Joins: mikew3c_ (~MikeSmith@EM114-48-174-137.pool.e-mobile.ne.jp)
# [18:57] <felcom> just depends on your knowledge and creativity
# [18:57] <davidmurdoch> Oh noes, I just realized the potential for abuse of the new fullscreen HTML elements coming soon.
# [18:58] <agu10^> :|
# [18:58] <davidmurdoch> Qk
# [18:59] <felcom> fullscreen i can deal with, just dont take away my browser navigation, that makes me mad
# [19:00] <agu10^> xD
# [19:00] <agu10^> well, now can I do that?
# [19:00] * Quits: mikew3c (~MikeSmith@EM111-188-81-119.pool.e-mobile.ne.jp) (Ping timeout: 240 seconds)
# [19:00] * mikew3c_ is now known as mikew3c
# [19:01] <davidmurdoch> you can't do fullscreen HTML yet.
# [19:01] <davidmurdoch> well, not without good ol' F11
# [19:01] <Pewpewarrows> have we already discussed http://w3fools.com/ ?
# [19:01] <davidmurdoch> yah, paul came in and announced it.
# [19:01] <Pewpewarrows> because I just spent the last 30 seconds laughing from it
# [19:01] <Pewpewarrows> DAMMIT
# [19:02] <paul_irish> so slow
# [19:02] <davidmurdoch> Pewpewarrows: try konami code on it.
# [19:02] <Pewpewarrows> davidmurdoch: lol
# [19:03] <Pewpewarrows> I'm gonna print that out and frame it
# [19:04] <tw2113> need to get it listed on http://konamicodesites.com/
# [19:07] * Quits: dcadenas (~dcadenas@r186-48-201-251.dialup.adsl.anteldata.net.uy) (Ping timeout: 240 seconds)
# [19:08] * Joins: jacine (~jacine@drupal.org/user/88931/view)
# [19:08] * Quits: jeremyselier (~Jeremy@pro75-4-82-238-200-10.fbx.proxad.net) (Quit: jeremyselier)
# [19:11] * Joins: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com)
# [19:11] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
# [19:15] * Quits: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar) (Remote host closed the connection)
# [19:15] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
# [19:16] <Pewpewarrows> holy hell, if that WebM decode in flash gets finished, can we finally only have to encode videos once?
# [19:16] <Pewpewarrows> say it ain't so
# [19:18] <alcuadrado> unluckly not :(
# [19:18] <alcuadrado> iOs is the problem
# [19:18] * Joins: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
# [19:21] <Pewpewarrows> I don't think it'll be too long before apple follows suit with WebM
# [19:23] <ben_c> the thing it comes down to is the hardware decoders in the devices..
# [19:23] <alcuadrado> yeah, that's the problem
# [19:23] <alcuadrado> and hardware doesn't have remote updates
# [19:23] <alcuadrado> :(
# [19:24] <ben_c> bloody hardware
# [19:24] <agu10^> should I make my websites using html5 or still has to be adopted?
# [19:24] <Neiluj> paul_irish: is it planned to make Modernizr apply css classes based on input types support ?
# [19:24] <nimbupani> agu10^: pls use html5 doctype
# [19:24] <nimbupani> if nothing else
# [19:25] <nimbupani> make this world better 1 doctype at a time.
# [19:25] <agu10^> well should I still use html4 ?
# [19:25] <paul_irish> Neiluj: no
# [19:25] <agu10^> not every browser supports html5...
# [19:25] <Neiluj> paul_irish: is there any reason ?
# [19:25] <alcuadrado> agu10^: all html4 is html5 compatible. well, almost
# [19:25] <paul_irish> you're the first one to ask for it
# [19:25] <Ms2ger> agu10^, all browsers support <!doctype html>
# [19:25] * Joins: tw2113 (~tw2113asw@host-66-96-230-24.midco.net)
# [19:25] * Quits: tw2113 (~tw2113asw@host-66-96-230-24.midco.net) (Changing host)
# [19:25] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
# [19:25] <paul_irish> also it would balloon the size of that className bigtime
# [19:26] <agu10^> why do I need to use <!doctype> ??
# [19:26] <Neiluj> mmh that's what I thought
# [19:26] <paul_irish> it's the easiest way to get a consistent rendering across browsers, agu10^
# [19:26] <agu10^> I never do that
# [19:26] <paul_irish> that among other things.
# [19:26] <agu10^> oh, how?
# [19:26] <Ms2ger> By triggering standards mode
# [19:26] <agu10^> how does it make it 'consistent' ?
# [19:26] <paul_irish> something called standards-mode rendering
# [19:26] <agu10^> wow, so browsers are non-standard by default?
# [19:27] <nimbupani> ?g truth about doctypes
# [19:27] <bot-t> nimbupani, The Truth about Doctypes | Nimbupani Designs - http://nimbupani.com/the-truth-about-doctypes.html
# [19:27] <Ms2ger> See https://developer.mozilla.org/en/mozilla%27s_quirks_mode
# [19:27] <shwetank> <hipster> i use html4 doctype just to be ironic.</hipster>
# [19:27] <agu10^> :O
# [19:27] <nimbupani> :))
# [19:27] <Neiluj> maybe Modernizr.applyClassnames('inputtypes') ? :)
# [19:27] <Neiluj> or something :P
# [19:27] <Ms2ger> I use the HTML4 doctype because the W3C pubrules make me
# [19:27] <paul_irish> Neiluj: if you write the code.. i'd be happy to link it up in the wiki/docs
# [19:27] <paul_irish> i use <!doctype html public "✰"> to be a real jerk. :)
# [19:27] <Neiluj> sure, what would be the cleanest way ?
# [19:28] <paul_irish> Neiluj: i guess that's up to you.
# [19:28] <Neiluj> I mean "syntax"
# [19:28] <Ms2ger> paul_irish, jerk :)
# [19:28] <paul_irish> ;)
# [19:28] <paul_irish> it works!
# [19:28] <paul_irish> sadly not without `public` though
# [19:28] <tw2113> this week i plan to use the html6 doctype on all my own sites....<!>
# [19:29] * Quits: JKarsrud (~JKarsrud@178.74.12.26) (Quit: Leaving.)
# [19:29] <paul_irish> Neiluj: shrug. however you like.
# [19:30] <davidmurdoch> paul_irish, you ever look into setting the Http Header for Server to "✰"?
# [19:30] <tw2113> put it all on one line Neiluj
# [19:30] <paul_irish> you figured out how to do it in IIS. i couldnt find a way in apache.
# [19:30] <davidmurdoch> well thats lame.
# [19:31] <paul_irish> yes
# [19:31] <Neiluj> tw2113: what do you mean ?
# [19:32] <tw2113> <!DOCTPYE><html>......</body></html>
# [19:32] <tw2113> don't hit enter in your typing
# [19:32] <nimbupani> o dear :/
# [19:32] <nimbupani> neets eh paul_irish http://www.iowasportscamps.com/
# [19:33] <tw2113> don't worry nimbupani i'm just joking about the single line bit
# [19:33] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Quit: dgathright)
# [19:33] <paul_irish> kinda nice
# [19:33] <agu10^> <!doctype html>
# [19:33] <davidmurdoch> lowercase the doctype, please.
# [19:33] <agu10^> davidmurdoch, it is lowercase...
# [19:33] <davidmurdoch> not, you.
# [19:34] <davidmurdoch> i don't know where that comma came from.
# [19:34] <agu10^> <!dockpie http>
# [19:34] <tw2113> what's wrong with capital doctypes?
# [19:34] <nimbupani> WHY DO YOU LIKE CAPS
# [19:34] <agu10^> taht they are capital sins...
# [19:34] * Joins: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com)
# [19:34] <davidmurdoch> <INPUT TYPE='text' />
# [19:34] <agu10^> lol
# [19:34] <tw2113> i just do it for the doctype declaration, the rest are lowercase
# [19:34] <agu10^> i hate when they use caps... why is that??
# [19:34] <davidmurdoch> why?
# [19:34] <tw2113> i think it looks better
# [19:35] <agu10^> because I dont like caps
# [19:35] <davidmurdoch> agu10^: blame the 90s
# [19:35] <agu10^> tw2113, lol
# [19:35] <agu10^> fucking 90s, they're the root of all evil
# [19:35] <davidmurdoch> HTML compresses better if you use a lowercase HTML5 doctype.
# [19:35] <agu10^> why did they do that in the 90s ??
# [19:35] <tw2113> but they brought us grunge and tragic heroin overdoses!
# [19:35] <davidmurdoch> why do planes fly, man?
# [19:35] <davidmurdoch> and miley cyrus.
# [19:35] <agu10^> were they absolutely mad in the 90s or what? their source code is always messy, nonstandard, and awful!!!
# [19:35] <davidmurdoch> er, wait.
# [19:35] <davidmurdoch> nevermind.
# [19:36] <agu10^> wut
# [19:36] <tw2113> agu10^, that was before people started practicing standards
# [19:36] <agu10^> hahah
# [19:36] <agu10^> well, but still code was awful
# [19:36] <tw2113> this was not something that was in place from the getgo
# [19:36] <agu10^> not only nonstandard, also awful, functions were all obfuscated... the whole code was obfuscated...
# [19:36] <davidmurdoch> tw2113: I"m been using HTML5 since 1995
# [19:36] <davidmurdoch> i've*
# [19:36] <davidmurdoch> :-p
# [19:37] <agu10^> why do people still use code and conventions from the 90s? it's suicide
# [19:37] * Joins: dguttman (~dguttman@gige.bur.digisynd.com)
# [19:37] <tw2113> there are still sites that use tables for layout, in 2011
# [19:37] <davidmurdoch> my fav: http://www2.warnerbros.com/spacejam/movie/jam.htm
# [19:37] <tw2113> i call them potential clients
# [19:38] <agu10^> html5 is still too similar to html4... c'mon, you didn't come up with something at least a big better????
# [19:38] <agu10^> html is way old
# [19:38] <davidmurdoch> Badda Bing, Badda Boom
# [19:38] <Ms2ger> Like XHTML2?
# [19:38] <agu10^> davidmurdoch, just boom
# [19:38] <agu10^> Ms2ger, for example, yes!
# [19:38] <Ms2ger> How much of XHTML2 can you use in browsers today?
# [19:38] <davidmurdoch> whats the func to revere an array in php?
# [19:38] <agu10^> why are we doomed to use html5 instead of xhtml or something?
# [19:38] <agu10^> Ms2ger, idk
# [19:38] <Ms2ger> Nothing
# [19:38] * Quits: m_W (m_W@c-24-0-228-200.hsd1.nj.comcast.net) (Read error: Connection reset by peer)
# [19:39] <paul_irish> ^ ^
# [19:39] <Ms2ger> Do you know why?
# [19:39] <tw2113> because html5 has become the natural evolution of the web
# [19:39] <agu10^> Ms2ger, i dont
# [19:39] <agu10^> it's abandoned?
# [19:39] <tw2113> and they have decided not to push forward with xhtml2
# [19:39] <Ms2ger> Because they started over instead of remaining backwards compatible
# [19:39] <agu10^> tw2113, why is that?
# [19:39] <agu10^> I don't see why
# [19:39] <agu10^> browsers don't want to implement it?
# [19:39] <agu10^> is that what you mean?
# [19:40] <shwetank> you can still code in xhtml style using html5 and serve it as xml if you want
# [19:40] * Quits: Brodingo (~Brodingo@cpe-70-116-9-4.austin.res.rr.com) (Remote host closed the connection)
# [19:40] <Ms2ger> Browsers will not implement things if they break the web, indeed
# [19:40] <agu10^> hmm
# [19:40] <agu10^> Ms2ger, break the web?
# [19:40] <agu10^> use <!doctype xhtml>
# [19:41] <Ms2ger> Another mode? Quirks mode showed us how bad that turns out
# [19:41] <davidmurdoch> yah, like removing h.256 codec support.
# [19:41] <tw2113> http://www.webdirections.org/blog/xhtml2-is-dead-long-live-html5/
# [19:41] <agu10^> Ms2ger, ?
# [19:43] <agu10^> we have to reinvent the whole browser
# [19:43] <agu10^> this sucks
# [19:43] * tw2113 facepalms
# [19:43] <alcuadrado> wow, great news! microsoft seems to be changing its position towards video
# [19:43] <tw2113> link or it didn't happen alcuadrado
# [19:43] * agu10^ facepalms at tw2113
# [19:44] <alcuadrado> http://www.microsoft.com/downloads/en/details.aspx?FamilyID=905b4d10-9cde-4d32-b576-c942d1375ceb&displaylang=en
# [19:44] <shwetank> huh?
# [19:46] <Pewpewarrows> are there technical terms for the actual grippable bar in a scrollbar, as opposed to the container with the arrows and background?
# [19:46] <tw2113> here you go agu10^ http://css-tricks.com/html-5-vs-xhtml-2-an-article-roundup-and-poll/
# [19:46] <davidmurdoch> Why can't microsoft use URL rewriting to make that url readable?
# [19:46] <paul_irish> ?g styling webkit scrollbar @ Pewpewarrows
# [19:46] <bot-t> Pewpewarrows, Surfin' Safari - Blog Archive � Styling Scrollbars - http://webkit.org/blog/363/styling-scrollbars/
# [19:47] <tw2113> because they're too busy failing, davidmurdoch
# [19:47] <alcuadrado> they are fixing disney movies
# [19:47] <paul_irish> alcuadrado: awesome! the two things i paid money for will work like they're supposed to!
# [19:47] <Pewpewarrows> paul_irish: stop knowing everything
# [19:47] * Quits: dgathright (~dgathrigh@cpe-76-90-139-148.socal.res.rr.com) (Quit: dgathright)
# [19:47] <paul_irish> aiight
# [19:48] <davidmurdoch> ?fpi
# [19:48] <bot-t> fucking paul irish!
# [19:49] <Neiluj> paul_irish: about Modernizr coding conventions, as I will prefix the classes with "inputtypes" and as Modernizr classes are using dashes only with ".no-", is it correct to not add other dashes after it, like ".no-inputtypesrange" or ".no-inputtypes-range" ? :-/
# [19:49] * Joins: m_W (m_W@c-24-0-228-200.hsd1.nj.comcast.net)
# [19:50] <alcuadrado> nimbupani: great article on doctypes
# [19:51] <alcuadrado> btw: selected text is completly unreadable, at least in chrome on linux
# [19:51] <Neiluj> I realize that there's not similar case yet, every non-boolean (litteral objects) Modernizr properties are the same one that are not class-applied (video/audio format, input types&attrs)
# [19:51] <nimbupani> thanks alcuadrado ! yeah I gotta fix it :(
# [19:52] <mikesusz> has anyone had IE show wingdings instead of their @font-face embed? i made it live and it's not a test TLD or anything, it's still happening. :(
# [19:54] <davidmurdoch> no
# [19:54] * Quits: masondesu (~masondesu@c-76-107-156-58.hsd1.ms.comcast.net) (Quit: masondesu)
# [19:58] * Quits: nimbupani (~Adium@c-24-22-131-46.hsd1.wa.comcast.net) (Quit: Leaving.)
# [19:59] * Parts: shwetank (~emailshwe@122.173.85.222)
# [19:59] * Joins: svenlito (~svnlto@78-86-0-182.zone2.bethere.co.uk)
# [20:00] <Neiluj> anyone to answer me about this Modernizr name convention special case ?
# [20:01] <danielfilho> this scrollbar thing reminds me ie6 saga.
# [20:01] <Neiluj> paul_irish: I'm ready to push, just need to know about this
# [20:01] <danielfilho> but i like it.
# [20:01] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
# [20:01] <danielfilho> sorry. I'm working as hell today. so I come here and try to summerize everything :D
# [20:01] * Joins: miketayl_r (~miketaylr@206.217.92.186)
# [20:02] * miketayl_r is now known as miketaylr
# [20:05] * Joins: dgathright (~dgathrigh@nat/yahoo/x-zhbyykjlhreejnvu)
# [20:05] <paul_irish> Neiluj: what are you asking
# [20:05] <Neiluj> ".no-inputtypesrange" or ".no-inputtypes-range" ?
# [20:05] <Neiluj> about dashes
# [20:06] * Joins: Velanor (~Velanor@cpc7-harb9-2-0-cust230.perr.cable.virginmedia.com)
# [20:07] * Quits: miketaylr (~miketaylr@206.217.92.186) (Remote host closed the connection)
# [20:07] * Parts: Velanor (~Velanor@cpc7-harb9-2-0-cust230.perr.cable.virginmedia.com)
# [20:07] <paul_irish> hmm
# [20:07] * Joins: miketaylr (~miketaylr@206.217.92.186)
# [20:07] <paul_irish> no extra dash
# [20:07] <Neiluj> even if it's inside litterals ? it's like feature grouping
# [20:08] <Neiluj> ok for me, you tell me
# [20:09] <paul_irish> yeah
# [20:09] <paul_irish> no extra dash
# [20:10] * Joins: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125)
# [20:10] <tw2113> yikes, i should update my firefox on my craptop Winxp machine
# [20:10] <tw2113> it's only at 3.5 series
# [20:10] <Neiluj> ok
# [20:10] <thatryan> firefox is screwing with me today, keeps putting a huge gap margin up on top of body i cant find whyyyyyy
# [20:10] <tw2113> link?
# [20:11] <snover> thatryan: Does the first element in your body have a huge margin?
# [20:11] <thatryan> snover: no, no margin at all
# [20:11] <thatryan> and it is perfectly fine in chrome
# [20:11] <thatryan> tw2113: still offline right now
# [20:11] * Joins: nohk (~nohk@e180099119.adsl.alicedsl.de)
# [20:11] <snover> thatryan: it sounds familiar but I can’t remember exactly what or why.
# [20:11] * Quits: nohk (~nohk@e180099119.adsl.alicedsl.de) (Remote host closed the connection)
# [20:11] <alcuadrado> why does <!doctype html> triggers almost standard mode in ie6? casuality?
# [20:12] <thatryan> snover: lol thanks ;) if it comes to you, let me know!
# [20:12] <Neiluj> paul_irish: done, now I hit "Pull request" right ?
# [20:12] <paul_irish> ya
# [20:12] <snover> alcuadrado: IE6 doesn’t have a standards mode ;)
# [20:13] <tw2113> haha, IE6+standards=FAIL
# [20:14] <Neiluj> paul_irish: pulled
# [20:15] <paul_irish> thx
# [20:15] <Neiluj> tw2113: sorry, one line wasn't enough ;-)
# [20:15] <tw2113> was worth the shot
# [20:15] <mikesusz> thatryan - you using a cms or anything?
# [20:16] <Neiluj> mmh I already have improvement to add...
# [20:16] <thatryan> mikesusz: nope, straight html5 valid and all
# [20:16] <mikesusz> i noticed wordpress 3.1 puts the admin bar, even if you hide it with css it adds top padding to the body with !important
# [20:16] <mikesusz> ah
# [20:16] <tw2113> i disable the admin bar
# [20:16] <mikesusz> tw2113 - yeah i do now
# [20:20] <tw2113> firefox 3.6 doesn't utilize placeholder attributes right?
# [20:20] <Ms2ger> No
# [20:20] <tw2113> good, this jquery is working afterall, except in IE
# [20:20] <tw2113> i think IE is hating the jquery in general at the moment anyway, so stuff is likey getting broked
# [20:20] * Quits: miketaylr (~miketaylr@206.217.92.186) (Remote host closed the connection)
# [20:22] * Joins: masondesu (~Mason@c-75-64-233-135.hsd1.ms.comcast.net)
# [20:22] * Joins: miketaylr (~miketaylr@206.217.92.186)
# [20:27] * Quits: mahemoff (~mahemoff@74.125.57.60) (Quit: mahemoff)
# [20:27] * Joins: LynnMWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net)
# [20:29] * Joins: mahemoff (~mahemoff@nat/google/x-pciiagbqnzqredjq)
# [20:30] * Quits: LynnWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Ping timeout: 240 seconds)
# [20:31] * Quits: masondesu (~Mason@c-75-64-233-135.hsd1.ms.comcast.net) (Quit: masondesu)
# [20:33] <Neiluj> paul_irish: I made some changes, pulled again
# [20:33] <Neiluj> we can do Modernizr.applyClasses('audio video input inputtypes') now
# [20:33] * Quits: tw2113 (~tw2113asw@fedora/tw2113) (Quit: Leaving)
# [20:34] <paul_irish> baller.
# [20:34] <paul_irish> I'll probably extend it so you can do .applyClasses(jQuery.support)
# [20:36] <Neiluj> mmh not a bad idea indeed :)
# [20:37] <Neiluj> in my case, I needed a way to know if input range was supported for a very little tool I've made for the fun this afternoon
# [20:38] <Neiluj> I didn't even use modernizr for it but I remembered I never saw those classes and that could be really useful imo
# [20:38] * Quits: burg (~burg@c12.uaic.ro) (Read error: Connection reset by peer)
# [20:39] * Joins: antonkovalyov (~antonkova@75-101-56-240.dsl.static.sonic.net)
# [20:43] * Joins: cardona507 (~cardona50@cpe-98-150-150-230.hawaii.res.rr.com)
# [20:43] * Quits: cardona507 (~cardona50@cpe-98-150-150-230.hawaii.res.rr.com) (Client Quit)
# [20:43] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Quit: zzzzz)
# [20:43] <Neiluj> btw, the tool is a simple password generator http://zeedev.aaz.fr/pass/ if any of you have the need :)
# [20:43] * Joins: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com)
# [20:43] <Neiluj> you can grow the length with arrow keys, scroll wheels or ... input range
# [20:44] <felcom> thats neat
# [20:44] * Quits: techrush (~techrush@rrcs-173-198-32-131.west.biz.rr.com) (Remote host closed the connection)
# [20:44] <Neiluj> thx felcom ;)
# [20:45] * Quits: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it) (Ping timeout: 272 seconds)
# [20:49] * Joins: obert- (~obert@host22-201-dynamic.47-79-r.retail.telecomitalia.it)
# [20:57] * Joins: burg (~burg@c12.uaic.ro)
# [20:59] * Joins: felcom_ (~felcom@rrcs-71-43-19-2.se.biz.rr.com)
# [20:59] * Quits: felcom_ (~felcom@rrcs-71-43-19-2.se.biz.rr.com) (Read error: Connection reset by peer)
# [21:03] * Quits: mahemoff (~mahemoff@nat/google/x-pciiagbqnzqredjq) (Quit: mahemoff)
# [21:03] * Quits: felcom (~felcom@rrcs-71-43-19-2.se.biz.rr.com) (Ping timeout: 240 seconds)
# [21:04] * Joins: mahemoff (~mahemoff@nat/google/x-pfungpwxwupbuhks)
# [21:10] <Neiluj> http://w3fools.com/ :)
# [21:10] * Joins: tw2113 (~tw2113asw@fedora/tw2113)
# [21:10] <tw2113> woo, easy FF4beta updating
# [21:13] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Quit: Bye!)
# [21:13] * Joins: nimbupani (~Adium@c-24-22-131-46.hsd1.wa.comcast.net)
# [21:14] * Quits: mahemoff (~mahemoff@nat/google/x-pfungpwxwupbuhks) (Quit: mahemoff)
# [21:16] * Joins: Trisox (~Trisox@g31044.upc-g.chello.nl)
# [21:19] * Joins: mahemoff (~mahemoff@74.125.57.52)
# [21:21] * Parts: snover (~Adium@unaffiliated/snover)
# [21:22] <dgathright> http://blog.chromium.org/2011/01/more-about-chrome-html-video-codec.html
# [21:22] * Quits: Levis (~Levis@93-63-109-252.ip27.fastwebnet.it) (Remote host closed the connection)
# [21:25] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
# [21:28] <mikew3c> nimbupani: sorry, I didn't know youse was logging all my searches
# [21:28] <nimbupani> wat :/
# [21:29] <mikew3c> whencanIuse
# [21:29] <nimbupani> :D :D :D :D :D
# [21:30] <nimbupani> i hope fyrd makes more such esoteric search terms public!
# [21:30] * Joins: Ramosa (Ramosa@unaffiliated/harald/x-000000001)
# [21:30] <nimbupani> http://sex.partofhtml5.com/
# [21:31] * Quits: rakeshpai (~rakeshpai@59.162.86.164) (Quit: rakeshpai)
# [21:31] <mikew3c> heh
# [21:32] <nimbupani> I think partofhtml5.com is alex sexton's work :)
# [21:33] <tw2113> he seems like a character
# [21:34] <danielfilho> OMFG
# [21:34] <danielfilho> inline-block doesn't work on IE
# [21:34] <danielfilho> GIMME GATES' NUMBER NOW!
# [21:34] <mikesusz> danielfilho - 9?
# [21:34] <danielfilho> 8
# [21:34] <tw2113> it should take a number for things that don't work in IE
# [21:34] <mikesusz> this is news? ;)
# [21:34] <danielfilho> i never needed to use it there.
# [21:35] <tw2113> hmmm interesting, very interesting "You can now use SVG as the source of an <img> tag. You can even animate them with SMIL. And you can also use SVGs as backgrounds in CSS."
# [21:35] * Joins: cocoadaemon (~cocoadaem@2a01:e35:8a99:e90:20d:93ff:fe3b:868c)
# [21:35] <mikew3c> "something doesn't work in IE" is like a news story "Dog Bites Man" … something that works in IE is like a news story "Man Bites Dog"
# [21:36] <mikesusz> with as much time as i've spent trying to figure out filter: lately, it actually can do a lot of stuff
# [21:36] <mikesusz> it's just extremely difficult
# [21:38] <Neiluj> got to go, have a nice we guys
# [21:39] * Quits: Neiluj (~Julien@195.200.175.214) (Quit: Neiluj)
# [21:40] <alcuadrado> This game is sooo awosome http://redshootinghood.info =)
# [21:41] * Quits: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net) (Quit: Leaving...)
# [21:42] * Quits: noxxten (noxxten@adsl-93-90-217.owb.bellsouth.net)
# [21:45] <tw2113> damn, i can't get the svg stuff working yet
# [21:47] * Quits: cgcardona (~cgcardona@cpe-98-150-150-230.hawaii.res.rr.com) (Ping timeout: 276 seconds)
# [21:50] <tw2113> ooh "Firefox 4 includes the changes required to help improve your privacy online by closing a decade-old hole in CSS rules that let any website query your browsing history. These changes have also been picked up by WebKit-based browsers and we?ve heard rumors that IE 9 might pick up this important change as well."
# [21:53] * Joins: shipit (~sumeet@adsl-63-200-129-20.dsl.snfc21.pacbell.net)
# [21:53] * Joins: jamesarosen (~jamesaros@204.28.122.178)
# [21:55] * Joins: mokush (~quassel@188.24.40.254)
# [21:55] <antonkovalyov> nimbupani, paul_irish: could you please merge my latest pull request to html5boilerplate?
# [21:55] <antonkovalyov> i have more coming :)
# [21:56] <mokush> you guys know if weston (or somebody else) does any work on a new webforms2?
# [21:57] * Quits: jetienne (~jerome@ivr94-6-82-230-255-246.fbx.proxad.net) (Remote host closed the connection)
# [22:00] * jacine is now known as jacine|afk
# [22:01] * Joins: Mussious (~kamil@dfv192.neoplus.adsl.tpnet.pl)
# [22:02] * Joins: bios (~bios@shup.com)
# [22:03] * Quits: miketaylr (~miketaylr@206.217.92.186) (Quit: miketaylr)
# [22:04] * Joins: thatryan (~thatryan@adsl-99-24-217-119.dsl.pltn13.sbcglobal.net)
# [22:05] * Quits: lukegalea (~lukegalea@tor.office.avidlifemedia.com) (Quit: lukegalea)
# [22:07] * Quits: Ms2ger (~Ms2ger@91.181.253.59) (Quit: nn)
# [22:08] <davidmurdoch> $.html([$element,$element]) doesn't work. interesting.
# [22:08] * Quits: dguttman (~dguttman@gige.bur.digisynd.com) (Quit: ...)
# [22:09] * Joins: dguttman (~dguttman@gige.bur.digisynd.com)
# [22:09] <davidmurdoch> er, i mean $("#myElement").html( [$element, $element] ) doesn't work
# [22:10] * umode is now known as chipotle
# [22:12] * Joins: miketaylr (~miketaylr@206.217.92.186)
# [22:14] * Quits: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar) (Remote host closed the connection)
# [22:15] * Joins: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
# [22:15] * Parts: alcuadrado (~alcuadrad@201-213-128-62.net.prima.net.ar)
# [22:21] * Joins: sulcalibur (~sulcalibu@cpc10-enfi15-2-0-cust120.hari.cable.virginmedia.com)
# [22:22] <tbranyen> davidmurdoch: well... why would that?
# [22:22] <mokush> davidmurdoch: well jquerys html works like innerhtml
# [22:22] <tbranyen> i'm missing something
# [22:22] <mokush> davidmurdoch: so you can only place place strings inside, from what I know.
# [22:25] <davidmurdoch> mokush: not true
# [22:25] <davidmurdoch> oops: $("#myElement").append( [$element, $element] )
# [22:26] <davidmurdoch> i mean append, not html
# [22:26] <mokush> davidmurdoch: that's a different thing.
# [22:27] <paul_irish> .empty().append( $([whatever,whatever]) );
# [22:27] <mokush> as append supports both nodes, elements, jquery objects.
# [22:27] <davidmurdoch> thank paul, I ended up figuring it out
# [22:27] <paul_irish> sure ya did
# [22:28] <davidmurdoch> haha. didn't yayquery talk about wanting a method that does empty().append() in one go?
# [22:28] <mokush> so paul_irish, when are you guys removing flash?
# [22:29] <paul_irish> http://blog.chromium.org/2011/01/more-about-chrome-html-video-codec.html
# [22:29] <paul_irish> $.fn.emptyAndAppend = function(){ return this.empty().append.call(this,arguments); }
# [22:29] <paul_irish> there u go david :)
# [22:30] * Quits: alrra (592f527d@gateway/web/freenode/ip.89.47.82.125) (Quit: Page closed)
# [22:30] <davidmurdoch> too verbose.
# [22:31] <davidmurdoch> :-)
# [22:31] <paul_irish> $.fn.NO_U
# [22:32] <davidmurdoch> I now have nothing to say. How do you come back from that?
# [22:32] * Joins: Michael (~disney@unaffiliated/jabberwock)
# [22:34] <nimbupani> thats the point
# [22:35] <mokush> paul_irish is such a bully
# [22:37] * Joins: LongBeach (~mike@AFontenayssB-152-1-61-106.w82-121.abo.wanadoo.fr)
# [22:37] <davidmurdoch> Zoolander reference coming up: Earth to Divya: duh; I knew that.
# [22:37] <antonkovalyov> paul_irish, nimbupani: russian translations are done
# [22:39] <nimbupani> woah neet antonkovalyov
# [22:40] <antonkovalyov> i have one pull request there thought before i can merge my translations branch to master
# [22:40] <antonkovalyov> though*
# [22:41] <antonkovalyov> now i need this small tiny jquery bugfix to actually happen. sloooooowwww
# [22:42] <Michael> Which bug is that?
# [22:42] <antonkovalyov> Michael, http://bugs.jquery.com/ticket/7945#propertyform
# [22:42] <Michael> thanks
# [22:42] <antonkovalyov> gonna do another pull request real quick, maybe it will speed things up
# [22:43] * Joins: murz (~mmurraywa@wcproxy.msnbc.com)
# [22:44] <Michael> antonkovalyov, It seems that instead of being held up you could use a different name for the key
# [22:44] <Michael> like j-query
# [22:44] <antonkovalyov> antonkovalyov, i do use a different name for the key but the bug is still a bug
# [22:44] <Michael> true
# [22:45] <Michael> just as long as it's not preventing you from moving forward
# [22:45] <Michael> Doesn't seem like a showstopper
# [22:45] <Michael> but yeah
# [22:45] <antonkovalyov> hah, i just messaged myself above
# [22:45] <Michael> I know lol
# [22:45] <antonkovalyov> Michael, we use latest stable release so even if bug is fixed in master I won't see it right away
# [22:46] <Michael> I see
# [22:46] <Michael> We're still on 1.4.2 I believe, because we use WebDriver for automated qUnit tests - and > 1.4.2 breaks in webdriver
# [22:46] <antonkovalyov> Michael, do you happen to know where was that page describing how to properly name branches for pull requests/bugs for jquery?
# [22:46] <Michael> I do not :/
# [22:48] * Quits: Mussious (~kamil@dfv192.neoplus.adsl.tpnet.pl) (Quit: Ex-Chat)
# [22:51] * Quits: peol (~andree@unaffiliated/peol) (Quit: Bye!)
# [22:53] * Joins: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net)
# [22:53] * Quits: peol (~andree@h55eb1e56.selukra.dyn.perspektivbredband.net) (Changing host)
# [22:53] * Joins: peol (~andree@unaffiliated/peol)
# [22:54] <paul_irish> i do
# [22:54] * Joins: rwaldron (~rwaldron_@64.119.153.2)
# [22:54] <paul_irish> rwaldron whats the gist with jquery pull req instructions
# [22:54] <paul_irish> does bot have a factoid for it
# [22:55] <paul_irish> antonkovalyov needs it'
# [22:55] * Quits: Pewpewarrows (~Pewpewarr@75-145-93-41-WashingtonDC.hfc.comcastbusiness.net) (Quit: Leaving)
# [22:55] <rwaldron> antonkovalyov, https://gist.github.com/672714
# [22:55] <antonkovalyov> ty
# [22:55] <paul_irish> txhthxh
# [22:55] <rwaldron> your welcome
# [22:55] <rwaldron> you're
# [22:55] <rwaldron> paul_irish, not that i know of, but there should be
# [22:56] <paul_irish> bot-t: jquerydevgist is https://gist.github.com/672714
# [22:56] <bot-t> paul_irish, Stored "jquerydevgist".
# [22:57] * Quits: mahemoff (~mahemoff@74.125.57.52) (Quit: mahemoff)
# [22:57] * Quits: Michael (~disney@unaffiliated/jabberwock) (Read error: Connection reset by peer)
# [22:58] * Quits: jamesarosen (~jamesaros@204.28.122.178) (Remote host closed the connection)
# [23:00] * Joins: jamesarosen (~jamesaros@204.28.122.178)
# [23:07] * Quits: LynnMWallenstein (~Lynn@pool-74-107-70-172.bltmmd.fios.verizon.net) (Quit: Leaving)
# [23:08] * Quits: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net) (Remote host closed the connection)
# [23:09] * Joins: twitterhapy (~twitter@h55eb1e56.selukra.dyn.perspektivbredband.net)
# [23:12] <danielfilho> well
# [23:12] <danielfilho> good weekend for all
# [23:12] <danielfilho> see you
# [23:13] <Trisox> hooooooooooooooi
# [23:15] * Quits: mikew3c (~MikeSmith@EM114-48-174-137.pool.e-mobile.ne.jp) (Quit: Deyr fé deyja, frændr deyr, sjálfr et sama)
# [23:20] * Joins: Dorward (~Dorward@94-192-4-225.zone6.bethere.co.uk)
# [23:20] <Dorward> Is there any documentation about backwards compatibility support for the HTML5 short meta charset code?
# [23:21] <paul_irish> YES.
# [23:21] <paul_irish> ?g github html5 boilerplate commits master
# [23:21] <bot-t> paul_irish, Xac/Rails-3-HTML5-Boilerplate - GitHub - https://github.com/Xac/Rails-3-HTML5-Boilerplate
# [23:21] <paul_irish> COME ONNNNNN google
# [23:21] * Quits: sulcalibur (~sulcalibu@cpc10-enfi15-2-0-cust120.hari.cable.virginmedia.com) (Quit: Leaving...)
# [23:23] <paul_irish> Dorward: read this http://blog.whatwg.org/the-road-to-html-5-character-encoding
# [23:23] <nimbupani> ha ha ha ha
# [23:23] * Quits: mduncan (~mduncan@216.195.221.2) (Quit: Leaving)
# [23:25] <Dorward> Thanks
# [23:28] * Joins: mikew3c (~MikeSmith@EM114-48-174-137.pool.e-mobile.ne.jp)
# [23:29] * Joins: joemsak (~hubble@173-165-61-105-Illinois.hfc.comcastbusiness.net)
# [23:30] <antonkovalyov> aaaand done http://bugs.jquery.com/ticket/7945#comment:2
# [23:31] <antonkovalyov> that was not "real quick" though, haha
# [23:31] * Quits: hubble (~hubble@dsl081-150-127.chi1.dsl.speakeasy.net) (Ping timeout: 276 seconds)
# [23:31] * joemsak is now known as hubble
# [23:38] * Quits: miketaylr (~miketaylr@206.217.92.186) (Quit: W3SCHOOLS 4 LYFE)
# [23:38] <paul_irish> http://webkit.org/blog/1424/css3-gradients/
# [23:39] <paul_irish> ?fpi
# [23:39] <bot-t> fucking paul irish!
# [23:41] <antonkovalyov> ?Douglas Crockford
# [23:41] <bot-t> The Immutable Singleton
# [23:46] * Joins: mahemoff (~mahemoff@87-194-3-205.bethere.co.uk)
# [23:55] * Quits: mahemoff (~mahemoff@87-194-3-205.bethere.co.uk) (Quit: mahemoff)
# [23:55] * Quits: mokush (~quassel@188.24.40.254) (Remote host closed the connection)
# Session Close: Sat Jan 15 00:00:00 2011

The end :)